What is the product of a Grignard reaction? O A 2° or 3° amine with the nitrogen bound to the R group from the Grignard reagent. A six-membered ring. O An ester that incorporates the R group from the Grignard reagent. O A 2° or 3° alcohol with the a carbon bound to the R group from the Grignard reagent. Question 5 How do you prepare a Grignard reagent? O React an organohalide with magnesium metal. React a carbonyl-containing compound with an organohalide O Mix an organohalide with molten magnesium. React a carbonyl containing compound with magnesium metal.

What is the product of a Grignard reaction? O A 2° or 3° amine with the nitrogen bound to the R group from the Grignard reagent. A six-membered ring. O An ester that incorporates the R group from the Grignard reagent. O A 2° or 3° alcohol with the a carbon bound to the R group from the Grignard reagent. Question 5 How do you prepare a Grignard reagent? O React an organohalide with magnesium metal. React a carbonyl-containing compound with an organohalide O Mix an organohalide with molten magnesium. React a carbonyl containing compound with magnesium metal.

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter10: Alcohols

Section10.7: The Pinacol Rearrangement

Problem GQ

See similar textbooks

Similar questions

ОН Type of reaction 1-Propanol is heated Type of reaction H+, Heat IZ + t 1- NaOH
1. Complete the following reactions. a. b. C. N HIN 1. LiAlH4 2. H₂O* 1. NaAlH4 2. H₂O* 1. LiAlH4 2. H₂O*
We know that acetals hydrolyze to the carbonyl compound and the alcohol that formed it What would be the product of the following hydrolysis reaction? H,0* Select one: HO to. HO HO. b. H. H. C. HO HO. OH
Complete the following reaction sequence with the missing major organic products. CH, NaOH CH,CH,CH,CHCH,CHCH,CEN H20 NaOH H,0 CH,CH,
There are THREE parts. Please circle the final answer! Which reagent would not react with a carboxylic acid? O a. LIAIH4 b. NaOH C. KMN04 d. ВНЗ/THF An aldehyde cannot be made directly from this type of compound a. carboxylic acid O b. alcohol C. ester O d. acid chloride
Which one is an acetal?
QUESTION 7 What should be used to complete the following reaction? H₂C. O CH3CH₂CH₂O, CH3CH₂CH₂OH 1) CH3CH₂CH₂OH, NaBH4 2) H30* O NaOH, H₂0 O 1) CH3CH₂CH₂MgBr, ether 2) H30* H₂C H₂C .OH
Draw the structure of the organic product formed when the given compounds undergo the three-step reaction sequence indicated. Select Draw Rings More Erase C Br 1. NaOC,H5. C,H5OH 2. NaOH, H2O 3. H3O*, heat
How can you monitor the progress of a Grignard reaction? O Use TLC to monitor the concentration of magnesium metal. O Titrate the reaction mixture with nitric acid. Use TLC to monitor the consumption of the carbonyl-containing compound. O Add water and see if the mixture reacts with it. Question 2 What should you avoid allowing into the reaction mixture when preparing and using a Grignard reagent? Omagnesium Owater O organic solvents Oorganohalides
The product of the reaction between an ester and the Grignard reagent is an alcohol and it forms how many new C-C bonds _?
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Identify the most important aldehyde and ketone from Section 14.4 on the basis of amount used, and list at least one characteristic for each that contributes to its usefulness.