Write names for the following coordination compounds: |(a) [Cd(en)Cl] |(b) KĄ[Mn(CN)6] (c) [Cr(NH3)s(CO3)]CI (d) [Ir(NH3)4(H2O))2](NO3)3

Q: The complex [Co(NH3)6]Cl3 is yellow orange while [Co(OH2)3F3] is blue. Suggest an explanation for…

A: The colour shown by the complexes are the complementary colours of the wavelength of light absorbed.…

Q: Give the systematic name for the following coordination compound: [NiCl₄]²⁻

A: [NiCl₄]²⁻ The above coordination compound systematic name is, Tetrachloronickelate (II) ion   A…

Q: Illustrate the concepts of Transition-Metal Complexes?

A: Transition metal complexes are also named as coordination compounds. These complexes involve ions of…

Q: [Cr(H₂O)₆]²⁺ is violet. Another CrL₆ complex is green.Can ligand L be CN⁻? Can it be Cl⁻?…

A: Given: [Cr(H₂O)₆]²⁺

Q: When cobalt(II) chloride is treated, under certain condition, with the bidentate ligand,…

A: A metal possesses two types of valencies -  primary and secondary. The combining power of a metal…

Q: [Cr(H2O)6] 2+ is violet. Another CrL6 complex is green. Can ligand L be CN-? Can it be Cl-? Explain.

A: The octahedral splitting energy of transition elements is the difference in the energy of the…

Q: Sketch the structure of all possible isomers of a coordination compound of the type (MAA)3 as in the…

A: Isomerism :- The phenomenon of existence of compounds with same molecular formula but different…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which a metal atom or ion forms coordinate bonds with the…

Q: A complex, ML62+, is violet. The same metal forms a complex with another ligand, Q, that creates a…

A: Given: The complex given is  This complex is violet. The metal gets attached to the weak field…

Q: Explain the differences between high-spin and low-spin metal complexes.

A: Complexes with weak field ligands have the same number of unpaired electrons as the free metal ion…

Q: In the coordination compound (NH4)2[Fe(OH2)F;], the e is octahedrally coordinated. (a) Based on the…

A: a) The given compound is (NH4)2[Fe(OH2)F5] or [Fe(OH2)F5]2-. The oxidation state of Fe is +3 and it…

Q: Sketch the structure of the complex in each of the follow- ing compounds and give the full compound…

A: a) The Cis-[Co(NH3)4(H2O)2](NO3)2 complex is cis isomer that means the same ligands come on the same…

Q: Both H2O and ethylenediamine (en) have two nonbonding pairs of electrons. Why can en act as a…

A:

Q: the coordination compound Rb2[Cr(O)Cls] (one oxide ligand and five chloride ligands). a. Determine…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: Explain the terms diamagnetic and paramagnetic NiCl2(PPh3)2 is a green paramagnetic solid, while cis…

A: If a compound have unpaired electrons in its orbital, then the compound is known as paramagnetic in…

Q: why do some d-block elements form colored complexes with various ligands

A: in complexes of the transition metals the D orbitals do not all have the same energy. the pattern of…

Q: 7. For an octahedral transition metal complex with maximum absorba wavelength of 580 nm, calculate…

A: The relation between the wavelength absorbed and the color reflected is based on the complement of…

Q: what is the maximum number if unpaired d electrons that an octahedral transition mental complex can…

A: The question is based on the concept of coordination chemistry. We have to identify maximum unpaired…

Q: Compare the ligand field strengths of CO and Cl, in terms of the types of bonds in which they can be…

A: CO is Sigma donor and pi acceptor ligand while Cl is only Sigma donor ligand .thus there type of…

Q: Assign a systematic name to the following coordination compound. Compound Name Li[RhF6|

A:

Q: Give 5 examples of metal coordination complexes and enumerate their importance

A: A question based on coordination complexes that is to be accomplished.

Q: Let us consider the following coordination complexes: [Fe(CN6)]3- Deduce from these electronic…

A: Crystal field splitting The splitting of degenerate d-orbitals in presence of ligands is called…

Q: Two Fe(II) complexes have low spin but different ligands. The solution of one is green, while the…

A: Given:- Two Fe(II) complexes have low spin but different ligands. The solution of one is green,…

Q: How is Ao defined for octahedral transition metal complexes?

A:

Q: b) For each of the following pairs, identify the molecule that is more likely to act as a ligand in…

A: b)      We have pair of ions or molecules in both parts , we have to predict one which can act as…

Q: A complex of the type [M(AA)2X2]n+is known to be optically active. What does this indicate about the…

A: An optically active [M (AA) 2X2] n+ structure must be cis-octahedral in nature because, trans…

Q: A coordination compound of ruthenium, [Ru(NH3)4Cl2]Cl, has shown some activity against leukemia in…

A: Generally in a coordination complex, a central metal atom (usually transition metal) is bonded to…

Q: Let us consider the following coordination complexes: [Fe(CN6)]3- Given that the chloride ion and…

A: The given coordination complex is a cyanide containing complex, and cyanide is a strong field…

Q: Indicate the likely coordination number of the metal in each of the following complexes: (a)…

A: Coordination number is the sum of ligand atoms attached to the central atom. That means the ligands…

Q: (c) Explain crystal field splitting in the case of tetrahedral complexes.

A: Crystal field splitting in tetrahedral complexes:

Q: Using crystal field theory, prove [NiCl4]2¯ is a tetrahedral paramagnetic complex.

A: Crystal field theory ia an electrostatic model which considers the metal-ligand bond to be ionic…

Q: Use your knowledge of electronic transitions in coordination compounds to justify why the compound…

A: If a sample absorbs all wavelengths of visible light, none reaches our eyes from that sample, and…

Q: 7. For an octahedral transition metal complex with maximum absorbance at a wavelength of 580 nm,…

A:

Q: Explain the bonding in coordination compounds in terms of Werner's nostulate

A:

Q: The coordination complex [Cr(CO)6] forms colorless,diamagnetic crystals that melt at 90 °C. (a) What…

A: (a)

Q: What is required of Lewis bases to act as ligands in coordination compounds?

A: Lewis base is a species which can donate electron pair to a Lewis acid.

Q: The complex ion [Co(CO3)3]3-, an octahedral complex with bidentate carbonate ions as ligands, has…

A: (a)

Q: Give the systematic name for the following coordination compound or complex ion: Cs,[CUCI,]

A: We have to give the name for given compound.

Q: Give the IUPAC name for this coordination compound. [Cr(H, O),CIJSO4

A: Write IUPAC name of the given coordination compound-

Q: A certain first-row transition metal ion forms many different colored solutions. When four…

A: During the formation of octahedral compounds, the d-orbital electrons can arrange in two different…

Q: When cobalt(II) chloride is treated, under certain condition, with the bidentate ligand,…

A: Coordination number is defined as the number of ligands that are attached to a metal in a complex…

Q: When cobalt(II) chloride is treated, under certain condition, with the bidentate ligand,…

A: Coordination number: When the metal ion in a complex is directly bonded or attached to ligand donor…

Q: [NİCI2(PPH3)2] is paramagnetic while [PtCl2(PPH3)2] is diamagnetic, what are the possible structures…

A: Though Ni(II) and Pt (II) are both d8 system, Ni complex is tetrahedral, whereas Pt complex is…

Q: A. Draw MX4Y2 where “M” is the metal and “X” and “Y” are ligands. Draw the “Y” ligands trans. Do not…

A: 5-membered ring is less flexible that 8-membered ring