Why are 2-nitrobenzoic acid and 2-chlorobenzoic acid stronger acids than benzoic acid? Aromatic Side-Chain Oxidation: o-Chlorobenzoic Acid from o-Chlorotoluene
Q: Which of the following reaction uses the reagent m-chloroperoxybenzoic acid? a Epoxidation b…
A: Which one of the following is correct
Q: Resonance structure of methyl phenyl thioether and Benzamide
A: Introduction : We need to draw resonance structures of methylthioether and benzamide .
Q: Which compound gives brick red precipitate of cuprous oxide with Benedict's solution? * a.…
A: Ketones will give negative test to Benedict solution.
Q: Explain the mechanism of electrophilic aromatic substitution ?
A: Electrophile, E+ is the e- deficient species. Aromatic ring consists of Π e- and therefore acts as a…
Q: Explain why pyridine N-oxide G can undergo nucleophilic aromatic substitution with nucleophile Nuc–…
A: Pyridine-N-oxide undergoes both electrophilic and nucleophilic substitution reactions as it has…
Q: Why is cycloprop-2-enone more polar than cyclopropanone?
A: Aromaticity : Huckel's rule: Any organic compound to obey aromatic character 1. It should be…
Q: Give reasons :(a) n-Butyl bromide has higher boiling point than f-butyl bromide.(b) Racemic mixture…
A: (a) n-Butyl bromide has a higher boiling point than t-butyl bromide. Reason: n-butyl bromide is a…
Q: Name and Draw the structures of all possible chemical (Electrophilic aromatic substitution)…
A:
Q: What are the infrared absorption frequency characteristics that would distinguish the following…
A: The inspecting of an unknown compound by its molecular formula is done by calculating the index of…
Q: . Compare the acidity of alcohols, phenols, and carboxylic acid of comparable molecular weights. 2.…
A: Answer - 1. The acidity of a carboxylic acid is higher than alcohols and even phenols. carboxylate…
Q: Draw resonance contributors to show why pyridine-N-oxide is more reactive than pyridine toward…
A: Electrophilic substitution reaction (ESR) is a type of reaction in which the electrophile gets…
Q: 2. Name and Draw the structures of all possible chemical (Electrophilic aromatic substitution)…
A:
Q: Propylene oxide is a chiral molecule. Hydrolysis of propylene oxide gives propylene glycol, another…
A: Concept introduction: An asymmetric carbon atom is represented as a cross in Fisher projection. The…
Q: Acyclovir is an effective antiviral agent used to treat the herpes simplex virus. (a) Draw the enol…
A: a. The enol form of acyclovir is shown in Figure 1. The enol form of acyclovir follows Huckel's…
Q: Can pyridine form a diazonium salt and can quinoline and isoquinoline undergo electrophilic…
A:
Q: Starting with Benzene (or naphthalene or biphenyl) Show a sequence of 3 electrophilic aromatic…
A: Benzene is an aromatic compound. The molecular formula of benzene is C6H6. It contains three double…
Q: Which of the following statements about an -NH2 group is FALSE? a. meta director b. activator…
A:
Q: Name and Draw the Phenol of all possible chemical (Electrophilic aromatic substitution) reactions of…
A: The answer is given as follows
Q: Can you explain why 1-phenylpropan-2-ol undergoes skeletal rearrangement when treated with…
A: Protonation of alcoholic oxygen Loss of leaving group leading to the formation of carbocation…
Q: 1. a. 4-methoxybenzoic acid is less or more polar than 4-methoxyacetophenone? explain why (WITHOUT…
A: More the number of Electronegative groups like halogens , oxygen , nitrogen develops the polarity…
Q: Rank the following compounds from greatest tendency to least tendency to undergo nucleophilic…
A: Concept introduction: Electrophilic aromatic substitution takes place when an electrophile displaces…
Q: Three arene oxides can be obtained from phenanthrene. a. Draw the structures of the three…
A:
Q: Name and Draw the structures of all possible chemical (Electrophilic aromatic substitution)…
A: Applying fredalcraft reaction.
Q: Draw the structure of each compound.(a) o-nitroanisole (b) 2,4-dimethoxyphenol (c) p-aminobenzoic…
A: Hello. Since your question has multiple sub-parts, we will solve first three sub-parts for you. If…
Q: Which of the following is the correct order of decreasing reactivity towards electrophilic aromatic…
A:
Q: Why is butanoic acid stronger acid than phenol?
A: Acid is a substance donate H+ ions Strength of Acidity depends on 1) - I effect and -R effect 2)…
Q: a. 4-methoxybenzoic acid is less or more polar than 4-methoxyacetophenone? explain why (WITHOUT…
A: More electronegative elements make the Compound polar due to Differences in electronegativity.
Q: Name and Draw the structures of all possible chemical (Electrophilic aromatic substitution)…
A:
Q: Explain the relevance pi* (antibonding) -molecular orbitals have in nucleophilic addition reactions…
A: Relavance of pi* antibonding orbital in nucleophilic addition reaction of carbonyl containing…
Q: What is the role of phosphoric acid in the synthesis of cyclohexene? it is an antioxidant that…
A:
Q: Cyclohexene can undergo strong oxidation with potassium permanganate in acidic solutions and yield a…
A: Cyclohexene can oxidize into adipic acid on react with potassium permanganate in acidic solutions
Q: Three arene oxides can be obtained from phenanthrene. a.Draw the structures of the three…
A: a). Structures of phenanthrene oxides:
Q: When phenylbenzoate is heated with aqueous acid solution, the products formed are: A. 2 moles of…
A:
Q: Draw the structure of organic compound m-t-butylanisole Name and Draw the structures of all possible…
A: In this question, we have to find out the correct answer of given problem by the help of the…
Q: Name and draw the structures of all the possible chemical (electrophilic aromatic substitution)…
A: The substitution reaction on the benzene ring of acetophenone occurs via electrophilic aromatic…
Q: Rank the aryl halides in each group in order of increasing reactivity in nucleophilic aromatic…
A:
Q: Which of the following aromatic compound has a hydroxy substitution? a Aniline b Cresol c…
A:
Q: Rxn 1: prop-1-yne reacts with H2 and palladium on carbon Rxn 2: Butan-2-one reacts with sodim…
A: Provided the answer for the first three questions according to Bartleby guidelines.
Q: Identify the aromatic compound which cannot undergo the Friedel-Crafts reaction with CH3Cl/AlCl3.
A: Compound (C) cannot undergo the Friedel-Crafts reaction with CH3Cl/AlCl3. Reason : Due to…
Q: What reactions and reagents can be used to make phenol from benzene if electrophilid aromatic…
A: Without electrophilic aromatic substitution Reaction phenol can be prepared from benzene by help of…
Q: Rank the aryl halides in each group in order of increasing reactivity in nucleophilic aromatic…
A: Nucleophilic aromatic substitution (SNar) reaction favors the addition of nucleophile on the…
Q: Which are the products of the Cannizzaro reaction * Carboxylic acid and ketone Carboxylic acid and…
A:
Q: Name and Draw the structures of all possible chemical (Electrophilic aromatic substitution)…
A:
Q: In the following pairs of compounds, which is the most acidic? Benzoic acid and 4-nitrobenzoic acid…
A:
Q: Draw the structure of each compound. (a) o-nitroanisole (b) 2,4-dimethoxyphenol (c) p-aminobenzoic…
A: The structure of the compound can be written by the IUPAC name. First of all, we draw the main…
Q: Name and Draw the structures of all possible chemical (Electrophilic aromatic substitution)…
A: Note - Since you have posted a question with multiple sub-parts, we will solve the first three…
-
Why are 2-nitrobenzoic acid and 2-chlorobenzoic acid stronger acids than benzoic acid?
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 1 images
- What reactions and reagents can be used to make phenol from benzene if electrophilic aromatic substitution reactions are excluded and benzene is the only source of carbon?Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.Account for the fact that treating propenoic acid (acrylic acid) with HCl gives only 3-chloropropanoic acid.Several diamines are building blocks for the synthesis of pharmaceuticals and agro-chemicals. Show how both 1,3-propanediamine and 1,4-butanediamine can be prepared from acrylonitrile.
- Aspirin is the common name for the compound acetylsalicylic acid, widely used as a fever reducer and as a pain killer. Salicylic acid, whose name comes from Salix, the willow family of plants, was derived from willow bark extracts. In folk medicine, willow bark teas were used as headache remedies and other tonics. Nowadays, salicylic acid is administered in the form of aspirin which is less irritating to the stomach than salicylic acid. To prepare aspirin, salicylic acid is reacted with an excess of acetic anhydride. A small amount of a strong acid is used as a catalyst which speeds up the reaction. In this experiment, phosphoric acid will be used as the catalyst. The excess acetic acid will be quenched with the addition of water. The aspirin product is not very soluble in water so the aspirin product will precipitate when water is added. The synthesis reaction of aspirin is shown below: Actic anhydride 5 ml. Acetic acid Salicylic acid 28 Acetylsalicylie acid Procedure 1) Mix salicylic…Explain some carboxylic acids in order of decreasing reactivity?Explain why p-nitrophenol is more acidic than 4- nitrocyclohexanol?
- Which is more acidic, p-methylphenol or phenol? why? Why is water more acidic than ethanol but slightly less acidic than methanol? Explain the acidity trend of alcohols: 1>2 > 3What groups favor the nitration of benzene and what groups do not favor it?When trans-2-chloro-1-cyclohexanol is treated with a base, cyclohexene oxide is the product. However, when cis-2-chloro-1-cyclohexanol is treated with a base, the product is cyclohexanone. Why doesn’t the cis isomer yield the oxide?