When synthesizing acetals and ketals, what is the main driving force behind whether the reaction favors the carbonyl species or the acetal/ketal? A B C D the catalytic acid solvent temperature Le Châtelier's Principle

When synthesizing acetals and ketals, what is the main driving force behind whether the reaction favors the carbonyl species or the acetal/ketal? A B C D the catalytic acid solvent temperature Le Châtelier's Principle

Organic Chemistry: A Guided Inquiry

2nd Edition

ISBN:9780618974122

Author:Andrei Straumanis

Publisher:Andrei Straumanis

Chapter25: Enolate & Enol Nucleophiles

Section: Chapter Questions

Problem 16E

See similar textbooks

Related questions

Q: I (A) (D) Bu Ph PH Ph MCPBA then heat (B) PH minor product? Ph major

Q: From the following equations use the values of Ksp , Ka, and Kf to find the equilibrium constant for…

Q: Which intermediate is formed when propane reacts with bromine in presence of heat or light? CH₂CHCH,…

Q: Write balanced half-reactions for the following redox reaction: OH (aq) 412(s)+AsH3(g)+8 - 81…

A: Loss of an electron is Oxidation whereas Gain of an electron is reduction . On the other hand we…

Q: What is IUPAC name of this chiral molecule below? (Hir name). CI

A: In iupac nomenclature, first we have to select longest carbon chain which contains main functional…

Q: 9.7 What terminal alkyne and alkyl halide would you use to make the compound shown below?

A: Terminal alkynes have acidic hydrogens which is easily React with base to form salt.

Q: 9 You work with the following system: 2X - Yo At equilibrium, [Y]=3[X] If K=10, calculate the [Y] at…

A: Given reaction is : 2X (g) <-----------> Y (g) At equilibrium [Y] = 3[X] If equilibrium…

Q: 8. K=1,7 x 10-10 for the following system which represents the dissolving of silver chloride AgCl…

Q: Suppose a 500. mL flask is filled with 1.2 mol of CO, 0.20 mol of H₂O and 0.30 mol of CO₂. The…

Q: Case problem. Describe theoretical basis and procedure of Practical «The study of adsorption of…

A: Acetic acid is remains as Dimer in organic solvents like benzene,tolune,xylene. Adhesion to surface…

Q: Calculate pCd²+ at each of the given points in the titration of 50.00 mL of 0.0070 M Cd²+ with…

Q: xcept: s cannot be created or destroyed. lement is composed of very small particles d protons,…

A: Dalton's atomic theory includes: 1. Atoms cannot be created or destroyed 2. All atoms of a given…

Q: Maps ! 1 F1 O A 1 tion N HO H HO HO 11 2 * F2 W S CHO command X )( # 3 CH₂OH H LU 80 F3 E OH H D H…

Q: Which of these reactions does not occur? a) b) 0=0 c) NHCHs » & c 9)!.!. -OCH₂ CH₂OH ª)ča d) -CI…

Q: Determine whether the two structures in each of the following pairs represent enantiomers,…

Q: List the following bromides in order of their increasing reactivity as substrates in S N1 reactions:…

A: To list the following bromides in order of their increasing reactivity as substrates in S N1…

Q: Question 14 What is the electrophile in the following reaction? COI O III Oll CONV 00 Na SCH; II III…

Q: Why do you think polymers have no definite melting point?

A: Here we have to predict why ploymer have no definite melting point.

Q: Chemistry Whats the product to this? анд О осиз 1) на осно 2)H2O+ work up

Q: Two metals X and Y are mutually soluble in all proportions in the liquid state, but are completely…

A: We have find out the answer by drawing binary X-Y phase diagram.

Q: Oleic acid is a 18 carbon, monounsaturated fatty acid while linoleic acid is a 18 carbon,…

A: We have to compare melting point of oleic acid and linoleic acid

Q: Name the following compounds a) CH₂CH₂CH2CH3 b) CH3CH₂CHCHCH2CHCH3 I CH3 I C) CH₂ - CH₂ - CH2 - CH3…

Q: 4. What current is required to deposit on the cathode 5.00 g gold/h from a solution containing a…

A: Current = Charge/Time Q = I/t 1F =96500 C/mol Mass of 1 mole =Molar mass

Q: 1. How many iron atoms are there in 0.6 mol of iron? 2. Calculate the mass of a 0.8 mol of sulphur…

A: Mole concept: The number of molecules or atoms present in the one mole of the substance is equal to…

Q: C The normal boiling point of a liquid is 282 °C. At what temperature (in °C) would the vapor…

Q: Calculate the ΔG° (in kJ/mol) for the following reaction at 25.0℃. K^+1(aq) + Li(s) → K(s) +…

Q: Question 9 Name the compound shown below. 4-ethyl-3-methyl-5-nonyne 4-ethyl-3-methyl-5-octyne…

A: Question 9 Steps to name the compound, • Select the longest continuous carbon chain. The given…

Q: Which of the following is NOT true about VSPER THEORY? Select one: O a. predicts shapes based on…

A: The valence shell electron pair repulsion theory, commonly known as VSEPR theory (popularly called…

Q: p.10leau.co Maps ! 1 0 F1 A Pi option H N 2 HC OH F2 HC - OH HC-OH W S CH₂OH #3 X command 80 F3 E…

Q: O

Q: 3) what do you mean by ion exchange capacity? Provide the functional groups present for weakly…

Q: The word prokaryotic means

Q: Predict the product of this E2 elimination reaction. 1 ||| Br H3C Ph f Ph Ph H3C Ph Ph H CH3 Ph ||…

A: In case of elimination reaction , anti position of H and leaving group gets favourable . In this E2…

Q: 2. Write the product and the mechanism for reaction. Write the names of starting material and…

Q: please indicate next to each item if acid, neutral or basic

A: pH and hydronium ion concentration, [H3O+] are related as, pH = - log ([H3O+])

Q: Question 23 Give the reagents. OmCPBA O 1. BH3, 2. H2O2, NaOH OKMnO4 O 03 O 1. Hg(OAc)2, H₂O 2.…

A: Explanation :

Q: 1 way you could increase how quickly you could dissolve 0.5g of carbon dioxide gas into 100g of…

Q: Predict the product for the following reaction. CN will ON + NaCN

Q: What reagents are needed to accomplish the following transformation? CH3 O 1- Hg(OAc)2, H₂O 2-…

A: When an alkene undergoes hydroboration Oxidation Reaction, then an alcohol is formed according to…

Q: H H₂C Which statement is true about the Following pair of compounds? H H COOH NH₂ H₂C H H H COOH NH₂…

A: True statement regarding the following pair of compounds are.

Q: List the following bromides in order of their increasing reactivity as substrates in S N1 reactions:…

A: the following bromides in order of their increasing reactivity as substrates in S N1 reactions are…

Q: b)

Q: Which alkene is lower in energy? H ta O The alkene on the left is lower in energy The alkene on the…

Q: 6. Draw a plausible multi-step mechanism for the following transformation. Remember to use the…

A: This is an example of intramolecular SN2 reaction . In the first step, the H- abstract the H atom…

Q: If the wavelength used in an instrument is changed from 460 to 560 nm, Has the energy been increased…

A: Given : Initial wavelength (λ1) = 460 nm Final wavelengh (λ2) = 560 nm

Q: 28. What is the coefficient of H₂O when the following equation is properly balanced with smallest…

Q: QUESTION 9 What concentration would you get if you diluted 0.600L of 1.000 M copper(II) sulfate…

Q: 2. 3. HBr Br Br 'Br 1.4-BuOK 2. Hg(OAc)₂, H₂O 3. NaBH 1.1-BuOK 2. Hg(OAc)2, CH,OH 3. NaBH, 1. OK 2.…

Q: 6. How many moles of protons are present in 3.30 x 1018 sodium atoms? A 2.19 × 1043 ) B) 5.48 x 10-6

A: Mole is a standard unit for measuring large quantities of very small entities such as molecules.…

Q: Suppose some ice at 0ºC is placed into 50.00g of water at 25.5ºC. When the system reaches…

A: Here we are required to find the heat of fusion of ice Hf

Concept explainers

Aldehydes and Ketones

Aldehydes and ketones are organic compounds that have a carbonyl group, C = O, as their functional group. They both differ in the placement of this carbonyl group in their structures.

Question

When synthesizing
acetals and ketals, what
is the main driving force behind whether
the reaction favors the carbonyl species or
the acetal/ketal?
A
B
C
D
the catalytic acid
solvent
temperature
Le Châtelier's Principle

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Acetals and ketals

VIEW

Step 2: Characteristics of acetals and ketals

VIEW

Step 3: Driving force for the formation of acetals/ketals

VIEW

Step by step

Solved in 3 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

According to Le Chatelier's Principle, acetal product formation tends to INCREASE (rather than decrease) when more alcohol is added to the reaction mixture. True or False?
acidity and bascity of carboxylic acids and its derivatives
When synthesizing acetals and ketals, what is the main driving force behind whether the reaction favors the carbonyl species or the acetal/ketal? a the catalytic acid b solvent c temperature d Le Châtelier's Principle
Describe the trends in the acidityand physical properties of carboxylicacids, and explain how their acidityvaries with their substituents.
Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?
Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…
When butanoic acid and 18O-labeled methanol react under acidic conditions, what compounds are labeled when the reaction has reached equilibrium?
Explain why pentane-2,4-dione forms two different alkylation products (Aor B) when the number of equivalents of base is increased from one totwo.
Why is it important that we are very careful in how much acid is added to neutralize the reaction? (Only pick one answer) If the solution becomes very acid it can be harmful to the skin Too much acid will increase vanillyl alcohols water solubility and inhibit crystal formation Too much acid will decrease vanillyl alcohols water solubility and inhibit crystal formation Excess acid will deprotonate the vanillyl alcohol and inhibit crystal formation
Why is it not advisable to use aqueous hydrochloric acid in a Grignard reaction of a ketone? A) The Grignard reagent will react with the acid and cannot react with the ketone. B) The ketone will be protonated and will become unreactive. C) The ketone will form an unreactive enol. D) The Grignard reagent won't dissolve in aqueous solutions
The percent of electron withdrawing groups increase the acidity of alcohols * True False