What would be the most likely product of the reaction below? Take Qu O O HO ATP OH O Hexokinase OH OH OH OH -0° OH to OH OH P -O- HO C-C H₂ H OH C C- Ο H ADP
Q: Please please please answer super super fast
A:
Q: Select the 2 products of the following reaction: H3C CI 2 CH3CH2CH2NH2 CH3CH2CH2NH3C₁ H₂C CH3 ☐ HO…
A: 1 mol of CH3CH2CH2NH2 'Cl' is a leaving group so, one H of amide group and Cl form HCl and…
Q: dont provide handwriting solution .....
A: Step 1:Using the following equation:ΔG° = -RT ln(K)where:ΔG° is the standard Gibbs free energy…
Q: + In aqueous solution the Ag ion forms a complex with two ammonia molecules. Write the formation…
A: ( If you have any queries please feel free to ask me).
Q: What isotope results when Ti-48 undergoes alpha decay? Use the elemental symbol (with correct…
A: Step 1:When Ti-48 undergoes alpha decay, it loses an alpha particle, which is a helium-4 nucleus…
Q: kJ H2(g) + 0.502(g) → H₂O(g) AH-241.8- AS-44.5 J-mol¯-K-¹ mol So, mol¹KI החומר ??? H₂O(®) 130.7…
A:
Q: Part II. Batteries Complete the Battery diagram if you are provided with the following substances:…
A: (1) Given: Copper metal, Magnesium metal, Copper (II) Nitrate) and Magnesium Nitrate Required:…
Q: state why in lab,we have to count initial reading of maleic acid at 2.0g ,and initial reading of…
A: Approach to solving the question: lab experiments and basic organic chemistry Detailed explanation:…
Q: Past paper
A: (d) The given compound is Ampicillin.In the case of ampicillin, which is a penicillin derivative,…
Q: The energies of the valence d orbitals on the cobalt atom in the octahedral [CoF6] complex are split…
A: Step 1: Step 2: Step 3: Step 4:
Q: Suppose a 250. mL flask is filled with 1.8 mol of CO, 0.20 mol of H2O and 1.0 mol of H2. The…
A: Step 1: write the balanced chemical equation, CO(g) + H2(g) = CO2(g) + H2O(g). Step 2: From above…
Q: None
A: Step 1:Step 2:
Q: Can you explain step by step?
A: The integrated rate law (concentration vs. time) equation for a second order reaction is given by:…
Q: Can you explain it step by step? What if the problem is about kb instead?
A: Step 1:Balanced reaction isC6H5COOH (aq) + KOH(aq) → C6H5COOK(aq) + H2O(l)net ionic equation…
Q: how much energy is released when 1.24 moles of u-35 undergoes fission
A: Given n= 1.24A=235Na= 6.02 *10^23Weight= mole * massWeight = 1.24*235=291.4Number of atom in 1 g of…
Q: 6. What are the products of the following hydrolysis reactions? II-O H ILO H What are the products…
A: Detailed explanation:a.) The hydrolysis of ethyl 3-methylbutanoate, also known as ethyl isovalerate,…
Q: A buffer solution is prepared by dissolving 1.000 g of sodium acetate (CH3COONa) into 100.00 mL of a…
A: Step 1:Solution of weak acid and its conjugate base can only act like a buffer solution when ratio…
Q: 6. 10 L of an ideal gas is allowed to expand isothermally against a constant pressure of 1 atm until…
A: The objective of the question is to calculate the work done, heat transferred, change in internal…
Q: D Incorrect Your answer is wrong. In addition to checking your math, check that you used the right…
A: Step 1: Phosphoric acid (H3PO4) is a triprotic acid. It can donate up to three protons. When it…
Q: How many mL of 23.4% sodium chloride must be mixed with 250 mL of Normal Saline to make 3% NaCl?
A: The objective of this question is to find out the volume of 23.4% sodium chloride solution that…
Q: Please don't provide handwritten solution ...
A: NAD+ (Nicotinamide adenine dinucleotide) is a coenzyme that plays a crucial role in many biochemical…
Q: Suppose a 250. mL flask is filled with 1.8 mol of CO, 0.20 mol of H2O and 1.0 mol of H2. The…
A: First, we need to calculate the initial concentrations of the reactants and products. The…
Q: None
A: After the addition of 50.0 mL of KOH, the moles of KOH added equaled the initial moles of HClO.…
Q: ? The following table shows the values of ionization constants for a number of acids and bases at 25…
A: To calculate the ratio of the masses of the buffer components (ammoniaNH3 and ammonium chloride (…
Q: A 24.9 mL sample of a 0.373 M aqueous hypochlorous acid solution is titrated with a 0.342 M aqueous…
A: In this case, the acid is hypochlorous acid (HClO). It is a weak acid, which means it does not fully…
Q: Calculate the Gibbs free energy chain, delta G, for a reaction with k equals 1.7 times 10 to the…
A: Step 1: The standard Gibbs free energy (ΔG°) and equilibrium constant (K) are related to one another…
Q: 2. Name the following compounds using IUPAC nomenclature: (include R/S and E/Z designations when…
A: The IUPAC names for the given compounds are: a) For (4R, 5S)-4-bromo-3-methylcyclohexene: The…
Q: 12H2O⟶light6O2+24H++24e−.Write the equation for the other half-reaction, called the dark reaction,…
A: In this equation:CO2 - carbon dioxideH2O - waterATP - adenosine triphosphate (energy carrier…
Q: None
A: 1.) To deduce the code number for CH2FCF3, we need to understand how ASHRAE (American Society of…
Q: Partial Question 7 0.33 / 1 pts Which fundamental mechanisms appear in the reaction between…
A: Out of the choices listed, only Acid-Base is involved in the reaction between pyridinium…
Q: QUESTION 1 How many molecules of C2H5OH (density = 0.789 g/mL) are there in 50.0 mL? O 1.29 x 1023…
A: Hope this helps you.
Q: What is the product of reaction between 2-butyne with Na, NH3 and NH4Cl.
A: The reaction you're referring to involves 2-butyne undergoing a transformation in the presence of…
Q: Calculate the heat of reaction AH for the following reaction: CH4(g) + 202(g) →CO2(g) + 2H2O(g) You…
A: In the given reaction, CH4(g) + 2O2(g) → CO2(g) + 2H2O2(g), the bonds broken are in the reactants…
Q: None
A: The question asks which reactant in reaction with PCC will yield the given 1H-NMR.Shown below is the…
Q: 14 of 24 > Maxwell Determine the major organic product for the reaction scheme shown. 人 Br 1.2 Li,…
A: Step 1:This is a type of organometallic reaction. We can easily find the product by the below…
Q: What is the following compound's common name, which is a form of carbohydrate storage commo? CH₂OH…
A: The compound in the image is not lactose. Lactose is a disaccharide, a sugar formed by combining two…
Q: CHAPTER 9 EXERCISES (SS 9.17 The data in Table 9E.1 represent individual observa- ical process.…
A: Setting Up a Tabular CUSUM for the Mean (a)Here's how to set up a tabular CUSUM for the mean of the…
Q: Specify a synthetic scheme that would produce the compound shown above in the fewest steps possible.…
A:
Q: Incorrect Row 2: Your answer is wrong. In addition to checking your math, check that you used the…
A: To calculate the solubility of AgCl in pure water and in 0.34 M NaCN, we'll use the solubility…
Q: Potential energy QUESTION 12 Considering the following diagram, the number 2 corresponds to the ○…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: ↓ Draw the major product of this reaction. Ignore inorganic byproducts. 1. NaOCH2CH3, 25°C 2.…
A:
Q: Please give the appropriate reagents to complete the following synthesis. 1.? 2. ?
A: If any further queries regarding the mechanism then please let me know . I will clarify…
Q: None
A: Step 1: Step 2: Step 3: Step 4:
Q: b) Disaccharide E is a reducing sugar. It is hydrolyzed by an α-glycosidase enzyme, which means it…
A:
Q: Draw the steps to produce the product. Show the intermediaries. Reagents may have up to seven…
A: Here we have to show the steps to produce the product. Given reaction is:-Here reagents may have…
Q: Note: This is an algorithm question so each attempt will have unique set of measurements. The…
A: To determine the concentration of Vitamin C in a cranberry juice sample via titration, we need to…
Q: Organic Chemistry What is the product of the reaction in the image, and what does the starting…
A:
Q: Please provide mechansim. THF quetiapine 0.779-O-TBS CC(C)(C)[SI](C)(C)OCCOCCN1. HCI HCI
A: Describe the initial step of the reaction mechanism, focusing on the interaction between the epoxide…
Q: Predict the major products of this reaction: NaOH → ? A If there won't be any products, just check…
A: Step 1:The reaction proceeds via aldol condensatation mechanism which takes place in presence of an…
Q: Be sure to answer all parts. 0 Balance the following skeleton reaction, calculate E cell Cu+(aq) +…
A:
Step by step
Solved in 2 steps
- The following isomerization reaction, drawn using D-glucose as starting material, occurs with all aldohexoses in the presence of base. Draw a stepwise mechanism that illustrates how each compound is formed. сно сно сно CH2OH C=0 H- OH H- -OH но- H- но H- "OH но H- Но H- но H- H- -H- H20 H- HO- O- H- -O- H- -OH -O- OH ČHOH CH,OH ČH2OH ČH2OH (recovered starting material) D-glucose-OH + Hint: Hemiacetal formation OH HO CH3 Hint: Ketal formation +HO- 40- Hint: Ketal hydrolysis CH3 H Intramolecular hemiketal formation (-Identify which product corresponds to each number 1-4. OH Mes 1 OTS A OTS B {{ D TsCl imidazole Br S 8 E F LL F KBr DMF PMes DMF DMF H PMes "PMes PMey K PMe
- Complete the following synthesis using any reagents of your choice: OMeSimePhco, MeMe7NH Br Ome on sime sime 3 Me ? E NH Ph Come10:08 24 of 51 Done Which is true of the reaction? NAOH The reaction proceeds by an E2 mechanism, and the reaction rate is first order in alkyl bromide concentration and independent of hydroxide concentration. a. Ob. The reaction proceeds by an E2 mechanism, and the reaction rate is first order in both alkyl bromide and hydroxide concentrations. The reaction proceeds by an E1 mechanism, and the reaction rate is first order in alkyl bromide concentration and independent of hydroxide concentration. The reaction proceeds by an E1 mechanism, and the reaction rate is first order in both hydroxide concentrations.Draw Intermediate CH3OH₂+ protonation H H3C -0 H Q CH3OH deprotonation loss of H₂O elimination H3C :0 ÖH -CH3 Draw Intermediate CH3OH deprotonatio Please select a drawing or reag
- Isoleucine, another of the twenty amino acids found in proteins, is metabolized by a pathway that includes the following step. Propose a mechanism.Which one the following compounds on treatment with Grignard reagent followed by hydrolysis produce CH3CH2COOH? CH3CHO CH3COCH3 CO2 HCHOtaneon lo robio i guiwollol o n 6A. Draw all of the possible aldol addition and condensation products from the following reaction (you may ignore stereochemistry of aldol products but not condensation): NaOH OMe ? H3C CH3 H OMe Jobong oryloby vithob plam
- Step 2: A hemiacetal formation has a similar mechanism to the hydrate reaction, except 1 equivalent of alcohol is added instead of water. 1² R₂ R₁ LOR3 R₁ R₂ The hemiacetal reaction is also reversible and can also be catalyzed by either acid or base. Hemiacetals are not usually isolated, except in the formation of 5- and 6-membered rings, as often seen in carbohydrate chemistry. Identify the hemiacetal formed from the intramolecular cyclization of the molecule shown. OH H OH R3OH OH OH OH CH₂OH NaOH ?Draw the major product(s) for reaction of methyl pentanoate with: LIAIH4; then H30* LUnleadView Available Hint(s) Hemiacetals Н О 0 HO Acetals CH2OH OH HO OH CH2OH OH OH OH 0 + 0- Neither Reset Help