Q: Give the IUPAC name
A: Since,Rule of IUPAC-1) Longest chain as parent chain.2) Numbering start from those side where more…
Q: Determine the volume occupied by 0.582 moles of a gas at 15°C if the pressure is 622 mmHg.
A:
Q: Predict the products of the following reaction. If no reaction will occur, use the NO REACTION…
A: ince, Balanced reaction means that both side number of atom present in equal number. Thus,
Q: 25.00 mL of a H2SO4 solution with an unknown concentration was titrated to a phenolphthalein…
A:
Q: 5. Draw Lewis structures for each molecular formula. H A. C₂H4Cl₂ (two isomers) C-H--H-CI-CI A B.…
A: we have to draw the Lewis structures for the given formula
Q: Table 1: Concentrations of [H3O*] and [OH-] when various amounts hydrochloric acid (HCl, strong…
A: A strong acid is an acid which is completely ionized in an aqueous solution. Example : Hydrogen…
Q: Deducing a rate law from initial reaction rate data Some measurements of the initial rate of a…
A:
Q: 1.13 A one-particle, one-dimensional system has the state function = (sin ar) (2/mc²)¹/4²³1²³² +…
A: A particle in a 1-dimensional box is a fundamental quantum mechanical approximation describing the…
Q: d. 'OH NH, CH,MgBr H, quench
A:
Q: Number of lone pairs of electrons associated with central atom (LP) +Lewis Structure Diagram Number…
A:
Q: Give the major products CH,CO;H CH₂Cl₂, Zn(Cu) HCV/H₂0 H₂, Pd/C Br₂/H₂O
A: The Simmons–Smith reaction is an organic cheletropic reaction involving CH2Cl2 and Zn(Cu) that…
Q: Calculate the [OH−] and the pH of a solution with an [H+]=5.3×10−12 M at 25 °C.
A:
Q: You add 3.00 mL of 0.400 M NaOH to 50.00 mL of pure water, and to this mixture you then add 12.00 mL…
A: To solve this problem, we need to determine the concentration of all speciesin the solution after…
Q: Q5: The Four Musketeers! The reactions below are examples of the Williamson reaction. Take each…
A: “Since you have posted multiple questions, we will provide the solution only to the first question…
Q: Carbon dioxide and water react to form methane and oxygen, like this: CO₂(g) + 2H₂O(g) → CH₂(g)…
A:
Q: 7. Write Lewis structures for the following. Show ALL resonance structures where applicable. For e…
A:
Q: Br2₂ (low conc.)
A: Br2 addition in a double bond is a stereospecific anti-addition. The reaction is stereospecific as…
Q: СН3 CH3 СН3 .CI Br _CI чиз +NaNH, +KNH2 + NaNH, NH; NH₂ NH3
A:
Q: Calculated 10 5 3 H1 2 ¹H Spectrum H7 H4 H3 H6 H5 H2
A: Multiplets in NMR (nuclear magnetic resonance) spectra are patterns of peaks that arise due to the…
Q: 33. What is each compound's systematic name? a. CH₂C=CCH₂CHCH, Br b. CH₂C=CCH₂CHCH, CH₂CH₂CH₂ CH, c.…
A: Steps for naming an organic compound- 1- find the functional group first. 2- determine the longest…
Q: For each row in the table below, decide whether the pair of elements will form a molecular compound…
A:
Q: Which one statement (A) – (E) concerning Galvanic and Electrolytic cells is NOT correct? A) In the…
A:
Q: Analyze the case of the sodium atom, taking into account its Z and determine a) How many electrons…
A: Electronic configuration generally tells us about how electrons are present in atomic orbitals.
Q: Aqueous sulfuric acid (H,SO₂) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…
A: Given, mass of sulfuric acid (H2SO4) reacts = 69.6 g mass of Sodium hydroxide (NaOH) reacts = 94.3 g…
Q: Question 9 What is the the equilibrium constant (K) for the reaction below, if the reaction mixture…
A:
Q: Arrange the highlighted bonds in the table below in decreasing order of polarity. That is, pick 1…
A: Polarity depends on the electronegativity difference. Higher is the electronegativity difference…
Q: Arrange the highlighted bonds in the table below in decreasing order of polarity. That is, pick 1…
A:
Q: What would be the stereochemistry of the compound? CH3CH₂CH=CHCH₂CH₂OH
A: Stereochemistry is a branch of chemistry that deals with the study of the different spatial…
Q: Consider the reaction below. 0.150 M N2O4 is placed in a one liter flask and the system is…
A: Since,Equilibrium constant or Kc is the ratio of the equilibrium concentrations of product over…
Q: What are the equilibrium concentrations of all species of 18.0M acetic acid at 25°C? What is the pH…
A: Acetic acid is a weak acid, so in an aqueous solution, it can not dissociate fully. To determine the…
Q: ppb of Sn^2+ in 10^9 % Sn(NO3)2
A:
Q: 3) Consider each compound in Part B to be a soluble ionic compound. Choose the ion responsible for…
A: Types of Salts
Q: Can you explain how to draw hybridization diagrams? How do I determine the hybrid orbitals? How can…
A: Hybridization is a concept used in chemistry to describe the combination of atomic orbitals to form…
Q: What mass of CaCO3 can react with 82.3 g of HClO3 according to the following reaction? CaCO3(s) + 2…
A: From reaction it's clear one mole of calcium carbonate react with two mole of HClO3
Q: Draw a Newman projection for the highest (least stable) and lowest energy (most stable)…
A:
Q: How many moles of carbon dioxide are produced when 10.0g of lead(II) carbonate reacts with 100.0 cm³…
A: Given that, Amount of lead(II) carbonate = 10.0 g Moles of lead(II) carbonate = 10.0 g/ 267.21 g/mol…
Q: he correct systematic name for the compound shown here. H3C CH3
A: It is a ester compound. Esters are formed by alcohol and carboxylic acid. From the structure it is…
Q: Consider the following reaction: N₂(g) + 3 H₂(g) → 2 NH3(g) At time zero there are 0.30 M N₂ and…
A: Answer: For a random reaction aA(g)+bB(g)→cC(g)+dD(g) relation between rate of appearance of C and D…
Q: How many joules of heat are required to melt 1.7 g of copper at a temperature of 1083 degrees…
A: Specific heat capacity for copper is 390 j/kg°C.
Q: Determine the average rate of change of B from t=0 s to 1 402 s. A 2B rates == M/s Time (s) 0 201…
A:
Q: Arrange the highlighted bonds in the table below in decreasing order of polarity. That is, pick 1…
A: The bond between atoms of different electronegativity is called the polar bond. Higher the…
Q: What is the product of the following reaction? سد سد A) (1) LiAlH (2) IO میدید OH OH D)
A: LiAlH4 cannot reduce non-polar bond like C=C bonds,it only reduces carbonyl carbon to alcohol.
Q: 5. Suggest how you would carry out each of these syntheses (remember, your target compound is the…
A: Every organic reaction includes four processes- Substrate, attack on the substrate by a reagent,…
Q: Convert 483 μm3 to cm3
A: Since, 1 μm=10-6 m1m=100 cmthen,
Q: please answer with drawing and explanation
A: Soaps are sodium salts of higher fatty acids.Soap is prepared by hydrolyzing a fat under alkaline…
Q: The value of K₂1 and Ką2 for carbonic acid are 4.20×10-7 and 4.80×10-11, respectively. (Use H30+…
A: Acid dissociation constant denoted by Kₐ and it is a quantitative measure of the strength of an…
Q: 6. Elemental analysis of a copolymer of propylene and vinyl chloride showed that the polymer…
A: Mole ratio is the ratio of number of moles of substance A to number of moles of substance B .
Q: Calculate the potential of a calomel electrode (Hg|Hg2Cl2, mercurous chloride) in a solution: 1 of…
A: To calculate the potential of a calomel electrode (Hg|Hg2Cl2) in a solution of NaCl, we need to use…
Q: Consider the following neutralization reaction between nitric acid and sodium hydroxide:…
A: Steps to write a net ionic equation and complete ionic equation for a molecular reaction :…
Q: How do I do the synthesis of 1-aldehydecyclohexane to cyclohex-1ene and of ethyl propyl ether from…
A: The question is based on the concepts of Organic conversion. we need to carry out synthesis of…
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 1 images
- Identify the product, if any, that would form in each of the following reactions. 73) CH3 - CH2-CH2-OH [0] A) || CH3- CH2 - C- CH3 74) [0] B) CH 3 - CH 2 - CH -OH || CH3 CH3 - CH2 - CH Match the structural formula with the correct functional group. 75) CНз - СH2 -ОН A) alcohol 76) CH3 – CH2¤0 ICH3 B) thiol 77) CH3- CH2 - SH C) ether Select the correct name for the following. 78) CH3 - CH2 - CH2 - SH A) propanethiol 79) CH3 - CH2 - O - CH2 - CH3 B) diethyl ether 80) C) m-ethylphenol OH CH2CH3 D) 1-ethyl-3- hydroxycyclohexene E) propane sulfidedraw the chemical structure (condensed structure) of the following: i) 2-ethyl-2-methylpent-3-yn-1-ol ii) N-ethyl-N-propyl-2-methylbutanamide iii) (2R,3S)-2-bromopentan-1,3-diolThe reaction of ozone with 2-butene leads to -10 formation of aldehyde + ketone 0 aldehyde + alcohol 0 two molecules of carboxylic acid 0
- An important step in one synthesis of carboxylic acids is the deprotonation of diethyl malonate and its alkyl-substituted derivative: Base CH;CH2O OCH,CH3 CH;CH,0 OCH2CH3 H2 Diethyl malonate Base CH;CH,0 °C `OCH,CH3 CH;CH,O OCH,CH3 R Alkyl substituted diethyl malonate NaOH can deprotonate diethyl malonate effectively, but NaOC(CH3)3 is typically used to deprotonate the alkyl-substituted derivative. Explain why.What type of compound is the second product in the reaction shown below? CH O-C-(CH2)16CH3 CH-OH CH-O-C-(CH)16CH, +3 NaOH > CH-OH + CH O-C-(CH,)16CH, CHOH O ester O fatty acid O alcohol fatty acid saltDraw the structural formulas of the following compounds, name them according to IUPAC (1,2,3,4,5,6 examples), indicate the asymmetric carbon atoms. 5) γ-hydroxyvaleric acid 6) δ-hydroxyvaleric acid 7) 2-hydroxypentanoic acid 8) 3-hydroxy-2-methylbutanoic acid 9) 2,3- dihydroxybutanedioic acid (tartaric acid)
- Which is the correct assignment of the names of the following substituted benzenes? OH CH3 HO, CH3 O 1 = phenol; 2 = m-cresol; 3 = toluene %3D O 1 = m-cresol; 2 = resorcinol; 3 = m-xylene %3D O 1 = anisole; 2 = catechol; 3 = m-xylene %3D %3D %3D O 1 = m-cresol; 2 = anisole; 3 = cumene %3DWhat is the systematic name of the product P of this chemical reaction? CH3-CH2-CH2-C-OH + NaOH + H20Refer to the following structures: K (V) -OH O I, II, III OI, VI O III, V OI, IV OVI DA NH₂ ✓ CH₂-CH-C²-OH Which of these structures are esters? ورے • CH₂ TD ~^^N-CH₂
- CH;CH2CH,CH,CH2B1 NH3 G + H + excessWrite down the common (not IUPAC) names of the organic molecules that would be released if this molecule were hydrolyzed: о CH2 O-C-(CH2)7-CH=CH-CH2-CH=CH-(CH2)4-CH3 о CH-O-C-(CH2)7-CH=CH-CH2-CH=CH-CH2-CH=CH-CH2-CH3 CH2 O-C-(CH2)4-CH=CH-CH2-CH=CH-CH2-CH=CH-(CH2)4-CH3 Separate each name with a comma. You will find useful information in the ALEKS Data resource.Draw a structural formula for the missing product in the following reaction. (1) LIAIH4, ether CH₂CH₂CH₂CH₂C-OH (2) H₂O ? +LIOH + Al(OH)3