The estimated average concentration of carbon monoxide in air in the United States in 1991 was 6.0ppm. Calculate the number of CO molecules in 1.0L of this air pressure of 754 torr and a temperature of 17 degrees Celsius

Q: Explain the use of the LIDAR technique in atmospheric monitoring. In particular, describe the…

A: The full form of LIDAR is light detection and ranging. It  is an optical remote sensing technology…

Q: What volume of CO2 gas at 645 torr and 800. K could be produced by the decomposition of 45.0 g of…

A: Number of moles of Calcium carbonate and carbondioxide can be calculated as follows:

Q: How many grams of iron oxide are produced from 15.OL of oxygen at STP? (Fe203 = 159.7g/mol) %3D 2…

A:

Q: Air contains nitrogen, oxygen, argon, and trace gases. If the partial pressure of nitrogen is 592 mm…

A: Given: Partial pressure of Nitrogen = 592 mm Hg Partial pressure of Oxygen = 160 mm Hg Partial…

Q: what is the number of mole of co2 produced when .0200 mol c2h2 burns?

A: A chemical equation can be represented by using symbols and formulas of the participating species.…

Q: The purity of a sample containing zinc and weighing 0.312 g is determined by measuring the amount of…

A: Given mass of sample of Zn = 0.312 g  Mass %age of Zn in the sample = 84.0%  Find amount of H2 gas…

Q: What volume of hydrogen will be produced at STP if 67.30 g of magnesium is reacted with an unlimited…

A: Number of Moles= Given Mass / Molar Mass

Q: Describe the composition of the atmosphere in terms of the major components in dry air at sea level?

A: The charged or neutral particles combining together to form earth atmosphere is called its…

Q: 24.00 g of solid calcium carbonate completely decomposes at 579 °C in a 12.000 L sealed vessel. The…

A: Given: 24.00 g of solid calcium carbonate 579 °C = 579 + 273.15 = 852.15 K 12.000 L

Q: number of CO molecules

A:

Q: Determine the volume of O 2 (at STP) formed when 70.0 g of Fe2O3 decomposes according to the…

A:

Q: 4. List major sources (biogenic and anthropogenic) of ammonia in the air What happen to ammonia when…

A: The major sources of NH3 emissions in air is agriculture, including animal husbandry NH3-based…

Q: Calculate the volume, in liters, occupied by 1.92 mol of neon gas at STP. O 43.0 L 22.4 L 20.2 L O…

A: Introduction: We will solve this question with the help of ideal gas equation. The ideal gas law is…

Q: Gold is found in seawater at very low levels, about 0.05 ppb by mass. Assuming that gold is worth…

A: The concentration of gold is 0.05 ppb (parts per billion). This means it consists of 0.05 g of gold…

Q: A sample of carbon monoxide at 57oC and under 0.67 atm of pressure takes up 85.3 L of space.  What…

A: Given data: Temperature = 57o C = 330 K Pressure  = 0.67 atm  Volume = 85.3 L Formula used: P V = n…

Q: The overall cause of ozone depletion is associated with the presence of chlorofluorocarbons and…

A: The ozone in the atmosphere reacts with the chlorofluoro carbons to form the oxygen through…

Q: How much co2(in L) will be produced by 250g of caco3 if it is completely reacted with hcl at 25C at…

A: Balanced chemical equation   CaCO3 + 2HCL → CaCl2 + CO2 + H2O

Q: 0.018 0.016 0.014+ 0.012 + 0.01 0.008 0.006 0.004 0.002 + 10 20 30 40 50 60 70 80 90 Time(min) From…

A: In chemistry, chemical kinetics deals with the kinetics of the reaction and given very useful…

Q: If 0.610g of magnesium was reacted with HCI and 511mL of hydrogen gas was collected over water at 23…

A: given, weight of Mg = 0.610 g   Theoritical yield of H2 = 511 ml   R = 0.082 L.atm.mol^-1.K^-1

Q: 1. The surface atoms of aluminum metal corrode in air to form an impervious aluminum oxide coating…

A:

Q: Calculate the volume, in mL, of 0.95 mol of Potassium Sulfate when it is in its gas form at STP. o…

A:

Q: As of the writing of this text, EPA standards limit atmospheric ozone levels in urban environments…

A: Given that Area covered by the air above Los Angeles = 4000 sq. miles = 1.036 x 1010 m2 . and height…

Q: The atmosphere contains about 5.2×10^15 t of air. What mass in metric tons of carbon dioxide is in…

A:

Q: Ozone molecules in the stratosphere absorb much of the harmful radiation from the sun. How many…

A: Given,Pressure, P = 1.59 × 10-3 atm     Volume, V = 1.00 LTemperature, T = 271 KNo. of moles (n) of…

Q: A Haber process reactor contains 25.0% nitrogen and 75.0% hydrogen for the synthesis of ammonia.…

A:

Q: What is the concentration of CO2 in such air in terms of molarity, assuming 1 atm pressure and a…

A: Given: Pressure = 1 atm Temperature = 37 oC = 37+273.15 = 310.15 K   1 mole of any ideal gas…

Q: The average concentration of carbon monoxide in air in an Ohio city in 2006 was 3.5ppm. Calculate…

A:

Q: Explain why the concentration of CFCs increased in the atmosphere.

A: Chlorofluorocarbons(CFCs) are a chlorine-containing compound used in several appliances and cause…

Q: The density of a certain gaseous fluoride of phosphorus is 3.93 g/L at STP. Calculate the molar mass…

A: Density of a gas can be expressed as, d=PMRT where P is pressure, M is the molar mass, R is the…

Q: A gas mixture consisting of 46.04% O2 and 53.96% He by mass, is used in scuba tanks for deep sea…

A: 46.04% O2 by mass in grams will be 46.04 g of oxygen gas. 53.96% He by mass in grams will be 53.96 g…

Q: In questions 5 and 6, assume 1.00 mol of any gas occupies 22.40 L at standard temperature and…

A: Since you have posted multiple questions, we will solve the first two questions for you since they…

Q: What is the total pressure for a mixture of hydrogen, nitrogen, and ammonia? O PN2 + PH2 / PNH3 O…

A:

Q: Calculate the amount of Cl2 (g) produced in L at STP and calculate the percent yield of Cl2(g) in…

A:

Q: A balloon flying a long distance contains 1.2 x 107 L of helium. If the helium pressure is 737 mmHg…

A: Given, Pressure (P) = 737 mmHg = 0.97 atm Volume (V) = 1.2 × 107 L Temperature (T) = 25°C = (25 +…

Q: Some chemical reactions are sensitive to air (oxygen or moisture), they are conducted under nitrogen…

A: In some cases, the reactant, the reagent or the product produced can be air sensitive. Being air…

Q: 2. A. Write a balanced chemical equation for the reaction, in aqueous solution, between silver…

A: We have to predict the balance chemical equation ,as well as moles and molecules of air.

Q: The purity of a sample containing zinc and weighing 0.198 g is determined by measuring the amount of…

A: Sample wt = 0.198 gZinc % in sample = 84 %wt of Zinc in sample = Sample wt100×84= 0.16632 gMolar…

Q: Calculate the average m mass fraction from its 21% O2.

A: Let total moles of air = 100  So no. of moles of N2 gas = 79 no. of moles of O2 gas = 21

Q: Dioxins are known to be very toxic. If TCDD concentration in the atmosphere is 195 ng/L of air. What…

A: The given conversions can be done using the below general unit conversion.

Q: 2Fe2O3+3C-4Fe+3CO2 The mole ratio for Fe2O3 to CO3 is what in fraction form

A: Stoichiometry refers to relationship between various quantities (mass, moles, equivalents) that are…

Q: The sulfur dioxide (SO2) concentration is measured at 0.6 mg/m in Denver where the atmospheric…

A: ppm: It is a unit of concentration i.e. parts per million. The mass of a chemical or contaminate per…

Q: Determine the volume of CO2 obtained from the combustion of 145 g propane, C3H8 (at 1741 mmHg and…

A:

Q: Calculate the average molecular weight of air from its molar composition of 79% N2and 21% O2and (2)…

A: Given information:Molar composition of nitrogen (N2) = 79 %Molar composition of oxygen (O2) = 21…

Q: What is an ionic atmosphere?

A: Ionic atmosphere is defined as the area at which a charged entity is capable of attracting an entity…

Q: 19. 1.18 g of Ar(g) occupies 2.00 L. container at the temperature of 25 °C. Calculate the pressure…

A:

Q: The estimated average concentration of NO2 in air in theUnited States in 2006 was 0.016 ppm. (a)…

A: The partial pressure and molecules of NO2 in the air are to be calculated from the given data.…

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".