Answer both please. Solid-state electrodes that respond to anions create a potential difference across the solid-state membrane byO A. reacting the membrane crystal with a strong acidO B. etching the surface of the membrane crystal with small groovesO C. drilling small channels through the crystalO D. doping the membrane crystal to create anion vacanciesO E. polishing the surface of the membrane crystalQUESTION 7Which of the following are CORRECT concerning the measurement of the potential difference across the potassium ion selective membrane?The driving force for the diffusion of K* across the membrane is the favorable free energy change that occurs when K* is solvated by water.The potential difference across the membrane is measured by two reference electrodes.Eouter is constant.At equilibrium, the net change in free energy for the diffusion of K* ions across the membrane is greater than 1.IIIIVwhich allows anions to migrate through the crystal.O A. I and IVO B. II and IIIO C. I and IIO D.III and IVO E. II and IV

Anion vacancy is a type of defect in which the negatively charged species are absent from their…

Solid-state electrodes that respond to anions create potential difference across the solid-state membrane by O A. reacting the membrane crystal with a strong acid OB. etching the surface of the membrane crystal with small grooves O C. drilling small channels through the crystal O D. doping the membrane crystal to create anion vacancies O E. polishing the surface of the membrane crystal which allows anions to migrate through the crystal.

Solid-state electrodes that respond to anions create potential difference across the solid-state membrane by O A. reacting the membrane crystal with a strong acid OB. etching the surface of the membrane crystal with small grooves O C. drilling small channels through the crystal O D. doping the membrane crystal to create anion vacancies O E. polishing the surface of the membrane crystal which allows anions to migrate through the crystal.

Chemical Principles in the Laboratory

11th Edition

ISBN:9781305264434

Author:Emil Slowinski, Wayne C. Wolsey, Robert Rossi

Publisher:Emil Slowinski, Wayne C. Wolsey, Robert Rossi

Chapter32: Voltaic Cell Measurements

Section: Chapter Questions

Problem 2ASA

See similar textbooks

Similar questions

For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
Consider the reaction low at 25°C: 3SO42(aq)+12H+(aq)+2Cr(s)3SO2(g)+2Cr3+(aq)+6H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 3.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (c) Is the reaction spontaneous at a pH of 8.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M and all gases at 1.00 atm?
A 0.0712-g sample of a purified organic acid was dissolved in an alcohol-water mixture and titrated with coulometrically generated hydroxide ions. With a current of 0.0392 A, 241 s was required to reach aphenolphthalein end point. Calculate the equivalent mass of the acid.
Consider the reaction below at 25°C: 2MnO4(aq)+16H+(aq)+10Br(aq)2Mn2+(aq)+5Br2(l)+8H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 2.00 with all other ionic species at 0.100 M? (c) Is the reaction spontaneous at a pH of 5.00 with all other ionic species at 0.100 M? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M?
An aqueous solution of an unknown salt of vanadium is electrolyzed by a current of 2.50 amps for 1.90 hours. The electroplating is carried out with an efficiency of 95.0%, resulting in a deposit of 2.850 g of vanadium. a How many faradays are required to deposit the vanadium? b What is the charge on the vanadium ions (based on your calculations)?
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?