Rank the pKa values of acetic acid, ethanol, phenol, and explain the reason in detail Rank the pka values of acetic acid, ethanol, phenol,and explain the reason in detail.OOHacetic acidOHethanolphenolOH

Acidity is defined as the ability of a molecule to release protons.If a compound easily donates…

Answered: Rank the pka values of acetic acid,…

Rank the pka values of acetic acid, ethanol, phenol, and explain the reason in detail. O OH acetic acid OH ethanol phenol OH

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter10: Alcohols

Section: Chapter Questions

Problem 10.49P

See similar textbooks

Related questions

Q: Use the following data to calculate the Ksp value for each solid. -3 a. The solubility of MgC2O4 is…

Q: Calculate the mass of potassium hydrogen phthalate (KHP) molar mass=204.22 your answer has the…

Q: 2. PREVIOUS ANSWERS OSATOMSCHEM2 9.2.0.030. MY NOTES ASK YOUR TEACHER When 1.3 g of fructose, CO), a…

A: The objective of the question is to calculate the heat released during the combustion of fructose.

Q: For the following reaction, please select the major organic product. 1. KMnO₂. NaOH, A 2. H₂00 how,…

A: When an alkyne is oxidized by hot an alkaline KMnO4 followed by acidification, carboxylic acids and…

Q: You decided the make the following changes to the Recrystallization experiment. Otherwise, the…

A: Percentage yield is a measure of the efficiency of a chemical reaction in producing the desired…

Q: 7. a. Calculate Kat 475 K for the reaction NO(g) + 1/2O2(g) → NO2(g) assuming that A, H° is constant…

A: Answer:When during a reaction heat evolves it is called as exothermic reaction and when heat gets…

Q: For the following reaction, predict the major product and draw a mechanism for its formation. Å Me…

A: Sodium methanethiolate (NaSMe) is a nucleophilic species that can participate in nucleophilic…

Q: Draw the organic product(s) of the following reactions including stereochemistry when it is…

A: Lindlar's catalyst is used for the reduction of alkyne to cis-alkene or Z-alkene.

Q: A Lewis structure for the carbonate ion is shown here: Which structure is the best resonance…

A: The Lewis dot structure represents the valency electrons present on an atom.

Q: Q08 DP Provide a structure for the product of the following reaction. 0.3. + H3C CH3 CH3 B

A: A 1,3 dipolar addition leads to the formation of a five-membered cyclic compound. A nitrone is a…

Q: Identify the reagents needed for the following conversion. OH 8.00 0-1-0 A B 4 A: HNO3, H₂SO4; B:…

A: When benzene is heated at 50-60°C in presence of a mixture of conc. HNO3 and conc. H2SO4,…

Q: What organic functional groups are in the Propylene Glycol structure?

Q: Calculate to three significant digits the density of dinitrogen difluoride gas at exactly 25°C and…

Q: What mass of Fe(OH)3 will be obtained when 100. mL of 0.166 M FeCl3 is mixed with 200. mL of 0.154 M…

A: FeCl3 between FeCl3the balanced chemical equation:and NaOH by the balanced chemical…

Q: Write the relative reaction rates for the following reaction: A + 2B → C

Q: A mixture of oxygen and neon gases, in a 9.80 L flask at 59 °C, contains 15.3 grams of oxygen and…

Q: Draw and name all of the monochlorinated products including stereoisomers that can result when…

A: When 2,2 -dimethylbutane is subjected to free-radical chlorination four different mono chlorinated…

Q: If an electric current is passed through an aqueous solution of What is expected to be produced at…

A: Answer:Preferential discharge theory states that when more than one ions are present at an electrode…

Q: Draw the products of this reduction of a ketone with sodium borohydride. Use a dash or wedge bond to…

A: Sodium borohydride, NaBH4 is a reducing agent that can reduce a carbonyl functional group into an…

Q: Hide Transcribed Text Find the energy levels and wave functions of the ground state and the first…

A: In quantum mechanics, the behavior of particles is described by wave functions, and the evolution of…

Q: What is the molecular geometry around the central atom in SeF? Select the single best answer. O…

Q: The formate ion, HCO₂, is formed when formic acid dissolves in water. A number of possible resonance…

A: When one structure is not able to define the structure of the molecule and its bond parameters, then…

Q: Consider a galvanic electrochemical cell constructed using Cr/Cr³+ and Zn/Zn²+ at 25 °C. The…

A: Given ,

Q: How much heat (in kJ) is needed to raise the temperature of 40.0 grams of AsBr₃(g) 20.0˚C?

A: Specific heat capacity for AsBr3 -1

Q: write the balanced total equation, net ionic equation, and complete ionic equation for the aqueous…

A: Balance molecular equation can be define as the reaction in which number of atoms of all the…

Q: 1. 2. 3. Compound h or e Name

A: IUPAC nomenclature: In IUPAC nomenclature a molecule's longest chain of carbons is taken as parent…

Q: A concentration cell was made using a Sr metal electrode in a saturated solution of SrCO for the…

A: Answer:Concentration cell is a type of galvanic cell in which solution of same electrolyte is used…

Q: A sample of oxygen gas was collected via water displacement. Since the oxygen was collected via…

Q: After carrying out the following operations, how many significant figures are appropriate to how in…

A: Given,The mathematical expression:( 13.7 + 0.027 ) 8.221

Q: explain the chemoselectivity (why this functional group and not other?), regioselectivity,…

A: The given transformation requires three steps, such as oxidation, nucleophilic attack and reduction…

Q: What is the total mass of the packet?

A: Given- volume of water- 250mLingredients- sodium citrate (Na3C6H5O7) - 8.6 mEqPotassium citrate…

Q: Where would be the least amount of the next electrophilic aromatic substitution occur in the…

A: Role of electron density:An electrophile preferably attacks on the site having higher electron…

Q: It was invented in 1859 by French physician Gaston Plante and still retains application today, more…

A: Answer:Extensive properties are the ones that depend on the size of the system and additive in…

Q: Propose a mechanism for the following reaction that would yield the expected major product. SHOW ALL…

A: Given is organic reaction.The given reactant is tertiary alcohol.The given reagent is hydronium…

Q: Draw the major product of this reaction. Ignore inorganic byproducts. 1. BH-THF 2. H₂O₂, NaOH Select…

A: Given,The reaction:

Q: Question 5 What is the major product to the following reaction? NaOCH3 HOCH3

A: Robinson annulation involves the following steps :Enolate formationMichael additionAldol…

Q: + 2 NH₂

A: Acid anhydride reacts with ammonia to form amide and ammonium salt of Carboxylic acid.

Q: A sample of methane gas at 305 K and 0.460 atm occupies a volume of 2.94 L. If the pressure of the…

A: Answer:As we know,When there is no leakage of gas then value of number of moles of gas can be…

Q: What is the major product of the following reaction? А. В. ОН ОН OH ОН 1. NaBH4 2. H3O+ с. ОН ОН ОН

A: NaBH4 act as mild reducing agent it reduces aldehyde and ketone mainly

Q: Draw the major monobromination product of this reaction.

A: Allylic bromination is the replacement of hydrogens on a carbon adjacent to a double bond with…

Q: Write a complete detailed arrow-pushing mechanism for the following transformations. HiCO CH3 CH₂ OH…

A: In presence of acid first of all carbonyl group protonated and carbonyl carbon becomes more…

Q: What is the absolute configuration of chiral center 2? Ο Α. Ε B. Z O C. R OD. S OH 1 2 HN.

Q: 2

A: In the glyoxylate cycle, two molecules of acetyl CoA can be used to produce one molecule of…

Q: Give a curved arrow-pushing mechanism for the following two reactions • SHOW WHERE EVERY PROTON…

A: A Lewis acid is a species that accepts electrons. It is positively charged or has vacant orbitals to…

Q: You used 80 mL of deionized water instead of the necessary 50 mL of water to make a KHP solution for…

A: The objective of the question is to choose the correct statement regarding the effect on the…

Q: The Ksp for Pbl₂(s) is 1.4 x 10-8. Calculate the solubility of Pbl₂(s) in 0.73 M Pb(NO3)2. mol/L

Q: using the arrow-pushing formalism. Draw all missing reactants and/or products in the appropriate…

A: While writing the mechanism use electron pushing arrow from electron rich center to electron poor…

Q: 4. Which of the following reactions can be used to prepare 1.1-diphenyl-1-propanol? CH3CH₂C- I.…

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: Determine the structure of the methyl ester and organomagnesium bromide reagents that can be…

A: The reaction between an ester and excess of Grignard reagent gives tertiary alcohol

Q: Compounds X and Y both have the formula C7H₁4. Both X and Y react with one molar equivalent of…

A: The question is based on the concept of organic reactions.We need to identify X and Y.

Concept explainers

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.

Question

Rank the pKa values of acetic acid, ethanol, phenol, and explain the reason in detail

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Define Acidity

VIEW

Step 2: Explain Acidity order

VIEW

Solution

VIEW

Step by step

Solved in 3 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The pKa of phenol is 10.0 and the pKa of para-nitrophenol is 7.2. Given this information, one knows that The conjugate base of para-nitrophenol must be less stable than the conjugate base of phenol The conjugate acid of para-nitrophenol must be more stable than the conjugate base of phenol The conjugate base of para-nitrophenol must be more stable than the conjugate base of phenol Both acids are bases
Although p-hydroxybenzoic acid is less acidic than benzoic acid, o-hydroxybenzoic acid is slightly more acidic than benzoic acid. Explain this result.
Account for the fact that one carboxyl group is a considerably stronger acid than the other carboxyl group.
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Why does a substance become more soluble in a solvent with increasing temperature? Solvents are ordered by decreasing value of theirdielectric constant. In the table, which is the most polar solvent and which is the least polar? How can acetylsalicylic acid be obtained from salicylic acid?
When trichloroacetaldehyde is dissolved in water, almost all of it is converted to the hydrate. Chloral hydrate, the product of the reaction, is a sedative that can be lethal. A cocktail laced with it is known—in detective novels, at least—as a “Mickey Finn.” Explain why an aqueous solution of trichloroacetaldehyde is almost all hydrate.
Aspirin is the common name for the compound acetylsalicylic acid, widely used as a fever reducer and as a pain killer. Salicylic acid, whose name comes from Salix, the willow family of plants, was derived from willow bark extracts. In folk medicine, willow bark teas were used as headache remedies and other tonics. Nowadays, salicylic acid is administered in the form of aspirin which is less irritating to the stomach than salicylic acid. To prepare aspirin, salicylic acid is reacted with an excess of acetic anhydride. A small amount of a strong acid is used as a catalyst which speeds up the reaction. In this experiment, phosphoric acid will be used as the catalyst. The excess acetic acid will be quenched with the addition of water. The aspirin product is not very soluble in water so the aspirin product will precipitate when water is added. The synthesis reaction of aspirin is shown below: Actic anhydride 5 ml. Acetic acid Salicylic acid 28 Acetylsalicylie acid Procedure 1) Mix salicylic…
When trichloroacetaldehyde is dissolved in water, almost all of it is converted to the hydrate. Chloral hydrate, the product of the reaction, is a sedative that can be lethal. A cocktail laced with it is known—in detective novels,at least—as a “Mickey Finn.” Explain why an aqueous solution of trichloroacetaldehyde is almost all hydrate.
Carbonyl compounds can be protonated on the carbonyl oxygen. Protonation of the carbonyl oxygen gives a species whose positive charge is delocalized by resonance. Explain why acetic acid (ethanoic acid) is more readily protonated than acetone (propanone).
Acetals are formed from the reaction of two alcohols with a carbonyl under acidic conditions. Acetal formation is faster with 1,2-ethanediol than with two methanol molecules. Choose the factor that explains the difference in reaction rates. A) The reaction with 1,2-ethanediol has a lower AH (enthalpy) of reaction. B) The reaction with 1,2-ethanediol has a higher AH (enthalpy) of reaction. C) The reaction with 1,2-ethanediol has a more favorable entropy of reaction.
why benzoic acid has a more acidic proton than 2-napthol.
Which is more acidic, p-methylphenol or phenol? why? Why is water more acidic than ethanol but slightly less acidic than methanol? Explain the acidity trend of alcohols: 1>2 > 3