6:41Done CHEM251Assignment 1 Feb 25-...Question 1:Provide the names for the following coordinationcompounds:1. [Mn(NH;),(H,O);]Br;2. [Pd(NH3),CI]Cl;3. [Pt(H,NCH,CH,NH,),Br,]Br,4. [Co(H,NCH,CH,NH,);],(SO,);5. Na,[Fe(CN),]6. K¿[NiCl,]7. Pt(NH;),Cl,8. Fe(CO);9. (NH,)[Ni(C,UA

Answered: Image /qna-images/answer/af0b8c60-3a15-4e76-9a54-c6f84693ad82.jpg

Question 1: Provide the names for the following coordination compounds: 1. [Mn(NH;),(H,O);]Br, 2. [Pd(NH,),CI]CI, 3. [Pt(H,NCH,CH,NH,),Br,]Br, 4. [Co(H,NCH,CH,NH,);]¿(SO,); 5. Na[Fe(CN),] 6. K¿[NiCl,] 7. Pt(NH3),Cl, 8. Fe(CO),

Question 1: Provide the names for the following coordination compounds: 1. [Mn(NH;),(H,O);]Br, 2. [Pd(NH,),CI]CI, 3. [Pt(H,NCH,CH,NH,),Br,]Br, 4. [Co(H,NCH,CH,NH,);]¿(SO,); 5. Na[Fe(CN),] 6. K¿[NiCl,] 7. Pt(NH3),Cl, 8. Fe(CO),

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 40P

See similar textbooks

Related questions

Q: 1. K[Cu(CN)4] 2. [Co(en);Br]CI 3. PtCl2(NH3)2 4. Co(en);Cl3

Q: [Co(NH3)5CO3]CI Na[PtCl3(NH3)] [Cu(NH3)4]²* Re(dien)Br2Cl 2+

A: 1) Stock system of nomenclature :- In this nomenclature system the naming of coordination…

Q: Write the formula of all complexes that could be formed by Cadmium and the ligand Br (as many…

A: Cd and Br- form complex in stepwise reaction.

Q: Bridging structures are quite common in coordination compounds. In this kind of structure, the…

Q: 1.43g sample of the complex [Co(NH3)4CO3]NO3 (MM=249 g/mol) was ignited in a crucible to convert all…

A: Previded amount of sample [Co(NH3)4CO3]NO3=1.43g Molar mass of [Co(NH3)4CO3]NO3=249g/mol Provided…

Q: Which of these ligands can participate in linkage isomerism:(a) SCN-; (b) S2O32-(thiosulfate); (c)…

A: Ligands having 2 donor atoms and which are capable of ligating through any of these donor atoms at a…

Q: The thermodynamic stability of coordination compounds depends on, а. AG¢ b. magnetic susceptibility…

A: The thermodynamic stability of coordination compound depends on the following factors.

Q: Determine the coordination number and oxidation state of the metal ion in each complex. Show all…

A: determination of oxidation state of metal ions in coordination complexes

Q: Indicate the coordination geomerty, the metal oxidation state, the d-electron count, and the…

A: Coordination geometry = square planar Metal oxidation state = +2 (Fe = 26) d-electron count = 6…

Q: The extent of crystal field splitting is often determined from spectra. (a) Given the wavelength…

A: As question has multiple subparts, so here solve first three subparts. If student want complete…

Q: The coordination compounds which is Enzymes- Carbonic Anhydrase. a. The oxidation number of central…

A: Carbonic Anhydrase is an enzyme i.e. utilize for the conversion of carbon dioxide to carbonic acid .…

Q: A Moving to another question will save this response. Question 6 For the following coordination…

Q: Describe the types of NO bonds by demonstrating the electrons involved. This is an acid (pi) ligand…

A: The metal uses t2g orbital to form pi bonds with ligands. Pi star orbital of metal is high energy…

Q: b. Draw and name the structures of possible geometric and optical isomers of the cobalt complexes…

A: Isomer are those who have same molecular formula same but different structural formula. If two…

Q: Explain the following :(i) Low spin octahedral complexes of nickel are not known.(ii) The…

A: Low spin octahedral complexes are formed when the central metal atom undergo d2sp3 hybridisation by…

Q: The reaction of 5.0 g of CuSO..SH2O with an excess of ammonium chloride, produces 2.0 E actual…

A: A question based on mole concept that is to be accomplished.

Q: 1. In coordination compound [Cr(en)2Cla]Cl the ligands the the coordination number is the donor…

A: In the coordination compound [Cr(en)2Cl2]Cl , the central metal atom is Cr and the ligands are…

Q: 1) a,b,c,d

A: Coordination number is the total number of ligands that forms bond with the metal atom. (a)In…

Q: Determination of %NH3 in the coordination compound with the empirical formula: Cr,(NH3),CI, 1) A…

A: To determine the percentage of ammonia present in coordination compound with the empirical…

Q: Give the systematic name for the following coordination compound or complex ion:…

A: Naming of coordination compound 1. In coordination compound always write the name of cation before…

Q: Consider the coordination compound [Ni(C204)2(H20)2]Cl2 and identify ligands O a. H20, CI- O b. C204…

Q: 1) In accordance to Crystal Field Theory (CFT): Explain in details the difference between [Fe(CN),]*…

Q: 3)a,b,c

Q: Using crystal field theory, draw an electron box energy level diagram for the valence d orbitals on…

Q: a. What is the coordination number of this complex?

A: a). The coordination number of any complex is defined as the number of ligands that are bonded to…

Q: he magnitude of delta octahedral (A.) epends on: he nature and charge of metal and whether the hetal…

A: The question is based on the concept of coordination compounds. We have to identify the factors on…

Q: 3+ cation, the energies of the valence d orbitals on When a certain strong-field ligand forms an…

Q: 1) In accordance to Crystal Field Theory (CFT): Explain in details the difference between [Fe(CN),]…

Q: The IR used to investigate the CO coordination to transition metal, why?

A: Carbon monoxide bonds to transition metals using "synergistic π* back-bonding

Q: Give the systematic name for the following coordination compound: CI- .F Со

A: While naming any complex ion, the ligands are always named before the metal ion. If multiple ligands…

Q: 9. [Cr(o-phen)(NH3)½CI2]* 10. [Pt(en);Cl½]²*

A: In stock system, the oxidation state of metal ion is written in parenthesis after writing the name…

Q: Determine the coordination number for [Ni(en)3]SO4. Enter your answer as a number What is the…

A: Determine coordination number and oxidation number of Ni in the given complex---

Q: Among the (pi) acid ligands of groups 15 and 16, which is the most similar, regarding the capacity…

Q: The stability constants of some copper complexes are given below (en ethylenediamine). Complex…

A: Stability constant of complex ion : the stability constant of the complex is the degree of…

Q: (a) Give names of two complexes which are used in medicines.(b) Using valence bond theory of…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: Draw the structure of ethylenediaminetetraacetate ion (EDTA“) is reacted with Mn" forming an…

A: Mn4+ reacts with EDTA4- to form complex as per the below reaction Mn4+ + EDTA4- --------> MnEDTA…

Q: Alfred Werner, found the key to understanding coordination compounds by synthesizing the series of…

A: The coordination complexes can be defined as the complex compounds which have coordinate linkage…

Q: a) Why the [Mn(H,O),]²* complex gives pale pink color where as MnO, gives intense color in water,…

A: “Since you have asked multip- le question, we will solve the first question for you. If you want any…

Q: Consider the coordination compound [Ni(C₂O4)2(H₂O)2] Cl2 and identify ligands a. C₂04-2, CI- -2 O b.…

Q: a. Briefly describe the chelate effect b. Give the structure of a ligand that will exhibit the…

A: The metal complex carrying the ligand that is chelating (two or more donating sites) is named as…

Q: 1. Draw two possible resonance structures for DMSO, where S is the central atom. What kind of bond…

A: 1. DMSO means dimethyl sulfoxide contains two S-Me and one S=O with one l.p. on S atom. It's…

Q: Which coordination complex has the greatest A,? O [Co(en), 1*+ O [COBB,- O [Co(NH3),1³+ O…

A: Applying concept of factors affecting splitting factor ∆o and spectrochemical series.

Q: question one

A: Here, the cation is Co2+. Octahedral Co(NH3)4Br2Cl shows geometrical isomerism which results into…

Q: Which of the following statement/s is/are true regarding coordination compounds? A. The interaction…

Q: Using crystal field theory, draw an electron box energy level diagram for the valence d orbitals on…

Q: Explain why [Ni(NH;),] diamagnetic. is paramagnetic, while [Ni(CN), is

A: A complex become paramagnetic when it has electrons that are not paired. If all the electrons are…

Q: When Werner's student Edith Humphrey first synthesized the complex complex salts of formula…

A: This is an example of Linkage isomerism of -NO2 ligand. When a particular ligand is binding to a…

Q: Name the following coordination compounds using (a) stock system and (b) Ewing-Basset system. Use…

A: A question based on coordination complexes that is to be accomplished.

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Provide the names for the following coordination compounds: 1. [Mn(NH3);(H,O);]Br; 2. [Pd(NH3),CI]Cl; 3. [Pt(H,NCH,CH,NH,),Br,]Br, 4. [Co(H,NCH,CH,NH,);];(SO,); 5. Na,[Fe(CN),] 6. K,[NiCl,] 7. Pt(NH;),Cl4
Name each complex ion or coordination compound. a. [Cr(H,0)f (Fe(NH;);Br]SO, b. (Cu(CN),] d. (Co(H,O), (NH,)(OH)|Cl,
6:41 Done CHEM251Assignment 1 Feb 25-2021_... Question 2: Provide the molecular formulas of the following coordination compounds? 1. hexaammineiron(III) nitrate 2. ammonium tetrachlorocuprate(II) 3. sodium monochloropentacyanoferrate(III) 4. potassium hexafluorocobaltate(III) Question 3: Draw the cis and trans isomers of the following compounds: a. (H2O),IrBr(CO) b. (Н;N),P(HCI с. (AsH;),PtH(CO)
Wi""'* וP י'Cll Give the systematic name for the following coordination compound: NH3 Pt CI NH3 trans- mer- cis- fac- 00 (V) (1I) ) (1) (II) (IV) |[ ion tetra tri bis di wuestions prep oK NOV
6) The correct name for [Fe(NH,);H,O](NO,); is a) pentammineaqualron(II) nitrate. c) pentamineaquadinitrolron (II). b) pentammineaqualron(III) nitrate. d) pentamineaquadinitrolron (III).
Which coordination complex has the greatest A,? O [Scl,}³- O [Sc(NH,),1³+ O [Sc(H,O),]³+ O [Sc(en),]³+ 9. '3
OP the distinctive colors of the coordination complexes? Q2: What is the yield percentage of the preparation of Co(salen) complex, if we start from 0.721g of salenH2 and the practical weight of the complex is: 0.632g. A. wt (Co=58.933, H=1, 0=16, C=12, N=14)
The complex [Ni(H20)6]CI2 is inert because it has six electrons in the t2g * .orbitals true ]:] Error |:| If the complex absorbs rays in the * .ultraviolet region, it appears yellow Error D true |:| The metal halide complexes are expected to absorb light in the *.region red. O green. O blue. O
Give the systematic name for the following coordination compound or complex ion: + CI Co…C/ NH3 H3N/ H3N NH3
In which of the following cases all complexes are square planes? (27Co, 28Ni, 46Pd, 78Pt, 79Au) A. [PtCl4] 2-, [AuCl4] -, [PdCl4] 2-, [NiCN4] 2- B. [Ni (CO) 4], [CoCl4] 2-, [AuCl4] -, [NiCN4] 2- C. [PtCl4] 2-, [PdCl4] 2-, [CoCl4] 2-, [Ni (CO) 4] D. [AuCl4] -, [PdCl4] 2-, [NiCN4] 2-, [Ni (CO) 4]
3.) Name the following coordination complexes: a.) K3 [Mo (CN); ] c.) e.) (H3N) (H3N Co CI (NH3) CI CH2NH2 LNH,CH, [PK] CH,NH, NH, CH, CI b.) [Co (NH3)4 CO3] NO3 d.) OC.. OC- OUIMICO M-CO M is Fe