Q: 5. What is the pH of a 0.80 M Cu(NO3)2 solution? (Ka for Cu²+ (aq) = 3.0 × 10-⁹)
A:
Q: O O O HO H 1. LIAIH4 2. H+ 3. PCC ? Major Organic Product
A: Lithium aluminium hydrate is strong reducing agent it will reduces ester group to primary alcohol.
Q: Balance the following redox reaction in basic solution: Cr₂O72 + CN1 -> Cr+3 + CNO-1
A: The oxidation state of Cr in is +6The oxidation state of C in CN- is +2.The oxidation state of C in…
Q: Give some advantages and disadvantages of the high tensile strength nanowires when it is made by the…
A: Nanowires are unique structures with exceptional properties due to their small size and high…
Q: Part G. Molecules with Oxygen and Nitrogen. Organic molecules often contain the elements oxygen and…
A: Constitutional isomers are compounds that have the same molecular formula but different connectivity…
Q: IIL Theoretical yield of chemical reactions Gaseous methane (CH4) reacts with gaseous oxygen gas…
A: When gaseous methane ( CH4 ) reacts with gaseous oxygen ( O2 ) to form gaseous carbon dioxide ( CO2…
Q: In the electrolysis of water, how long will it take to produce 75.00 L of H₂ at 1.0 atm and 273 K…
A:
Q: A solution is prepared at 25 °C that is initially 0.35M in diethylamine ((C₂H3)₂NH), bromide…
A: pH + pOH = 14
Q: Determine the molecular or formula mass of each of the following compounds. (For this exercise,…
A: When the masses of all the atoms present in a molecule are added, the value obtained is referred to…
Q: Rank the following compounds (A-E) based on the acidity of the highlighted Hs (#1 most acidic; #5…
A: Acidity is measured on a pH scale, which ranges from 0 to 14. The lower the pH level, the stronger…
Q: HH R-C-C-R HX 1. The halide ion as the leaving group leaves initially. II. The halide ion as the…
A: To answer the given questions, first we need to know about E1 and E2 reactions.E1 reactions are…
Q: Match the gas sample on the left with a description on the right. You may use the same answer more…
A: The speed of a gas particle depends on the temperature of the gas and its molar mass. The average…
Q: O Br 1. LIAIH₂ 2. H* 3. H₂SO₂. heat ? Major Organic Product
A: Reaction of acid chloride withLiAlH4H+H2SO4, heat
Q: How long does it take to deposit a coating of gold 1.00 μm thick on a disk-shaped medallion 4.00 cm…
A: According to the Faraday first law of electrolysis, the amount of substance deposited at any…
Q: 0=5 CH CF3CO3H
A: yes, this reaction produced benzoic acid.
Q: A student sets up the following equation to convert a measurement. (The ? stands for a number the…
A: 1 Kg = 103 g 1 m = 102 cm
Q: What is the quantity of heat (in kJ) associated with cooling 205.5 g of water from 25.60 °C to ice…
A: Given mass of water ice, m = 205.5 g Molar mass of water = 18.02 g/ mol Therefore,moles of water =…
Q: Select ALL the correct net ionic equations 2AgNO3 (aq)+ Na2CO3 (aq)--> 2NaNO3 (aq)+ Ag2CO3 (s)…
A:
Q: A dye molecule can exist in one of three forms, shown below. Which of the three has the largest Amax…
A: The wavelength of the absorbed light by an organic molecule depends on the extent of conjugation…
Q: Part B Calculate the solubility of Mn(OH)₂ in grams per liter when buffered at pH=9.4. Express your…
A: “Since you have posted multiple questions, we will provide the solution only to the first question…
Q: pace X XOBQB Calculate the pH of 0.055M NH3 (K₁ scratch paper. = WEBCAM SCREEN 1.8x10-5). Show all…
A: Details
Q: 7. One step in the production of SDS detergent is the reaction below. + HO H₂SO4 C. SN2 d.…
A: In the given reaction we have to determine the type of reaction taking place.Here the reaction given…
Q: A solution contains 1.19x10-2 M cobalt(II) acetate and 1.29x10-2 M copper(II) nitrate. Solid sodium…
A: ind
Q: Write a balanced half-reaction for the reduction of aqueous hydrogen peroxide H2O2 to liquid…
A: A redox reaction is always accompanied by a reduction and an oxidation reaction.Reduction : Gain of…
Q: The reaction that occurs between 1,3-butadine and ethene at high temp and pressure is a/an: O…
A: we have to determine the type of reaction that occurs between 1,3-butadiene and ethane
Q: What is the major organic product of the following reaction? (CH3)2NH TSOH Il app.honorlock.co
A: When cyclohexanone reacts with dimethylamine in presence of acid a hydroxyl amine is formed, further…
Q: What is the final product of the following reaction? NaOH, Cl₂ (excess
A:
Q: Which of the following pairs will not form a buffer when mixed together in an aqueous solution?…
A:
Q: 8. Calculate the theoretical yield (in grams) of cyclohexyl acetate if 2.75 g of cyclohexanol…
A: Reaction of acetic anhydride with cyclohexanol gives cyclohexylacetate as a product.Weight of acetic…
Q: A galvanic cell is powered by the following redox reaction: 3 Fe³+ (aq) + MnO₂(s) + 4 OH (aq) 2+ 3…
A: A redox reaction of a galvanic cell is given.
Q: احا anyMS 2:01 +H جمله مش ضد Ha :g OH مطة ا
A: In our mechanism base will abstract acidic protons. Then after formation of enolate ion i.e inol…
Q: Reasoning by analogy from what you learned about solutions of weak polyprotic acids, what is the…
A:
Q: 10. Predict the products for each of the following (c) 1) MCPBA 2) NaSH 3) H₂O ?
A: According to Q&A guidelines of Bartleby, we are supposed to answer only the first question out…
Q: What is the major neutral organic product for the following transformation?
A: Claisen condensation is the condensation between two esters or ketone in presence of strong base…
Q: 0 Draw all possible structures for the following ions and identify the most likely structure using…
A: Draw all possible structures for the following ions and identify the most likely structure using…
Q: Can you pls assist me with the mechanism of Benzyl alcohol being oxidised to Benzyl aldehyde and to…
A: Data
Q: Question 4: What is the binding energy, kJ/mol, of an electron in a metal whose threshold frequency…
A: Photoelectric effect: The spontaneous emission of electrons from the surface of metals when light or…
Q: What are the correct reaction conditions for the following transformation? 1. DIBAI-H, -78 C 2. H3O+…
A: NaBH4 reduces aldehyde, ketone and acid halide to alcohol.LiAlH4 reduces acid halide to…
Q: For the following compound, predict three Phase 2 reactions possible at the nucleophilic site in the…
A: Para-cresol reacts with chlorofom in alkane medium to give the compound A is a p-methyl hydroxy…
Q: H₂CO CH3 Дон . H2SO. 2) NazCrzO, H2SO., heat
A: First reaction are a Friedel Craft reactionSecond reaction are a oxidation reaction in which…
Q: A standard galvanic cell is constructed with Zn2* | Zn and Fe²+ | Fe half cell compartments…
A: A galvanic cell is constructed by two half cells which are Zn2+|Zn and Fe2+|Fe. We know that, in…
Q: compound C 7 H 14 O has the proton NMR spectrum shown below. Draw a reasonable structure that is…
A: The formula of the double bond equivalence (R) is R = .
Q: O -NH₂ H+ N H y N. ? Major Organic Product mo H N Ho
A: Product
Q: What is the product of the following reaction? NaBH4 H₂O
A: Sodium borohydride, NaBH4 is a reducing agent and it can selectively reduce a carbonyl functional…
Q: Which is the most acidic hydrogen in the following compound? D E C -H I H O H HH CN -H A -B
A: To get acidic strength first we remove acidic hydrogen after that we compare the stability of anion…
Q: o O o O 1. NaBH4 2. H3O+ PCC 1. LiAlH4 2. H3O+ ? 1. DIBAI-H, -78 C 2. H3O+
A: The given reaction is the conversion of ester to an aldehyde. This is a reduction reaction
Q: Given the chemical structures pictured below what is the proper, accepted chemical name for that…
A: The given compound contains an ester functional group. The name of the carboxylic acid part is…
Q: You have a solution with a concentration of 0.0000012 moles per liter (mol/L) of protons. What is…
A: In the question, concentration of proton is given and we have to find the pH of the solution.
Q: At 55°C aniline, C6H5NH₂, has a Kb = 8.2 *10-1⁰ What is the pH of a 0.035M solution in water? A)…
A: According to the Arrhenius theory of acid and Base A base is a compound that when dissolved in water…
Q: solution is made by mixing 260.0 mL of ethanol initially at 12.5 °C with 260.0 mL of water initially…
A: According to Law of calorimetry,amount of heat released by the substance having higher temperature…
Trending now
This is a popular solution!
Step by step
Solved in 5 steps with 4 images
- Give an IUPAC and common name for each of the following naturally occurring carboxylic acids: (a) CH3CH(OH)CO2H (lactic acid); (b) HOCH2CH2C(OH)(CH3)CH2CO2H (mevalonic acid).What is the major organic product of the following reaction? (a) (b) NaBH4 CH3CH₂OH ? (c) (d) OHThe key step in a reported laboratory synthesis of sativene, a hydrocarbon isolated from the mold Helminthosporium sativum, involves the following base treatment of a keto tosylate. What kind of reaction is occurring? How would you complete the synthesis?
- The action of heating one mole of water (containing a trace of acid catalyst) on one mole of compound Y produces one mole of CH,COOH and one mole of CH, CH,NH, The structure of Y is: Select one: O CHCNCCH, CH,CH,NHCH,CH, OH CH CHNHCH,CH, O CHCH,CNHCH; O CH;CH NHÖCH;Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OHName the following carboxylic acid derivatives, giving both a common name and anIUPAC name where possible.(a) PhCOOCH2CH(CH3)2
- Draw the product formed when (CH3CH2)3N:, a Lewis base, reacts with each Lewis acid: (a) B(CH3)3; (b) (CH3)3C+; (c) AlCl3.Explain why each of the following carboxylic acids cannot be prepared by a malonic ester synthesis: (a) (CH3CCH;COOH; (b) C,H;CH2COOH; (c) (CHa)CCOOH.PQ-16. What is the major product of this reaction? OH (A) (B) 2) H3O+ H (C) (D) H