How would you synthesize the following substances from benzaldehyde and reagents from the table? In general, the fewer the steps, the better the synthesis. You should not need more than four steps. Use letters from the table to list reagents in the order used (first at the left) with no commas. Example: cag a CH2=0 Reagents f 1. CH3MgBr/dry ether 2 H₂O* j 1. P(C6H5)3 2. BuLi Br₂ b O C (C6H5)3P-CH2 g Dess-Martin periodinane in CH2Cl2 h 1. NaBH4 2. H3O+ 1. PBг3 d m NH + acid i 1. BH3/THF NaNH2/NH3 2. H2O2/NaOH CrO3/H₂O* n Mg/ dry ether a) Previous Next

How would you synthesize the following substances from benzaldehyde and reagents from the table? In general, the fewer the steps, the better the synthesis. You should not need more than four steps. Use letters from the table to list reagents in the order used (first at the left) with no commas. Example: cag a CH2=0 Reagents f 1. CH3MgBr/dry ether 2 H₂O* j 1. P(C6H5)3 2. BuLi Br₂ b O C (C6H5)3P-CH2 g Dess-Martin periodinane in CH2Cl2 h 1. NaBH4 2. H3O+ 1. PBг3 d m NH + acid i 1. BH3/THF NaNH2/NH3 2. H2O2/NaOH CrO3/H₂O* n Mg/ dry ether a) Previous Next

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter11: Ethers, Epoxides, And Sulfides

Section: Chapter Questions

Problem 11.42P

See similar textbooks

Similar questions

How would you synthesize the following compounds from cyclohexanone using reagents from the table? Use letters from the table to list reagents in the order used (first at the left). Reagents a 1. CH3MgBr/dry ether 2 H3O+ e 1. OsO4 i 1. BH3/THF 2. NaHSO3/H2O 2. H₂O₂ / NaOH b 1. C6H5MgBr / dry ether f 1. NaBH4 j Mg / dry ether 2 H3O+ 2. H3O+ с PBr3 g HOCH2CH2OH/HCI k H2/Pd d m-chloroperbenzoic h H3O+ / heat I CrO3 / H3O+ acid m cyclohexanone a) cyclohexylbenzene b) 2-phenylcyclohexanone Submit Answer Try Another Version 3 item attempts remaining
How would you synthesize the following compounds from cyclohexanone using reagents from the table? Use letters from the table to list reagents in the order used (first at the left). Reagents a 1. CH3MgBr / dry ether 2 H3O+ e 1. OsO4 i 1. BH3/THF 2. NaHSO3/H₂O 2. H₂O₂ / NaOH b 1. C6H5 MgBr / dry ether f 1. NaBH4 j Mg / dry ether 2 H3O+ 2. H3O+ C PBг3 g HOCH2CH2OH/HCI k H2/Pd d m-chloroperbenzoic h H3O+ / heat 1 CrO3 / H3O+ acid a) 2-phenylcyclohexanone b) cyclohexylbenzene m cyclohexanone
Ethers/Aldehydes/Ketones SynthesisPrepare the following compounds from any simple alkyl halide having four carbons or less,cyclohexane, and/or benzene. You may also use ethylene oxide (oxacyclopropane). SHOW ALLSTEPS AND REAGENTS with arrows.
This is a multistep syntheses. More than one reagent/reaction will be necessary to produce the product. Provide all necessary reaction conditions (HBr, HgSO4, etc.) and the products produced after each step of the synthesis.
Ethers/Aldehydes/Ketones SynthesisDraw and Prepare the following compounds from any simple alkyl halide having four carbons or less,cyclohexane, and/or benzene. You may also use ethylene oxide (oxacyclopropane). SHOW ALLSTEPS AND REAGENTS with arrows.
b) Synthesize the following product starting with phenol (hydroxybenzene). NO₂ OH HO. phenol
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Show how to synthesize the following product as the major product starting with 2,2-dimethylpropane as the starting material. You may use additional reagents and any number of steps. Be sure to list each step with all reactants/reagents/conditions required. (Do not use hydrogenation reactions). Write the process.
What is a suitable synthesis to complete the transformation below? Show all steps with reagents and products.
Provide the reagents necessary to carry out the following conversion: 4-methyl-cyclohexanol -------> 4-methyl- cyclohexanone O KMNO4/NAOH/H20 peroxyacetic acid O Br2, CCl, O NazCr207/H2SO2/H2O O OsO4
Question 11 Propose best Williamson ether syntheses for the following compounds. Select all applicable options (multiple answers can be possible). Note: Some compounds cannot be made using Williamson synthesis reaction. A: Хон OH ΚΗ مر OK Br SN2 KH B: OH OK SN1 C: Α ABC ☐ C 1000 Br Cannot be synthesized using Williamson ether syntheses.
Describe how 1-ethylcyclohexanol can be prepared from cyclohexane. You can use any inorganic reagents, any solvents, and any organic reagents as long as they contain no more than two carbons.