Give the main organic product for the following reaction: CH2OH OH H3O* CH3CH2CH2OH OH OH OH

Q: What is the major organic product of the following reaction. он H. 1. н', но OH H. он 2. CH;MgBr 3.…

A:

Q: What is the major organic product obtained from the following reaction? OH ,HSO,

A:

Q: 1. Complete balanced equations and name the organic products for the following reactions. State any…

A: When Acetaldehyde is treated with, Tollen's reagent, it gives characteristic test for aldehydic…

Q: What is the product for the following reaction? 1) Sia₂BH 2) H₂O₂/NaOH LOH OH

A:

Q: What is the major organic product? 1) MeMgBr (1eq) 2) NH4 HO, H

A: The major organic product can be identified as

Q: 1. Complete balanced equations and name the organic products for the following reactions. State any…

A:

Q: What is the major organic product of the following reaction? 1. NaOEt 2. H30*

A: 1. We have reaction of diester compound with base we have to predict the major product. 2. We have…

Q: What is the major organic product obtained from the following reaction? 1 mol HBr

A: The reaction given is,

Q: What is the major organic product of the following reaction? 1. ВНз 2. H202, HO- OH II II IV A)I B)…

A: It is hydroboration oxidation reaction.

Q: Explain why metal hydride reduction gives an endo alcohol as the major product in one reaction and…

A: The metal hydride here used is Lithium Aluminum hydride, which is a reducing agent and acts as a…

Q: A. Give the reacton on how to convert the following organic compounds. 1. Butyric anhydride 2.…

A: Given: Names of some compounds and structure of some compounds To Find: To draw the structures of…

Q: H2O CI

A:

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: % Yield of the reaction is a measure of reaction efficiency in terms of the amount of product formed…

Q: NH2 What are the corresponding carboxylic acid and alcohol that yield this ester? O Acetic acid and…

A: In this questions, we will see the starting material ( Carboxylic acid and alcohol ) which making…

Q: Draw the structure of the major organic product of the following reaction Draw the structure(s) of…

A: The reagent Ag2O in aqueous NaOH acts as an oxidising agent which oxidises the aldehyde into…

Q: raw the main organic product formed in each of the following reactions: O i a) 5) c) + H₂O OCH 3 i…

A:

Q: A

A:

Q: Brz, H,O* tert-Buto A CEN O:

A: The hydrogen on the alpha carbon of the ketone group is acidic. hence it can be protonated. So when…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: Given Chemical reaction: CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Mass of butanoic…

Q: Complete the following reaction of a thiol with an oxidizing agent. Draw the structure of the major…

A:

Q: (a) CH;CH,COOH + CH;OH he esterification products of the following acid/alcohol pairs. (b) CH;CH,OH…

A: Esterification is the process of combining an acid with alcohol to form Ester and water. In this…

Q: What is the major organic product of the following reaction? H* (cat.) + HO, О НО ОН

A:

Q: Give the major organic product for the following reaction. OH H AGNO3 NH,CH O 2-Hydroxyhexane…

A: The given organic Transformation will give 4-hydroxypentanoic acid as the major product reagent used…

Q: The acid catalyzed hydrolysis of the ester, CH3CH>COOCH3 will yield which one classification of a…

A: Acidic hydrolysis of ester is the reaction in which an ester is treated with an acid to yield a…

Q: 1) BH3, THF 2) H2O2 H,O, NAOH 10. 3) NaH 4) CH3B

A:

Q: 3. What is the major organic product of the following reaction 1, NABH4 2. H30* What is the major…

A:

Q: The organic product formed when propanoic acid reacts with ethanol in the presence of an acid…

A: Ans A

Q: What is the major organic product obtained from the following reaction? 1. NABH, 2. H2O

A: This is an exapmle of reduction of a ketone using NaBH4 reducing agent resulting in the formation of…

Q: What is the major product of the following acid-catalyzed dehydration reaction? OH H,PO4, A OH A. В.…

A: Secondary alcohols reacts with acids in presence of heat and undergo dehydration reaction producing…

Q: Draw the structure of the major organic product(s) of the reaction. H30 N-

A:

Q: a. ОН FeCl, + `CH3 b. CH, „OH FeCls + > C. OH OH FeCl, d. ОН ОН

A: The given reactions are examples of the complexation, coupling, oxidation and dehydration reactions…

Q: What is the product of the oxidation of the below compounds by the following oxidizing agents KMN04,…

A:

Q: Draw the major organic product for the reaction. H2O cat. TFOH -H-

A: Alkynes can be hydrated to form enols that immediately tautomerize into ketones. The addition of a…

Q: What is the major organic product of the following reaction? 1. ВН, 2. H2O2, HO он OH II IV %3D

A: The major product of the following reaction has to be given,

Q: What is the major organic product of the following reaction? trace H* HạN

A:

Q: What is the major product produced in the given reaction? A 1. B 2. D OH 1. NaOH major product 2.…

A:

Q: OH H,SO. A +

A:

Q: If the following structure undergoes oxidation reaction, which of the product(s) will form: ОН…

A: Welcome to bartleby !

Q: Write reactions of 2-methylbutanoic acid with the following reagents: a. CH3OH/H+ b. PBr5.

A: Carboxylic acid reacts with Alcohol to give ester by the elimination of water. Carboxylic acid in…

Q: Draw the organic products of the following reaction. Selec CH3 HCI H3C H,O ČH3

A: Given molecule is imine. Imine on hydrolysis gives amine and aldehyde or ketone.

Q: HF

A: Introduction: In the given reaction, cyclopentane forms carbocation by abstracting hydrogen from the…

Q: Give the IUPAC name for the major organic product obtained from the following reaction. H3C-C=c Na…

A:

Q: What is the major organic product obtained from the following reaction? 1. BH3 HO 2. H,O2 OH NAOH OH…

A: When 2-methyl 2-butene is treated with BH3 and H2O2 in presence of NaOH then the alcoholic group is…

Q: Draw the structure of the major organic product(s) of the reaction. NaOH H20 ČH3

A:

Q: CH₂OH cyclohexylmethanol Na₂Cr₂O7 H₂SO4 O C-OH cyclohexanecarboxylic acid (92%)

A: Na2Cr2O7 and H2SO4 are reagents which are used to oxidize organic compounds.

Q: pH 4.5 H,C. `CH, + *CH3 `NH,

A: The imine is an organic compound that contains a -C=N- bond. It is formed during the condensation…

Q: 1. Draw clear structures for the organic products of the following reactions. NaOEt EHOH b. HNO,…

A: while getting the product, once needs to take care of reagent given. Product of each reaction is…

Q: What two alkenes give rise to each alcohol as the major product of acid-catalyzed hydration?

A: Alcohols are the organic compounds with the functional group -OH. Alkenes are the organic compound…

Q: CH3 H,0 OH

A: Epoxy reacts with water in presence of base i.e OH- ions to produce diols.

Q: What is the major organic product of the following reaction. HF D B. OOO

A: In this question we have to tell the product of the reaction.