Gaseous methane (CH,) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO,) and gaseous water (H,O). If 1.97 g of carbon dioxide is produced from the reaction of 4.7 g of methane and 6.1 g of oxygen gas, calculate the percent yield of carbon dioxide.

Gaseous methane (CH,) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO,) and gaseous water (H,O). If 1.97 g of carbon dioxide is produced from the reaction of 4.7 g of methane and 6.1 g of oxygen gas, calculate the percent yield of carbon dioxide.

World of Chemistry

7th Edition

ISBN:9780618562763

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 49A

See similar textbooks

Related questions

Q: Suppose you buy a 50.0 pound propane tank for your gas grill. The combustion of propane gas (C3H8)…

Q: The chemical formula for hydrogen fluoride is HF. A chemist measured the amount of hydrogen fluoride…

A: Since you have posted multiple questions, we are entitled to answer the first only.

Q: Gaseous ethane (CH₂CH3) reacts with gaseous oxygen gas (0₂) to produce gaseous carbon dioxide (CO₂)…

A: Given Mass of ethane = 6.9 g Mass of O2 = 6.4 g Actual yield of water = 1.20 g Percent yield of…

Q: (CH,(CH,),CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (Co,) and…

Q: Percent yield of chemical reactions O 1/5 Gaseous methane (CH) reacts with gaseous oxygen gas (0,)…

Q: for fuel It is proced as the sole product of the combination of carbon monoxide gas and hydrogen gas…

A: Balanced chemical reaction, CO+2H2 -> CH3OH Mass of H2 = 532 g Molar mass of H2 = 2 g Molar mass…

Q: Liquid octane (CH (CH,) CH, reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Gaseous methane (CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: Given, Gaseous methane (CH4) react with gaseous Oxygen (O2) gas to produce gaseous carbon dioxide…

Q: In an industrial process, nitrogen is reacted with hydrogen to produce ammonia. The percent yield of…

A: Given, Actual mass of ammonia, NH3 produced = 4.8 kg = 4800 g (1 kg = 1000 g) Percent yield = 28…

Q: Hydrogen gas is considered a clean fuel because it produces only water vapor when it burns. If the…

A: Combustion reaction of hydrogen gas is H2 + 12 O2 → H2O Given that , mass of water (H2O) formed =…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: Ethane reacts with oxygen to form carbon dioxide and water. The equation for the balanced chemical…

Q: (CH,(CH,),CH,) reacts with gaseous oxygen gas (O, to produce gaseous carbon dioxide (CO,) and…

A: Chemical reactions occur according to the stoichiometry of the reactants. The reactant which is…

Q: For the reaction, Na2CO3 + Ca(NO3)2 → CaCO3 + 2NaNO3. How many grams of calcium carbonate, CaCO3,…

A: Balanced chemical equation: Na2CO3 + Ca(NO3)2 → CaCO3 + 2NaNO3 Number of moles of CaCO3 = number of…

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: number of moles = mass/molar mass mass = moles × molar mass percent yield = {actual…

Q: Gaseous methane (CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

Q: Methanol can be formed by the following UNBALANCED equation below. What is the mass in grams of…

A: Molecules of CO= 145 Molecules Mass of methanol=?

Q: Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

Q: Methanol can be formed by the following UNBALANCED equation below. What is the mass in grams of…

A: We have to predict the mass of methanol that can be formed.

Q: Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: 1.14 g of sodium bromide is produced from the reaction of 3.2 g of hydrobromic acid and 2.7 g…

Q: Gaseous butane (CH;(CH,),CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Liquid hexane (CH,(CH,) CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Hexane reacts with oxygen to form carbon dioxide and water. The equation for the balanced chemical…

Q: Nitric oxide (NO) reacts with oxygen gas to form nitrogen dioxide (NO2), a dark brown gas: 2NO(g)…

A: Given: moles of NO = 0.871 mol moles of O2 = 0.506 mol

Q: Methanol can be formed by the following UNBALANCED equation below. What is the mass in grams of…

A: First one need to balance the equation 2H2(g) + CO(g) →CH3OH(l) Now mole Concept need to applied.

Q: carbon Gaseous ethane (CH, CH, reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Chemical equation for the given reaction is: 2C2H6+7O2→4CO2+6H2O According to above reaction, 2…

Q: Liquid hexane (CH; (CH,), CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: No. of moles = mass/molar mass Mass = moles × molar mass Percent yield = {actual yield/theoretical…

Q: Liquid hexane (CH,(CH,) CH, reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

A: Given, Liquid hexane (C6H14) react with gaseous Oxygen (O2) gas to produce gaseous carbon dioxide…

Q: Nitrogen reacts with chlorine to produce nitrogen trichloride. If 10.0 g of nitrogen react with 12.0…

Q: A chemist measures the amount of bromine liquid produced during an experiment. She finds that 2.3 g…

A: Given :- mass of bromine liquid produced = 2.3 g To calculate :- Number of moles of bromine liquid…

Q: Considering the reaction below, _______ is the limiting reactant when 26.0 g of acetylene (C2H2) and…

A: The limiting reagent in a chemical reaction is a reactant that is totally consumed when the chemical…

Q: Gaseous butane (CH,(CH,),CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Q: Citric acid (C6H3O7), named for its natural occurrence in citrus fruits, is produced in large…

A: Given; C12H22O11 + 3O2 ➝ 2C6H8O7 + 3H2O Note: (1Kg = 1000g) Mass of sucrose (C12H22O11) = 600.0 Kg =…

Q: The reaction between potassium chlorate and red phosphorus takes place when you strike a match on a…

A: The given reaction is not balanced. The balanced reaction is as follows. 10 KClO3+3 P4 →3 P4O10 + 10…

Q: Chloroform, CHCl3, reacts with chlorine, Cl2, to form carbon tetrachloride, CCl4, and hydrogen…

A: Limiting reactant can be defined as the reactant that get totally consumed in the reaction and…

Q: Because of increasing evidence of damage to the ozone layer, chlorofluorocarbon (CFC) production was…

A: Given : Mass of CFC in each automobile = 1.5 Kg Number of automobiles = 100 million = 100 X 106 =…

Q: Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: Gaseous methane (CH4) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,)…

A: We have to calculate the % yield of carbon dioxide.

Q: 1. Aluminum metal reacts with aqueous sulfuric acid to produce aqueous aluminum sulfate and hydrogen…

A: 1. The maximum amount of Aluminium sulphate that can be produced is 58.8 g

Q: Gaseous ethane (CH;CH;) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO2)…

A: Balanced chemical equation for the combustion of ethane: 2C2H6 + 7O2 → 4CO2 + 6H2O +…

Q: For the reaction, Na2CO3+Ca(NO3)2-->CaCO3+2NaNO3 how many grams of calcium carbonate, CaCO3, are…

A: The balanced chemical equation is, Na2CO3 + Ca(NO3)2 → CaCO3 + 2NaNO3 The number of moles of Na2CO3…

Q: Suppose 90.0 g of Iron (III) chloride reacts with 17g of water? What is the limiting reagent? How…

Q: Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: As per the given information, the balanced chemical reaction can be written as: HBr+NaOH→NaBr+H2O…

Q: Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: We have to the percentage yield of H2O formed in the above reaction

Q: A particular chemical reaction that produces benzene has a percent yield of 35.5% If you want to…

A: % yield = {actual yield/ theoretical yield} × 100

Q: Percent yield of chemical reactions O 0/5 El (CH,(CH,),CH,) reacts with gaseous oxygen gas (0,) to…

Q: Propane, C3H8, a fuel used in many outdoor grills, burns in oxygen produce carbon dioxide gas, CO2,…

A: Given: Moles of propane = 2.0 mol

Q: Citric acid (C6H$O7), named for its natural occurrence in citrus fruits, is produced in large…

A: Citric acid named for its natural occurrence in citrus fruits, is produced in large quantities…

Q: Gaseous methane CH4 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and…

A: Combustions reactions are the reactions where an organic compound or hydrocarbons burns completely…

Q: What is the percent yield of Na?

A: Given :- Actual yield = 26 g Theoretical yield = 46 g To calculate :- percent yield

Q: C3H8 + 5O2 → 3CO2 + 4 H2O, with the given equation, thirty (30) grams of C3H8 burns in air to…

Q: Liquid octane (CH, (CH,) CH, reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide…

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

100%

please see the attached image

Gaseous methane (CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO,) and gaseous
water (H,O). If 1.97 g of carbon dioxide is produced from the reaction of 4.7 g of methane and 6.1 g of oxygen gas,
calculate the percent yield of carbon dioxide.
Round your answer to 2 significant figures.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For the chemical reaction C3H8O2+4O23CO2+4H2O how many product molecules are formed when nine C3H8O2 molecules react?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g of CaO was obtained out of a possible 203.9 g ofCaO. a. What is the theoretical yield of CaO? b. What is the actual yield of CaO? c. What is the percent yield of CaO?
3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Propane, C3H8, is the fuel of choice in a gas barbecue. When burning, the balanced equation is C3H8+5O23CO2+4H2O a What is the limiting reactant in cooking with a gas grill? b If the grill will not light and you know that you have an ample flow of propane to the burner, what is the limiting reactant? c When using a gas grill you can sometimes turn the gas up to the point at which the flame becomes yellow and smokey. In terms of the chemical reaction, what is happening?
The element magnesium reacts with the element oxygen to form a white solid compound, magnesium oxide. When a sample of magnesium that weighs 24.30 g reacts with oxygen, it is found that the magnesium oxide produced weighs exactly 40.30 g. (a) Calculate the mass of oxygen in the magnesium oxide. (b) Calculate the mass of magnesium oxide that could be produced from 40.0 g magnesium.
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?
3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.