Answered: Explain why diethyl ether…

Explain why diethyl ether (CH3CH2OCH2CH3) and butan-1-ol (CH3CH2CH2CH2OH) have similar solubility properties in water, but butan-1-ol has a much higher boiling point.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter10: Fuels, Organic Chemicals, And Polymers

Section: Chapter Questions

Problem 91QRT

See similar textbooks

Related questions

Q: E. Which member in each of the following pairs will be more soluble in water?Explain. a.…

Q: Write IUPAC and common names for ethers.

A: The IUPAC name of an organic compound is written on the basis of the certain rules laid down by…

Q: Draw an isomer of C5H10O that contains an ether

Q: 2,4,6-Trinitrophenol is known by the common name picricacid. Picric acid is a solid but is readily…

Q: CH;CH2OH or CH3-O-CH3 CH;OH or CH3CH2OH

A: We have two set of compound , we have to predict which among the two will be having higher boiling…

Q: . Name this ether correctly. CH3CH2CH2CH2-O-CHCH=CHCH3 ČH3

A: IUPAC rules : Ethers name should be "alkoxyalkane" , lower carbons chain should be alkoxy side ,…

Q: CH3CHCH2OCH,CH3

A: IUPAC nomenclature of organic compounds is useful in naming organic compounds tointernational…

Q: The heat of combustion of either but-1-yne or but-2-yne is -2577 kJ/mol (-615.9 kcal/mol), whereas…

A: The heat of combustion is the amount of heat energy liberated upon combustion of 1 mole of an…

Q: Draw the organic products formed when 2-bromo-3-pentanone (CH,CH,COCHBrCH3) is treated with each…

A: The products formed when 2-bromopentan-3-one is treated with Li2CO3, LiBr, DMF is given as,

Q: What general conclusions can be drawn regarding the solubility of alcohols in water? Explain which…

A: Alcohol can be defined as the organic compound in which hydroxyl group is attached to carbon atom.

Q: Give the IUPAC name for each compound. CH3 CH2CH3 Br a. PHCH(CH3)2 b. С. d.

A: Since you have posted multiple sub-parts, the answer for first three sub-parts are given below.…

Q: Draw the structures of two specific ethers that have the formula C4H10O

A: Structures of two specific ethers that have the formula C4H10O

Q: 1) Select the correct IUPAC name for: CH3 CH3CH2CH2CH2CCH2CH3 CH2CH2CH3 A) 5-methyl-5-ethyloctane B)…

A: To write the IUPAC name of a chemical formula first we have to find out the parent chain.i.e. having…

Q: Br CH3 || H3C-CH-CH2-CH-CH2-C-OH IUPAC Br CH3 || H3C-CH-CH2-CH-CH2-C-OH

A: IUPAC is the universal name of the compound

Q: name the following ether using (Non-IUPAC) CH3CH2CH(CH3)OCH2CH2CH3

A: Ether group ( R - O - R' ) In the Ether group , the Oxygen atom is bonded by the two sides by the…

Q: What is the IUPAC name of the following compound? a. trans-1-isopropyl-4-methylcyclopentane b.…

A: In this question, we will write the IUPAC name of the compound. You can see the details solution…

Q: Can i get help step by step please

A: The IUPAC name of the given compound can be arrived at by considering its structure, substituents…

Q: Which alcohol is the most soluble in water? A CH;CH2CHOHCH3 B CH;CH2CH2CH2OH C (CH3)2CHCH2OH D)…

Q: -. Give the IUPAC name of each alkyne. (d) CH3 CH3 CH3CH2CC=CCHCH3 CH3 ČH3

Q: In each pair of compounds, pick the one with the higher vaporpressure at a given temperature.…

A: Introduction: The main criteria of having the higher vapor pressure at a given temperature is that…

Q: Explain why n-butanol has a higher boiling point than methyl tert-butyl ether.

A: The structure of the n-butanol and methyl tert-butyl ether is as follows:

Q: Give the IUPAC name of the following alcohols: a. CH;CH2CH2CH2CH2CH2CH2CHCH2CH3 OH b.…

A: Iupac naming of the given compounds.

Q: Diethyl ether (CH3CH2OCH2CH3) and butan-1-ol (CH3CH2CH2CH2OH) are constitutional isomers with the…

A: The boiling point of the compound depends on the intramolecular forces of the compound.

Q: Give the proper IUPAC name for the molecule shown as a Fischer projection. Make sure to include the…

A: For naming the organic compounds IUPAC have certain rules. Some basic rules are the following.…

Q: Diethyl ether can be converted to alcohol by heating with * HI NaOH Water O KMN04 Which is not true…

A: The organic compound diethyl ether has formula C2H5OC2H5. Alkynes have C≡C triple bond.…

Q: What is the IUPAC name for this compound? Visited CH;CH2CH2 -CN-CH3

Q: The boiling point of cis-but-2-ene is 3.7 °C, whereas that of trans-but-2-ene is 0.9 °C. Explain.…

A: The boiling point of cis-but-2-ene is higher than trans-but-2-ene . This has to be explained The…

Q: Draw the structure of the major product of benzene + CH3CH2CH2Cl in AlCl3

A: The reaction of benzene with R-X by using anhydrous AlCl3 to produce the corresponding alkyl benzene…

Q: Ethers can be classified as open chain or cyclic. Open chain ethers can contain rings. What is the…

Q: a. 1-Methylcyclopentanol b. trans-2-Methylcyclopentanol

Q: In which solvent is cyclohexane most soluble? Water Diethyl ether Hexanol ethanol

A: Miscibility or Solubility of cyclohexane in given solvent? Solution is the composition of both…

Q: Draw your prefered structure for any or for all: a. 5-secbutylnonane b.…

Q: What is the IUPAC name of CH₂CH3 CH3CHCHCH₂CH₂CH₂CH₂CH3 3 CH3 O2-ethyl-3-methyloctane…

Q: Give the IUPAC name for each compound: (CH3)3CCH2CH(CH2CH3)2 CH3(CH2)3CH(CH2CH2CH3)CH(CH3)2

A: The structures of the given molecules are shown below:

Q: CH3-CH2-C-o-CH3 butanone

Q: A 2-bromobutane react with methanol and form a enantiomeric pair of 2-methoxybutane. Draw the…

A: Enantiomeric pair of 2-methoxybutane

Q: isomer of C5H10O that contains an aldehyde

A: Isomers are molecules having same molecular formula but different molecular structures.

Q: R)-diaminebutane S)-diaminebutane R)-diaminebutane

A: Here, 2S rotates the plane polarized to left and 3R to right.

Q: Write IUPAC and common names for ethers.

A: Ethers are compounds containing an oxygen atom bonded to two carbon atoms via single covalent bonds.…

Q: What is the IUPAC name for the compound shown? CH3 H3C- -C- CH CH2- CH2-CH3 CH3 ČH2-CH3 IUPAC name:

Q: Although diethyl ether and tetrahydrofuran are both four-carbon ethers, one compound is much more…

A: An ionic bond can be defined as the electrostatic force of attraction between cation and anions.…

Q: Which is an example of an ether? A. CH3OH B. CH3CH2CH2Cl C. CH3CH2COOCH3 D. CH3CH2OCH2CH3

A: Ether have this general formula R1 -COO- R2

Q: Please provide your views ? below point are true or false ? a.) Alkenes have low melting points and…

A: Alkenes are the compounds that contains C=C bonds.

Q: Name the following Ethers Common Name 1. CH;CH,CH,OCH,CH,CH,CH3 2. CH;CH,CH,OCH3 3. CH;CHOCH,CH; CH3…

A: 1. Butyl propyl ether 2. Methyl n-propyl ether 3. Ethyl isopropyl ether 4. Cyclopropyl methyl…

Q: Be sure to answer all parts. Draw the structure corresponding to each IUPAC name. a.…

A: The structure of an organic compound is written in the following steps: Determine the number of…

Q: Draw the structure corresponding to the following IUPAC names: a) cyclohexanethiol b) methylphenyl…

Q: Explain why tetrahydrofuran has a higher boiling point and is much more water soluble than furan,…

A: The physical properties of any molecule can be easily determined by applying the facts of the Vander…

Question

Explain why diethyl ether (CH3CH2OCH2CH3) and butan-1-ol (CH3CH2CH2CH2OH) have similar solubility properties in water, but butan-1-ol has a much higher boiling point.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Trending now

This is a popular solution!

Step by step

Solved in 4 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

General Physical Properties of Organic Compounds

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Diethyl ether and butan-1-ol are isomers, and they have similar solubilities in water. Their boiling points are very different, however. Explain why these two compounds have similar solubility properties but dramatically different boiling points. CH3CH2¬O¬CH2CH3 CH3CH2CH2CH2¬OH diethyl ether, bp 35 °C butan-1-ol, bp 118 °C 8.4 mL dissolves in 100 mL H2O 9.1 mL dissolves in 100 mL H2O
H3C C CH₂CH3 CH₂MgBr+ Ether H₂O
Although diethyl ether and tetrahydrofuran are both four-carbon ethers, one compound is much more water soluble than the other. Predict which compound has higher water solubility and offer an explanation ?
Explain why these compounds (1-propanol, ethylene glycol, and ethanethiol) experience different intermolecular forces based on their molecular structure.
Diethyl ether[(CH3CH2)2O]is an imperfect anesthetic in part because it readily combusts in air to form CO2 and H2O. Write a balanced equation for the complete combustion of diethyl ether.
1: Give at least five (5) uses of Etherin medicine. CH3 CH,-0-C-CH, CH, common name: methyl-t-butyl ether (MTBE) IUPAC name: 2-methoxy-2-methylpropane diphenyl ether or phenyl ether phenoxybenzene Analyze the given ether. Then describe the structural formula.
The boiling point of cis-but-2-ene is 3.7 °C, whereas that of trans-but-2-ene is 0.9 °C. Explain. Hint: Identify which intermolecular interaction is responsible for the difference in boiling points. cis-But-2-ene trans-But-2-ene Boiling point = 3.7 °C Boiling point = 0.9 °C
Draw the structures of two specific ethers that have the formula C4H10O
Which of the following molecules is least likely to be a fatty acid? O H₂C-(CH₂)-COOH O H₂C-CH(CH=CH-CH₂)-(CH₂-COOH H₂C-(CH₂)-CH=CH-(CH₂)-COOH (CH₂)-CH-(CH₂)-COOH
Which of the following has the greatest solubility in water? O CH3O-K+ CH3OH CH3OCH3 (CH3)3CH
When trans-2-chloro-1-cyclohexanol is treated with a base, cyclohexene oxide is the product. However, when cis-2-chloro-1-cyclohexanol is treated with a base, the product is cyclohexanoneWrite the equation for the reaction between trans-2-chloro-1-cyclohexanol and the base to yield the cyclohexene oxide Why doesn’t the cis isomer yield the oxide?Write the mechanism for each of the two reactions. .
Ethanol, C2H5OH, and propane, C3H8, have approximately the same molar mass, yet ethanol has a much higher boiling point. Briefly explain why. Ethanol, C2H5OH, and dimethyl ether, CH3OCH3, have the same molar mass, yet ethanol has a much higher boiling point. Briefly explain why. Write an equation to show the reaction between ethanol, C2H5OH and methyllithium, CH3Li. Draw all non-bonding electrons and show electron flow with curved arrows. 37. Write an equation that shows the reaction between acetic acid (CH3COOH) and triethylamine (CH3CH2)3N. Draw all non-bonding lone electron pairs and show the electron flow with curved arrows.