Determine the standard enthalpy change of the following explosive reaction by using the appropriate enthalpies of formation.3NH NO3(s) + C₁0H₂2 (1)+140₂ (g) 3N₂(g) + 17H₂O(g) +10CO₂(g)-22→→→kJSubstanceNH₂NO3(s)C10H₂2 (1)0₂ (8)N₂(g)H₂O(g)CO₂ (8)ΔΗ,(kJ/mole)-365.6-249.70.00.0-241.8-393.5

Answered: Image /qna-images/answer/8821ba04-29f1-4115-a193-3a98fcaef4b3.jpg

Determine the standard enthalpy change of the following explosive reaction by using the appropriate enthalpies of formation. 3NH4NO3(s) +C10H22 (7) + 140₂ (g) - →3N₂(g) + 17H₂O(g) +10CO₂(g) kJ Substance NH4NO3(s) C10H22 (7) 0₂ (8) N₂(g) H₂O(g) CO₂(g) AHJ (kJ/mole) -365.6 -249.7 0.0 0.0 -241.8 -393.5

Determine the standard enthalpy change of the following explosive reaction by using the appropriate enthalpies of formation. 3NH4NO3(s) +C10H22 (7) + 140₂ (g) - →3N₂(g) + 17H₂O(g) +10CO₂(g) kJ Substance NH4NO3(s) C10H22 (7) 0₂ (8) N₂(g) H₂O(g) CO₂(g) AHJ (kJ/mole) -365.6 -249.7 0.0 0.0 -241.8 -393.5

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 77E: Give the definition of the standard enthalpy of formation for a substance. Write separate reactions...

See similar textbooks

Similar questions

9.73 Without looking up any numerical data or doing calculations, predict whether the enthalpy change for each of the following reactions should he positive, negative, or zero. (a) H2O(l)H2O(s) (b) N2(g)2N(g) (c) CH4(g)+2O2(g)CO2(g)+2H2O(l) (d) CO2(s)CO2(g)
The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
Write reactions for which the enthalpy change will be a. Hf for solid aluminum oxide. b. the standard enthalpy of combustion of liquid ethanol, C2H5OH(l). c. the standard enthalpy of neutralization of sodium hydroxide solution by hydrochloric acid. d. Hf for gaseous vinyl chloride, C2H3Cl(g). e. the enthalpy of combustion of liquid benzene, C6H6(l). f. the enthalpy of solution of solid ammonium bromide.
Sodium carbonate, Na2CO3, is used to manufacture glass. It is obtained from sodium hydrogen carbonate, NaHCO3, by heating. 2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation (Table 6.2).
Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.
Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJ
The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.
Use Hesss law to calculate the enthalpy change for the formation of CS2() from C(s) and S(s) [C(s) + 2 S(s) CS2()] from the following enthalpy values. C(s)+O2(g)CO2(g)rH1=393.5kJ/mol-rxnS(s)+O2(g)SO2(g)rH2=296.8kJ/mol-rxnCS2(l)+3O2(g)CO2(g)+2SO2(g)rH3=1103.9kJ/mol-rxn
A 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?