Choose the BEST IUPAC name or the following structure: O isobutyl propyl ether propyl sec-butyl ether butyl propyl ether sec-butyl propyl ether

Q: Give the IUPAC name and a common name for the following ether  CH3-CH2-O-CH2-CH2-CH3 CH3-O-CH3

A: Ether- Alkoxy derivatives of an alkane called as ether Ether has functional group is (R-O-R’) group.…

Q: Classify the following compound: CH3 H A. Hemiacetal В. Асetal C. Ketal D. Hemiketal

A:

Q: What is the IUPAC name of the ether that has the structure shown? -O-CH3

A: We have to predict the iupac nomenclature of given structure.

Q: Pls help ASAP

A: a) 2-methyl butanoic acid:- •Here carbon chain is of 4 carbon because there is -but- used. •Oic acid…

Q: The IUPAC name of the compound H- is (a) 5-formylhex-2-en-3-one (b) 5-methyl-4-oxohex-2-en-5-al (c)…

A:

Q: Name the IUPAC name or common name for the following ether: CH3-CH2-O-CH2-CH2-CH3

A: The compound given can be expanded as

Q: Give the IUPAC name for each alcohol HỌ CH3 (CH),CHCH,CHCH,CH3 CH̟CH,CH,OH CH,CHCH,CH,CH3 b. а. Но.…

A: Note: According to our guidelines we are supposed to answer only one question.  Kindly repost other…

Q: Select the common name for the ether shown. O 2-propan-2-yloxypropane dipropyl ether ethyl isopropyl…

A: According to common system, Ethers are named according to alkyl groupattached to the oxygen atom.…

Q: Draw the structures of the following compound and give it's IUPAC name: a. Methyl mercaptan b.…

A: Mercaptan: The organic compounds having thiol (-SH) as a functional group is called mercaptan. IUPAC…

Q: What is the IUPAC name of the following molecule? a E O 3-ethyl-4-sec-hexyl-hexan-3-ol O…

A:

Q: what are the structures of: Ethyl n-propyl ether Methyl n-butyl ether

A: The structures of the following compound has to be drawn.

Q: Glycerol contains:   a. oxygens which are each bonded to two alkyl groups b. oxygens single-bonded…

A: Given,  Glycerol

Q: The IUPAC name of CH3-O-CH2-CH2-CH2-CH3 is ---.     Question 26 options:   butyl pentyl ether…

A: The IUPAC name of CH3-O-CH2-CH2-CH2-CH3 is

Q: The IUPAC name of is Br (a) 2-methyl-3-bromohexanal (b) 3-bromo-2-methylbutanal (c)…

A: Aldehyde is a functional group with chemical formula R-CHO. Here, R represents the alkyl chain.…

Q: I. Use the IUPAC system to hame the following compounds CH) а. CH.CH,CH: CH) Br

A:

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

A: Given chemical formula, (a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

Q: What is the IUPAC name for the following compound? cyclohexyl ethyl ether ethyl cyclohexyl ether…

A:

Q: 9. What is the IUPAC of the following compound? (CH3CH2)3COH a) 2-Ethyl-2-pentanol b)…

A: Given,

Q: The correct IUPAC name of the compound (see atatched picture) A.) 1-carbonyl-2-methyl-4-pentanol…

A:

Q: STAT 1. Bisphenol A is prepared from: a) Benzene and Acetone b) Benzene and Phenol c) Acctone and…

A: Bisphenol A is prepared from the acid-catalyzed condensation of phenol and acetone.

Q: What's the IUPAC name for the structure shown below (the stem must have OH group)

A: The answer is given as follows

Q: ol lphenol ylphenol pyl benzene nypropane

A: As we know,   Propene with H3PO4 formed isopropyl carbocation as an electrophile. Then Friedel craft…

Q: Give the IUPAC name for the compound shown below. CH3 O-CH-CH3 O ethyl propanoate O propyl ethanate…

A: Group attached with oxygen called alkyl group And other part with oate

Q: Explain why n-butanol has a higher boiling point than methyl tert-butyl ether.

A: The structure of the n-butanol and methyl tert-butyl ether is as follows:

Q: What is the IUPAC name of the structure?   a. ethanoic acid b. butanoic acid c. methyl propanoate d.…

A: In this question we have to tell the IUPAC name of the compound.

Q: Write the IUPAC name for the below compound: (A) dicyclohexyl ether (B) cyclohexoxycyclohexane (C)…

A: In the naming of ether, when both the alkyl groups are same, we write the name of ether as dialkyl…

Q: Provide the IUPAC and common name for the ether shown:

A: (IUPAC)  - full form is The International Union of Pure and Applied Chemistry. it is a method of…

Q: 5. What is the IUPAC name for the following compound? a. 4-hexanone b. 3-hехanone c. ethyl propyl…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: What is the correct IUPAC name for the following structure: CHCH

A: The IUPAC name of the structure has to be given. The given structure is CHCH.

Q: Pick the best IUPAC name for the following molecule: CH3 CH3 O 1-butyl-2-propylphenyl O…

A: There are two groups butyl(contains four carbon) and propyl (contains 2 carbon).  There is a rule…

Q: IUPAC name of the following compound is: CHO HO A 4-Hydroxycyclopentanecarbaldehyde…

A: Given that : We have to identify the IUPAC name of the following compound : A.…

Q: Provide the correct IUPAC name for the compound shown here. f HO 3- 4- 5- 7- sec- tert- iso 6- 2- di…

A:

Q: . What is the IUPAC of the following compound но. a) 5-Hydroxy-3-ethyl-1-hexene b)…

A: The rules for writing IUPAC name of the molecule are: 1) Find the longest carbon chain in the…

Q: Provide the proper IUPAC or common name for the following compound. HO. OH…

A:

Q: CH3-CH-CH,-CH2-CH2-CH2 2. The correct IUPAC name for ОН ÓH is hexyl dialcohol 2,6-dihydroxyhexane a)…

A:

Q: 12.2 Give the IUPAC name for each of the following: a. OH b. CH, CH,-CH; -CH-CH;-OH c. OH d.

A: "Since you have asked multiple Questions with multiple subparts, therefore I am solving one for you.…

Q: 2. IUPAC name of the structure CH3CH2C o- is: a. isopropyl cyclooctanoate. b. cyclooctyl propanoate.…

A: In the naming of esters, the parent chain is taken as the chain containing carbon with double bond…

Q: What is the IUPAC name of the following compou CH3 CH3 H3C-C-CH2-CH-CHO ČH3 O…

A:

Q: Identify the IUPAC name of the given compound. H. H3C Jm 4-Propylbenzaldehyde 1-Propylbenzaldehyde…

A: The name of an organic compound is stated using the guidelines issued by IUPAC. The first step is to…

Q: Assign a systematic (IUPAC) name for the following compound: O 1-propylcyclohexene O…

A: Given,

Q: Give the IUPAC name for the following compound. Be sure to answer all parts. O cis 12…

A: Here we have to write the complete IUPAC name of the following given compound.  The writing IUPAC…

Q: H H C H .H H H C -C H H C H-C H I H O: == H

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: What is the IUPAC name of compound shown here? A) cyclopentanecarboxylic acid B) cyclopentane acid…

A: Given a structure of a compound and we are asked to write the IUPAC name of the compound.

Q: the structure in their IUPAC equivalent

A: IUPAC name of the given compound can be shown below

Q: What is the correct common IUPAC name for the following structure:  CH3-CH2-CO-CH3

A: The IUPAC name of the CH3-CH2-CO-CH3 is

Q: What is the IUPAC name of CH3CH(CI)CH,CH,CH(OH)CH3? A 5-Chloropentan-2-ol B 5-Chlorohexan-2-ol C…

A:

Q: Draw the structure corresponding to the following IUPAC names: a) cyclohexanethiol b) methylphenyl…

A:

Q: ?What is the IUPAC name for the following structure OH اخترأحد الخيارات a. 4-methyl-2-pentanol b.…

A: In this question, we will write the IUPAC name of the given compound. You can see details…