Q: 11. CH;-C = C-CH-CH, What is the correct IUPAC name for the compound above? a. 4-phenyl-2-pentyne…
A: The compound given has a benzene ring which contains double bonds and a triple bond is also present…
Q: HO (c) Alkene + Reagent HO (d) Alkene + Reagent
A:
Q: B. Give the common name for each ether. (a) H3C-0-CH2CH3 (b) H3C-0-CH3
A: The given compounds have an "ether" functional group.
Q: Give the IUPAC name for each ketone: CH3 (CH3)3C. b. c. (CH3)3CCOC(CH3)3 a. Name the following…
A:
Q: 1. Name each compound according to the IUPAC system. a) CH,CH,CHCH,CH,CH, CH, b) CH,CHCH,CH,CHCH,CH,…
A: Note: As per our guidelines, we are supposed to do only three subparts when question with multiple…
Q: What is the trivial name for the circled alkyl substituent? Select one: a. n-butyl b. 2-butyl O C.…
A: Circle alkyl substituation name is Sec-butyl.becuase it is a 2° alkyl group. It have 4 carbon in…
Q: What is the IUPAC name for the following molecule? OH 3-hydroxyhexen-4-one…
A:
Q: Give the IUPAC name for each aldehyde. CHO CHO a. (CHa),CC(CH3),CH,CHO b. С. С- CI
A: The IUPAC name of given aldehydes has to be provided. (a) The given aldehyde is…
Q: Give the IUPAC name for each aldehyde a. (CH:);CHCH;CH;CH;CHO b. (CH:);CC(CH:)CH;CHO CH;CH3 сно c.…
A: Since we only answer up to 3 sub-parts, we’ll answer the first 3 sub-parts. Please resubmit the…
Q: Draw the molecule that corresponds to each IUPAC name. (a) (Z)-hept-3-enedial; (b)…
A:
Q: Give a systematic (IUPAC) name for each diol. ) HO¬(CH2)8¬OH
A: First note the structure of given diol.
Q: What is the IUPAC name for the following compound? Br. ) (R)-6-bromo-2-heptanal O…
A: The IUPAC name of an organic compound includes the following features: The name of the longest…
Q: Give the IUPAC name for each compound. CH3 CH2CH3 Br a. PHCH(CH3)2 b. С. d.
A: Since you have posted multiple sub-parts, the answer for first three sub-parts are given below.…
Q: Give the structure corresponding to each IUPAC name. 2,4 dimethyl- 2 hexanol
A: The given compound is 2,4-dimethyl-2-hexanol.
Q: Convert each compound to hex-1-yne
A: We can make hex-1-yne from given compounds by elimination reactions. Let's see,
Q: What is the major organic product of the following reaction? CH3-CH-CH,CH3 CH;CH,ÖH room temperature…
A: Ethanol(CH3CH2OH) is considered as a weak nucleophile which follow SN1 mechanism
Q: Draw the products formed when each alcohol is dehydrated with H 2SO 4. Use the Zaitsev rule to…
A: Since you have posted a question with multiple sub parts, we will solve only first three sub parts…
Q: What is IUPAC name of this compound? Br OH O 4-Bromo-5-methyl-2-hepten-6-ol O…
A:
Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3
A: Given chemical formula, (a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3
Q: Give the IUPAC name for each aldehyde. а) CH3 b) H || CH-CHCH— С —н CH3CH2CH2-C-CH¿CH3 CHO CH3 c)…
A: IUPAC name of the organic compound is composed of the following three components:Root name = depends…
Q: 6. What is the correct IUPAC name of the following compound? A)…
A: We will be naming the above mentioned organic compound by using IUPAC nomenclature rule.
Q: 3. CH3CH2CH2 O CH3-CH-CH-C-H CH3 What is the correct IUPAC name for the compound above?…
A: The numbering is starting with the aldehyde group. only 6 carbon is involved in this structure.
Q: OH 12. - CH3 What is the IUPAC name for the above? Oa. 3-methylcyclohexanol Ob. 3-methylphenol O c.…
A: The given compound: The name of the given compound has to be determined. There are two…
Q: Which of the following compounds is methyl formate? a. H3C C-H b. H3C O- CH3 H3C- -HO- С. d. -CH3…
A: Answer
Q: 3. What is the correct IUPAC name of the following compound? A)…
A: The IUPAC name of the compound can be written on the basis of the number of carbon atoms in the main…
Q: What is the IUPAC name of the following compound? но ÓCH3 O 3-Methoxy-4-hydroxybenzaldehyde O…
A:
Q: What is the IUPAC name of the following compound? Br CH3 H3C A. 5-Bromo-2-methylphenyl ethanoate B.…
A:
Q: What is the correct IUPAC name of the structure below? Be sure to include all punctuation (- and ).…
A: To find the IUPAC name of:
Q: 12. CH3-C-CHCH, CH,CHCH, What is the correct IUPAC name for the compound above? Oa.…
A: To write the IUPAC name , we first search is the longest carbon chain ,here the longest chain has 5…
Q: 3) What is the IUPAC name of the following alcohol? A) trans-4-methylcyclohexanol B)…
A: In the question , a diagram of an organic compound is given and it is asked in the question to give…
Q: Write the IUPAC name and any common name for each of the following ethers: a. CH;-CH,-CH2-0-CH,-CH3…
A: These compounds are ethers. They are named by the IUPAC or common systems. The IUPAC name is…
Q: Write the IUPAC name and, where possible, a common name for each compound
A: The IUPAC name and common name for a given racemic mixture has to be given.
Q: HO. 8. pineapple H.isopropyl alcohol In heptyl alcohol J. Isoamyl alcohol Hsleanc acid R…
A:
Q: What is the correct IUPAC name of an Aldehyde below? CH, H;C 4-methyl pentanal 2-methyl pentanal…
A: The answer is as follows:
Q: What is the complete IUPAC name for the following compound: H IOH H3C OH Select one: а.…
A:
Q: 4. What is the IUPAC name of the following compound? CH3-CH-CEC-CH2-CH-CH3 CH3-CH2 CH2-CH3 (a)…
A: The given compound is an alkyne. The IUPAC name of alkynes end with a suffix "-yne".
Q: 10. What is the IUPAC name for the compound shown below? CH3 CH3-Ö-CH-CH-CH3 A. 2-methyl-4-pentanone…
A: We have an organic compound , we have to predict the IUPAC nomenclature of the compound.
Q: 12.2 Give the IUPAC name for each of the following: a. OH b. CH, CH,-CH; -CH-CH;-OH c. OH d.
A: "Since you have asked multiple Questions with multiple subparts, therefore I am solving one for you.…
Q: Give the IUPAC name for each aldehyde. CH, CH;CHCH-č-H CH,CH;CH;-C-CH;CH; сно b. c.…
A: a. 2,3-dimethylbutanal b. 2-ethylpentanal c. 3-methylbutanal d. 3,3,4,4-tetramethylpentanal
Q: 2. What is the IUPAC name of the compound below? CH,CH2CH(CH3)h CH3CH2CH,CHCHCH3 ÓH A.…
A: Since you have posted multiple questions, we are entitled to answer the first only. 22) The compound…
Q: What is the IUPAC name for the following structure? OH a) cyclohexenol b) 3-cyclohexen-1-ol c)…
A: According to IUPAC ,the prority of Alcohol is higher than the double bond,so alcohol will be here…
Q: Name each aldehyde or ketone. b. CH3-CH;-CH;-C-CH-CH; ČH3
A: Interpretation: Name of the given compound is to be determined.
Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OH
A: (a) Given chemical formula, CH3CH(OH)(CH2)4CH(OH)C(CH3)3 IUPAC name of the given diol is…
Q: 12. OH CH3 What is the IUPAC name for the above? O 3-methylcyclohexanol 3-methylphenol O…
A: Write IUPAC name of the given above structure-
Q: 1. Write the IUPAC name of the following а. CH3-CH-O-CH2-CH3 CH3 b. CНЗ-СH-CH2-SH CH3 c.…
A: 1. a. The above molecule is an ether. For the Iupac nomenclature the general name is alkoxy alkane.…
Q: 7. JOjea 8. 10 11.1 12 13 I 14 16 1 17 18 II. B- Assign IUPAC name to each of the following…
A: For naming of alcohol select the longest possible chain of carbon and for alcohol suffix 'ol' is…
Q: List the products of each alcohol reaction. CH3 H,SO4 a. CH,-C-OH CH, NazCr0, b. CH3-CH-CH,-CH;-OH…
A: Alcohols are the functional group which contains one or more hydroxyl group in it. Alcohols are…
Q: The IUPAC name is: HO a) l,4-trimethylcyclohexano) b) I,4,4 - trimethyl cyclohexanol C)…
A: Given structures are The IUPAC names of the compounds are -----?
Q: ?What is the IUPAC name for the following structure OH اخترأحد الخيارات a. 4-methyl-2-pentanol b.…
A: In this question, we will write the IUPAC name of the given compound. You can see details…
Step by step
Solved in 2 steps with 2 images