A weak acid is added to a strong base. The base is neutralized last, giving a mole ratio to acid remaining of 2:3. If Ka is 1.0 x 10-5, what is the ph of the solution?

Q: Carbonic acid, H,CO, is a diprotic acid with Ka1 = 4.3 × 107 and Ka2 = 5.6 × 1011. What is the pH of…

A: H2CO3 ⇌HCO3−  +   H+.........     ka1= 4.3x10-7 HCO3− ⇌CO3-2 ​+   H+..........    Ka2=5.6x10-11ka1…

Q: 4. Calculate the pH of a salt solution of NH,CI with molar concentration 0.1 M (Kh = 5.71 x 101")

A: Given, The molarity of NH4Cl = 0.1M            Kh = 5.71 × 10-11

Q: Calculate the pH of a solution of 6.5 x 109 mol of Ca(OH)2 in 10.0 L of water. Ksp(Ca(OH)₂) = 6.5 x…

A:

Q: The reaction of an acid and a base only produces a salt and water as products. This is an example of…

A: When an acid(say HA) reacts with a base (MOH). They produce salt and water.

Q: In a liter of 0.2F solution of propionic acid, HC3H$O2 it has ionization constant of 1.34 x 10-3,…

A: The formality solution is the number of formula mass of any solute dissolved in 1 litre of solution.…

Q: 10.T/ An industrial chemist prepares a 0.025 mol/L solution of hydrazoic acid, HN3(aq), a weak…

A:

Q: Calculate the pH of a 0.053 M NaF solution. (Ka for HF = 7.1 x 10−4.)

A: NaF is a salt of strong base (NaOH) and weak acid (HF)

Q: Calculate the pH of a solution of ammonium acctate. Given that: K, - 1.76 x 10, K,- 1.8 x 10 and K,…

A: A salt formed of weak acid and strong base is alkaline in nature and has a pH above 7 while a salt…

Q: The pH of a 0.05 M acid solution is 1.4. What is [H] in that solution? If the K, for the acid is 3.3…

A: We know that pH is the negative logarithm of H+ ion concentration. that is  pH = – log[H+] ⇒[H+] =…

Q: Calculate the pH of a solution that is prepared by dissolving 0.23 mol of hydrofluoric acid (HF) and…

A:

Q: Calculate the pH of a 0.10 M solution of sodium hypochlorite (NaCIO; Ka 2.90 x 10-8). Also,…

A:

Q: Calculate the pH of a solution containing 0.1M NH,OH and 0.01M NH.CI, K = 1.76 x 10$. %3D

A: Given, [NH4OH] = 0.1 M [NH4Cl] = 0.01 M Kb = 1.76 × 10-5

Q: 7. The pH of a 0.10 M solution of acetic acid (CH3COOH) is 2.39. What is the Ka of acetic acid?

A: H3O+ can be calculated as follows: pH=-log [H3O]+[H3O]+=10-pH[H3O]+=10-2.39[H3O]+=0.00407 M

Q: The pH of a lime is 1.90. What is the [H3O*]?

A: Power of hydrogenpH value indicates the acidic and basic nature of a solution. pH ranges between 0…

Q: Determine the pH and pOH of 0.25 L of a solution that is 0.0201 M boric acid and 0.0366 M sodium…

A:

Q: Hydrogen cyanide, HCN(aq), is a weak acid with pKa = 9.2. What is the pH of 2.5 M HCN(aq)?

A: The weak acids' strength is reflected by their dissociation constant (Ka) value. If they possess a…

Q: 9 Write the formula of the conjugate acid of a HSO, b CO;?

A: According to Bronsted Lowry Theory , any molecule that donate H+ atom is an acid and any molecule…

Q: What is the pH of a 0.103 M aqueous solution of potassium hypochlorite, KCIO? This solution is pH =

A:

Q: Propionic acid, CH3CH2COOH, has a Ka = 1.34 x 105. If 10.00 mL of 0.080 M propionic acid is mixed…

A:

Q: Calculate the pH of a 0.010-M solution of iodic acid (HIO3, Ka = 0.17).

A: Molarity of Solution = 0.010M Ka of Acid = 0.17 We have to find the pH of the solution of iodic…

Q: 2. You have a solution of 0.1M Na₂CO3. You measure the pH using a pH meter. What is your prediction…

A:

Q: the pH of an acid solution is 3.59. If the concentration of the acid in the solution is 0.200 mol/L,…

A: Given Concentration of the acid=0.2 mol/LpH of the acid solution=3.59Ka of thel acid=??

Q: calculate the ph of a 0.600 solution of Na2S

A: When Na2S dissolved in water - Na2S + 2H2O <===> 2NaOH + H2S Thus, sodium Sulfide is a salt of…

Q: Determine the K of a weak base if a 0.33 M solution of the base has a pH of 12.18 at 25°C. x 10

A: Given that: concentration of weak base = 0.33 M pH = 12.18 To find: Kb?

Q: Calculate the pH of a 0.450 M solution of NH4Cl (Kb for NH3 is 1.8 x 10-5)

A: Interpretation -  To determine the pH of 0.45M of NH4Cl solution when Kb of NH3 = 1.8 ×10-5 .…

Q: A weak base is dissolved in water with a concentration of 0.200 mol/L. The Kb value of the base is…

A: Given :- initial concentration of base = 0.200 mol/L                Kb of base = 9.75 × 10-4  To…

Q: What is the pH of a 0.20 M solution of CH3NH3NO3 at 25 °C? At this temperature, the Kp for CH3NH2 is…

A: Both given Ka and Kb are given, means this salt is a weak acid-weak base type salt. -PH or [H+] of…

Q: Write a net ionic equation for the equilibrium that causes the solution of KHTar in water to be…

A: KHTar is used for potassium acid tartarate. A solution is said to be acidic when there is the…

Q: 1. When H2SO<(aq) was reacted with NaOH(aq) in the titration, why was a precipitate not formed? 2.…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: Hydrogen cyanide, HCN(aq), is a weak acid with pKa = 9.2. What is the pH of 2.5M HCN(aq)?

A:

Q: Calculate the pH of a 0.20 M solution of sodium acetate (NaCH3COO) given that the Ka of acetic acid…

A:

Q: The pH for a solution with a [H3O]+ of 1.0 x 10^-6 is

A:

Q: For  K w, the product of [H 3O +] and [OH -] is

A: Kw is the water constant and is defined as product of hydronium ion and hydroxyl ion  Kw = [H3O+]…

Q: ) What is the pH of a solution of 0.626 M of a weak base if K, = 3.2x10-³? (Assuming X is very…

A:

Q: What is the pH of a solution prepared by dissolving 0.450 mol of NH3 in sufficient water to make…

A: Given,  The pH of a solution prepared by dissolving 0.450 mol of NH3 in sufficient water to make…

Q: What is the pH for a weak monoprotic acid if a 0.020 M solution of the acid has a Ka of 3.28 x 10-7…

A: The H3O+ concentration for the weak acid is determined given below:

Q: The acid dissociation reaction for the weak acid butyric acid, HC4H¬O2 is given below. Its Ka is…

A: The dissociation reaction given is Assuming y concentration of HC4H7O2 dissociates as per the…

Q: Nitrous acid is a weak acid and has a concentration of 0.65 mol/L. What is the pH of the solution…

A:

Q: Calculate the pH and percent ionization of a 2.5 x 102 45 x 10:4)

A:

Q: The following reaction is in equilibrium: NO2 (aq) + H20 (1) = HN02 (aq) + OH" (aq). Kh (NO,) = 2.2…

A: According to Le Chatelier's principle, when a system at equilibrium is disturbed, then the system…

Q: Phenoxide ion (C,HsO) is a weak base, with Kp = 7.70 x 10. Calculate the pH of a 0.50 M aqueous…

A: Given that  Kb = 7.70 × 10-5  Peroxide ion is a weak base

Q: The K, for hypoiodite anion (IO) is 4.35x10-4. What is the pH of a 0.226 mol L solution of lithium…

A:

Q: A buffer solution is 0.402 M in NaH2PO4 and 0.318 M in Na2HPO4. If Ka for H2PO4- is 6.2 x 10 -8,…

A: The solution has NaH2PO4 which will dissociate completely into ions Na+ and H2PO4-  Hence…

Q: What substance(s) have a pH most similar to that of water (pH 7)?

A: Salt of strong acid and strong base have a pH similar to that of water i.e. pH = 7.

Q: How many moles of hydroxide ions can be released into solution from 1.00 mg of Mg(OH)2 that is used…

A: Molar mass of Mg(OH)2 = 58.32 g/mol Given mass = 1 mg = 0.001g Moles = 0.001/58.32 = 1.71*10-5

Q: Given the following chemical reaction between a weak acid, HA, and water: НА(аg) Calculate the Ka of…

A: [HA] = 0.546 M  pH = 4.56  We need to determine value of Ka.

Q: explain the cycle of acidic precipitation?

A: Acidic precipitation means, the acid in gaseous form released in air, reacts with the moisture in…

Q: 6 A solution of NaOH has a pH of 10.50. How many grams of CaO should be dissolved in sufficient…

A: To solve this problem we have to first calculate the concentration of OH- by using the pH of NaOH…

Q: What is the pH of a 9.5 x 10-4 M HCIO, solution?

A: