4. The following questions pertain to a 2.2 M solution of hydrocyanic acid, HCN at 25 °C. pKa = 9.21 at 25°C a. Is HCN a strong or weak acid? b. Write the net ionic equation C. Create an ice table d. Write the equilibrium expression e. Solve for Ka f. Calculate the PH of the solution
Q: A 4.17 gram sample of an unknown gas is found to occupy a volume of 1.72 L at a pressure of 897 mm…
A: The objective of the question is to find the molecular weight of an unknown gas given its mass,…
Q: A sample of CO2 gas has a volume of 939 mL, has a pressure of 877 mm Hg, and is at a temperature of…
A: The objective of the question is to calculate the amount of CO2 in moles in the gas sample using the…
Q: Calculate the density of krypton gas (in g/L) at 944 mm Hg and 46.0 °C.g/L
A: The objective of this question is to calculate the density of krypton gas under given conditions of…
Q: What volume ( in Liters) will 2.0 g of hydrogen gas occupy at STP conditions?
A: The objective of this question is to find out the volume occupied by 2.0 g of hydrogen gas at…
Q: Draw structures for the alkene (or alkenes) that gives the following reaction product. ? H₂/Pd CH3…
A: Given product: CH3CH(CH3)CH2CH(CH3)CH3This product suggests the addition of two moles of hydrogen…
Q: Determine ∆S° for 2 O₃(g) → 3 O₂(g). Substance Sf° (J/mol・K) O₃ (g) 239 O₂ (g) 205
A:
Q: None
A: Step 1:For any reaction, value of Gibbs free energy change is equal to the difference between Gibbs…
Q: Help me categorize this
A: 1. Used for measuring/dispensing accurate volume:10 mL Graduated cylinder: This cylinder has…
Q: 3 PHASE DIAGRAMS. Sketch the temperature-composition (“T-x") phase diagram for acetone, (CH3)2 CO),…
A: To sketch the temperature-composition (T-x) phase diagram for the acetone-chloroform mixture, we…
Q: 3 a) State Zaitsev's rule and show the structures elimination product(s) of the following compounds…
A: The objective of the question is to explain Zaitsev's rule and apply it to predict the elimination…
Q: None
A:
Q: What is the mechanism and reagents for this reaction? with the circled molecule being attacked first…
A: Step 1: Step 2: Step 3: Step 4:
Q: Please answer in typing format
A: Let's see all the molecular weight.Here molecular ion peak is 101. So answer is amine.
Q: Draw the missing organic structures in the following multistep synthesis. Show the final product at…
A: Step 1: Sodium ethoxide deprotonates the acidic proton of the compound, resulting in the formation…
Q: Draw the major product for this reaction. Ignore inorganic byproducts. 1. disiamylborane, THF 2.…
A:
Q: answer is d please explain
A: 1.The reaction described is an example of an endothermic reaction. This is indicated by the fact…
Q: Gases can be mixed with any proportions unless they chemically react with one another). We can say…
A: Gases, unlike liquids and solids, have the unique property of being able to mix with one another in…
Q: 2. i) Circle each stereogenic unit in the Structure provided and write its label directly below the…
A: Step 1: Step 2: Step 3: Step 4:
Q: 6
A:
Q: Draw structural formulas for organic products A and B in the window below. -CI Li pentane H₂O A B •…
A: Step 1:Alkyl chloride reacts with Lithium to form alkyl lithium . A is cyclopentyl lithium. Step…
Q: If 2.5 g of a gas dissolves in 1.2 L of water at 0.8 atm of pressure, how much will dissolve at 1.0…
A: The objective of this question is to find out how much gas will dissolve in water at a different…
Q: Ilustrate the mechanism of the following reactions.
A: Step 1: Step 2: Step 3: Step 4:
Q: Equilibrium of Co2+and Cl-with CoCl42-a) Give a balanced reaction equation for the reaction between…
A: The objective of the question is to understand the chemical reaction and properties of the cobalt…
Q: A 0.175 mol sample of N2 gas is contained in a 4.00 L flask at room temperature and pressure. What…
A: The objective of this question is to calculate the density of nitrogen gas under given conditions.…
Q: A sample of oxygen gas occupies a volume of 9.84 L at 46.0°C and 1.29 atm. If it is desired to…
A: The objective of the question is to find the temperature of the oxygen gas sample at the new volume…
Q: A student conducts a laboratory investigation of anaerobic respiration. The student places 10.0 g of…
A: The objective of this question is to determine whether all the glucose reacted during the…
Q: Part F The third variable (call it v) is v=x1-cx2 + x3, where c is a constant you need to determine…
A: Step 1:To determine the constant c such that v=x1-cx2+x3 represents the SHM(simple harmonic motion)…
Q: An electron in the n = 6 level emits a photon with a wavelength of 410.2 nm. To what energy level…
A:
Q: If you combine 410.0 mL of water at 25.0°C and 130.0 mL of water at 95.0°C, what is the final…
A:
Q: Explain why a solution of ammonium nitrate is a weak acid. Give a balanced rection equation…
A: The objective of the question is to explain why a solution of ammonium nitrate behaves as a weak…
Q: 3. Which of the molecules below could do a crossed condensation reaction with ethyl acetate…
A: The condensation reaction involving carbonyl and some acyl compounds involves deprotonation of the…
Q: dont provide handwriting solution...
A: The objective of this question is to determine the amount of the reagent in excess that remains…
Q: Determine K for a reaction at 200 K if ∆G° =20.4 kJ/mol. (R = 8.314 J/mol ・ K)
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: 2) (4) Successful recrystallizations involve several steps, each which must be carried out…
A: a. Incorrect ProcedureExplanation: Dissolving the solute in liberal amounts of hot solvent goes…
Q: Show work, thank you!
A: To solve this query, we need to first write the balanced chemical equation for the cell reaction…
Q: 2. Draw the missing structure(s) in each of the following reactions. The missing structure(s) can be…
A: Step 1:electrophilic addition reaction is the characteristic reaction of alkenes addition of…
Q: Chemistry
A: Step 1:
Q: At 1120 K, ∆G° = 42.3 kJ/mol for the reaction 3 A (g) + B (g) →2 C (g). If the partial pressures of…
A: Step 1: The reaction: 3A(g)+B(g)→2C(g) The standard free energy change (ΔGo) and the free energy…
Q: 2) Predict the product of the following reaction and provide a step-by-step mechanism for this…
A: MECHANISM : EXPLANATION : K2CO3 works as a non-nucleophilic base. In the first step potassium…
Q: 5. The element Chromium has a KB X-ray wavelength of 0.209nm. The K-shell binding energy is 5989eV.…
A: Step 1: Step 2: Step 3: Step 4:
Q: O II III O IV OV What is the structure of (1S,2R)-1-ethyl-2-methyl-1,2-epoxycyclohexane? .... www IV…
A: The objective of the question is to determine the structure of the compound…
Q: None
A: Generally P exhibits valence 3, sulfur and oxygen exhibit valence 2. Among the given structures…
Q: A voltaic cell consists of Cu^2+/Cu and Cd ^2+/Cd half-cells. Each compartment has a volume of 0.500…
A: To find the concentration of [Cu^2+] when the cell voltage is 0.728 V, we can use the Nernst…
Q: Hydrogen chloride is an important compound, and when mixed with water, it generates hydrochloric…
A: The objective of the question is to understand the effect of the addition of more HCl gas on the…
Q: Indicate whether (a) and (b) are radial nodes or nodal planes: a 2s (a) is a (b) is a > < b 2PX
A: The objective of the question is to determine whether the given atomic orbitals (2s and 2px) have…
Q: Equilibrium of methyl orangea) Give a balanced reaction equation for the reaction of methyl orange…
A: The objective of the question is to understand the reaction of methyl orange with HCl and NaOH and…
Q: The standard electrode potential (E) for the half-reaction Ni2+(aq) + 2e → Ni(s) is -0.257 V. What…
A: Step 1:In a galvanic cell, oxidation always takes place at anode and reduction always takes place at…
Q: None
A: Step 1:Nucleophilic attack by amine to carbonyl carbon. Step 2:C-O bond breaks Step 3:Proton…
Q: None
A: Step 1:
Q: Q1. The ring opening of the compound below under photochemical conditions will afford which of the…
A:
Solve.
Unlock instant AI solutions
Tap the button
to generate a solution
Click the button to generate
a solution
- Strong Acids, Weak Acids, and pH Two 0.10-mol samples of the hypothetical monoprotic acids HA(aq) and HB(aq) are used to prepare 1.0-L stock solutions of each acid. a Write the chemical reactions for these acids in water. What are the concentrations of the two acid solutions? b One of these acids is a strong acid, and one is weak. What could you measure that would tell you which acid was strong and which was weak? c Say that the HA(aq) solution has a pH of 3.7. Is this the stronger of the two acids? How did you arrive at your answer? d What is the concentration of A(aq) in the HA solution described in part c? e If HB(aq) is a strong acid, what is the hydronium-ion concentration? f In the solution of HB(aq), which of the following would you expect to be in the greatest concentration: H3O+(aq), B(aq), HB(aq), or OH(aq)? How did you decide? g In the solution of HA(aq), which of the following would you expect to be in the greatest concentration: H3O+(aq), A+(aq), HA(aq), or OH(aq)? How did you decide? h Say you add 1.0 L of pure water to a solution of HB. Would this water addition make the solution more acidic, make it less acidic, or not change the acidity of the original solution? Be sure to fully justify your answer. i You prepare a 1.0-L solution of HA. You then take a 200-mL sample of this solution and place it into a separate container. Would this 200 mL sample be more acidic, be less acidic, or have the same acidity as the original 1.0-L solution of HA(aq)? Be sure to support your answer.. The concepts of acid-base equilibria were developed in this chapter for aqueous solutions (in aqueous solutions, water is the solvent and is intimately involved in the equilibria). However, the Brønsted-Lowry acid-base theory can be extended easily to other solvents. One such solvent that has been investigated in depth is liquid ammonia. NH3. a. Write a chemical equation indicating how HCl behaves as an acid in liquid ammonia. b. Write a chemical equation indicating how OH- behaves as a base in liquid ammonia.What is a salt? List some anions that behave as weak bases in water. List some anions that have no basic properties in water. List some cations that behave as weak acids in water. List some cations that have no acidic properties in water. Using these lists, give some formulas for salts that have only weak base properties in water. What strategy would you use to solve for the pH of these basic salt solutions? Identify some salts that have only weak acid properties in water. What strategy would you use to solve for the pH of these acidic salt solutions? Identify some salts that have no acidic or basic properties in water (produce neutral solutions). When a salt contains both a weak acid ion and a weak base ion, how do you predict whether the solution pH is acidic, basic, or neutral?
- Use the same symbols as in Question 61 ( = anion, =OH) for the box below. (a) Fill in a similar box (representing one liter of the same solution) after 2 mol of H+ (2) have been added. Indicate whether the resulting solution is an acid, base, or buffer. (b) Follow the directions of part (a) for the resulting solution after 2 mol of OH- (2 ) have been added. (c) Follow the directions of part (a) for the resulting solution after 5 mol of OH- (5 ) have been added. (Hint: Write the equation for the reaction before you draw the results.)Write the reaction and the corresponding Kb equilibrium expression for each of the following substances acting as bases in water. a. aniline, C6H5NH2 b. dimethylamine, (CH3)2NHEach box represents an acid solution at equilibrium. Squares represent H+ ions. Circles represent anions. (Although the anions have different identities in each figure, they are all represented as circles.) Water molecules are not shown. Assume that all solutions have the same volume. (a) Which figure represents the strongest acid? (b) Which figure represents the acid with the smallest Ka? (c) Which figure represents the acid with the lowest pH?
- An aqueous solution contains formic acid and formate ion. Determine the direction in which the pH will change if each of the following chemicals is added to the solution. (a) HCl (b) NaHSO4 (c) CH3COONa (d) KBr (e) H2O. What is meant by the iou-product constant for water, KW? What does this constant signify? Write an equation for the chemical reaction from which the constant is derived.Hydrazine, N2H4, is weak base with Kb = 1.3 106. Fill in the iCe table and write the equation needed to solve for the concentration of hydroxide ion in a 0.10 M solution.
- . Strong buses are bases that completely ionize in water to produce hydroxide ion, OH-. The strong bases include the hydroxides of the Group I elements. For example, if 1.0 mole of NaOH is dissolved per liter, the concentration of OH ion is 1.0 M. Calculate the [OH-], pOH, and pH for each of the following strong base solutions. a. 1.10 M NaOH b. 2.0104M KOH c. 6.2103M CsOH d. 0.0001 M NaOHEach of the following statements concerns a 0.10 M solution of a weak organic base, B. Briefly describe why each statement is either true or false. a [B] is approximately equal to 0.10 M. b [B] is much greater than [HB+]. c [H3O+] is greater than [HB+]. d The pH is 13. e [HB+] is approximately equal to [OH]. f [OH] equals 0.10 M.Table 13-4 lists the stepwise Ka values for some polyprotic acids. What is the difference between a monoprotic acid, a diprotic acid, and a triprotic acid? Most polyprotic acids are weak acids; the major exception is H2SO4. To solve for the pH of a solution of H2SO4, you must generally solve a strong acid problem as well as a weak acid problem. Explain. Write out the reactions that refer to Ka1 and Ka2 for H2SO4. For H3PO4, Ka1 = 7.5 103, Ka2 = 6.2 108, and Ka3= 4.8 1013. Write out the reactions that refer to the Ka1, Ka2and Ka3equilibrium constants. What are the three acids in a solution of H3PO4? Which acid is strongest? What are the three conjugate bases in a solution of H3PO4? Which conjugate base is strongest? Summarize the strategy for calculating the pH of a polyprotic acid in water.