3. Calculate the energy change per mole for the following reaction? H + H > Не The mass of H is 2.01355 amu and the mass of He is 4.00150 amu. a. 2.30 x 10° kJ/mol b. 9.00 x 10° kJ/mol 1.79 × 1011 kJ/mol d. 3.52 x 1012 kJ/mol с. e. 2.84 x 1013 kJ/mol

3. Calculate the energy change per mole for the following reaction? H + H > Не The mass of H is 2.01355 amu and the mass of He is 4.00150 amu. a. 2.30 x 10° kJ/mol b. 9.00 x 10° kJ/mol 1.79 × 1011 kJ/mol d. 3.52 x 1012 kJ/mol с. e. 2.84 x 1013 kJ/mol

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter7: Chemical Energy

Section: Chapter Questions

Problem 108AE

See similar textbooks

Related questions

Q: Following the triple-alpha process to form 12C, a variety of nuclear reactions can form heavier…

A: The given reaction is 16O + 16O →32S + ɤ

Q: Al (s) WFe:0s (s) Fe(s) + %Al:0s(s) AH - 212.25k) (b) The mass of the Al need to produce 1 k of…

A: Answer;- This question is answered by using the simple concept of stoichiometry which involves the…

Q: For the following reaction, what is the energy released, in GJ/mol? (1 GJ = 1E9 J) Use 2.998E8 m/s…

Q: 1.) The energy change in a chemical reaction comes from a change in mass. Calculate the mass change…

A: Step 1 Given: The ∆H°rxn is -802.35 kJ/mol. Introduction: Einstein equation gives us the…

Q: Calculate the amount of mass in nanograms that is changed into energy when one mole of liquid water…

A: The chemical reaction, H2 + 1/2 O2 ------> H2O

Q: What amount of energy is needed to transform 7.55 grams of H2O at 57°C to 114°C?

A: The energy needed to raise the temperature is given by the equation, Q=m×c×∆TQ→energy neededm→mass…

Q: The atomic mass of 13F isotope is 18.9984 amu. The amount of the energy released to the surroundings…

A: Isotope = 199F Atomic mass = 18.9984 amu Amount of energy released to the surrounding = ?

Q: ol tinu 9nit619gmot ort bne esluor ot alu > 4CO28) 2. Calculate AG° for the combustion of ethane +…

Q: How many liters of gasoline, CH(l), when combusted at 25°C are needed to evolve the same quantity of…

A: Given: (Density of octane is 0.702 g/mL, and ΔH° of octane is -249.95 kJ/mol).

Q: What is the change in energy associated with increasing the temperature of 81.7g water from 20°C to…

A: We will use formula of heat energy

Q: .How does nuclear fusion generate energy? A.When a heavy nucleus splits, the total mass of the…

A: Nuclear chemistry

Q: Matter has been described as condensed energy. Using Einstein’s equation, calculate the amount of…

Q: The binding energy of the first level in an atom is 2.2 × 10 -18 J, and the binding energy of the…

A: The binding energy of the first level in an atom is = = 2.2 × 10 -18 J The binding energy of the…

Q: Calculate the energy change, in kJ/mole, for the reaction below. (Masses of nuclei: 253Es (253.08294…

A: The reaction taking place is given as, => 253Es + 4He ------> 257Md Given: Mass of 253Es =…

Q: hen an iron core reaches a mass so large that even degenerate electrons can no longer support it and…

A: degeneracy pressure halts the collapse

Q: 16. The chemical reaction for photosynthesis is 6 CO2 + 12 H20 + light energy C6H1206 + 6 02 + 6 H20…

Q: How much energy in MeV is released to form one atom of 102PB from protons, electrons, and neutrons…

A: Given: Formation of 102Pb from protons, neutrons and electrons.

Q: Beta O It is stable and does not undergo decay. QUESTION 15 Find the temperature (in K) below which…

A: [15.] ΔH = - 201.5 kJ/mol = - 201.5 × 103 J/mol ΔS = - 70.2 J/k.mol T = ?

Q: How much energy is needed for the reaction of 1.22 moles of H3BO3 with 5.67 moles of hydrogen

A: 2H3BO3 + 6H2 -----> B2H6 + 6H2O ∆H reaction = 493 kJ 1.22 moles of H3BO3 with 5.67 moles of…

Q: The total volume of hydrogen gas needed to the Hindenburg was 2.00 * 10 ^ 8 * d * m ^ 3 atm and 25…

Q: Kelerences a. Be-7 decays by gamma emission. What are the atomic symbol and mass number of the…

A: The correct answer about radioactive decay is given below

Q: What is AS, in kJ/mol, if AG = 16 kJ/mol, AH = 131 kJ/mol and T=-17 C? %3D O A. 0.45 OB. -8.2 O C.…

A: Note : The units of ΔS will be KJ/mol.K and not KJ/mol. Its a typo error in the question

Q: Suppose that the total mass of the reactants in a chemical reaction was 100.00000 g. Your answer is…

Q: An analytical laboratory balance typically measures mass to the nearest 0.1 mg. What energy change…

A: Given : Loss of mass = 0.1 mg Since 1 Kg = 1000 g And 1 g = 1000 mg => 1 Kg = 106 mg Hence mass…

Q: 21. 2 jHeliumj atoms undergo fusion.

A: Nuclear reaction: The given reaction is a nuclear reaction. In the nuclear reaction, one nuclide is…

Q: energy

Q: The overall hydrogen burning reaction in stars can berepresented as the conversion of four protons…

A: The change in the mass during the nuclear reaction is; total mH=4×mH=4×1.007825 μtotal mH=4.0313…

Q: How much energy in kJ is released to form one mole of 82 Kr from protons, electrons, and neutrons if…

A: Given that, 82Kr has the mass, m = 81.913482 amu, The mass of the proton is mp = 1.00728 amu, The…

Q: Which example is an enodthermic process? O producing sugar by photosynthesis O formation of snow in…

Q: a. F-18 decays by positron emission. What are the atomic symbol and mass number of the product?…

Q: In the Styrofoam ball investigation, when the plastic rod is rubbed on the cat's fur, it is…

A: When plastic rod is rubbed against cats fur, the fur acquire positive charges and due to this the…

Q: What can be said about nuclear fusion reactions of the following systems I) (5)B I) ()C ()N As the…

A: Nuclear fusion reactions: It is a reaction in which two or more atomic nuclei are combined to form…

Q: 1. If you turn on the burner on a gas stove under a pan of cold water, energy moves from the burner…

A: This mode of transfer of energy is called conduction because there is direct supply of heat between…

Q: Calculate the energy change per mole for the following reaction? The mass of ¡H is 2.01355 amu and…

Q: Dinosaur fossils are often dated by using an element other than carbon, like potassium-40, that has…

Q: Which conservation law is violated in the strong nuclear reaction p + n → p + \overline{p}p + n

A: In nuclear reaction, atomic mass and atomic number are balanced. In nuclear reaction mass is not…

Q: The reaction of A to produce B by the reaction 2A + C → B is exothermic with a ΔH = -345 kJ. If…

A: First we would calculate moles of A and energy released for thise moles of A. Then we use energy…

Q: Calculate the energy change per mole for the following reaction? The mass of ?H is 2.01355 amu and…

Q: How many stable isobars do you expect with atomic mass number 57? Number If the nucleus 57 Fe 26…

Q: Use the table to the right to answer the following question. Item How many kilograms of isotope…

A: Introduction: Nuclear energy is produce from the nuclear reactions. The reaction can nuclear fission…

Q: .67492716 × 10-24 g c) 1.092263 x 10–12 J/nucleon eon cleon d) 8 7381 x 10-12 J/nucleon

A: Mass of Be-8 = 1.32931×10-23 g Mass of protons (mp) =1.67262158×10-24 g Mass of Neutron(mp) =…

Q: Calculate the mass equivalent of the energy released by the complete combustion of 4 mol of methane…

Q: The reaction p+188O→189F+n requires an input of energy equal to 2.438 MeV . What is the mass of…

A: In a nuclear fission reaction, the bombardment of a heavier nucleus by the lighter particles such as…

Q: After a star uses up its hydrogen by fusing it all into helium, one of the next processes to become…

Q: AMoving to another question will save this response. Question 10 How much energy will be released by…

Q: 5) Iodide I-123 (as sodium Iodide I-123) is a radioactive isotope of iodine used in nuclear medicine…

A: Hello. Since your question has multiple sub-parts, we will solve first three sub-parts for you. If…

Q: Cu-67 decays by beta decay. What are the atomic symbol and mass number of the product? a. Product:…

A: a. Given that, Cu-67 decays by beta decays. We have to give the atomic symbol and the mass number of…

Question

3. Calculate the energy change per mole for the following reaction?
ƏH; < H + H
The mass of H is 2.01355 amu and the mass of He is 4.00150 amu.
a. 2.30 x 10° kJ/mol
b. 9.00 x 10° kJ/mol
1.79 x 1011 kJ/mol
d. 3.52 x 1012 kJ/mol
e. 2.84 x 1013 kJ/mol
с.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1: Given,∆m formula and calculation

VIEW

Step 2: ∆E formula and calculation

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

9.52 Write the formation reaction for each of the following substances. (a) CH4(g) , (b) C3H(l) , (c) HCI(g), (d) C6H12O6(s) , (e) NaF(s)
Consider the Haber process: N2(g)+3H2(g)2NH3(g);H=91.8kJ The density of ammonia at 25C and 1.00 atm is 0.696 g/L. The density of nitrogen, N2, is 1.145 g/L, and the molar heat capacity is 29.12 J/(mol C). (a) How much heat is evolved in the production of 1.00 L of ammonia at 25C and 1.00 atm? (b) What percentage of this heat is required to heat the nitrogen required for this reaction (0.500 L) from 25C to 400C, the temperature at which the Haber process is run?
9.56 Using heats of formation tabulated in Appendix E, calculate the heats of reaction for the following. (a) C2H2(g)+52O2(g)2CO2(g)+H2O(l) (b) PCl3(g)+Cl2(g)PCl5(g) (c) C2H4(g)+H2O(g)C2H5OH(g) (d) Fe2O3(s)+2Al(s)Al2O3(s)+2Fe(l)
When one mol of KOH is neutralized by sulfuric acid, q=56 kJ. (This is called the heat of neutralization.) At 23.7C, 25.0 mL of 0.475 M H2SO4 is neutralized by 0.613 M KOH in a coffee-cup calorimeter. Assume that the specific heat of all solutions is 4.18J/gC, that the density of all solutions is 1.00 g/mL, and that volumes are additive. (a) How many mL of KOH is required to neutralize H2SO4? (b) What is the final temperature of the solution?
A reaction used to produce the silicon for semiconductors from sand (SiO2), can be broken up into three steps: SiO2(s)+2C(s)Si(s)+2CO(g)H=689.9kJ Si(s)+2Cl2(s)SiCl4(g)H=657.0kJ SiCl4(g)+2Mg(s)2MgCl2(g)+Si(s)H=625.6kJ (a) Write a thermochemical equation for the overall reaction where silicon is obtained from silicon dioxide and CO and MgCl2 are by-products. (b) What is H for the formation of one mole of silicon? (c) Is the overall reaction exothermic?
We burn 3.47 g lithium in excess oxygen at constant atmospheric pressure to form Li2O. Then, we bring the reaction mixture back to 25 C. In this process 146 kJ of heat is given off. Calculate the standard formation enthalpy of Li2O.
The heat of neutralization, Hneut, can be defined as the amount of heat released (or absorbed), q, per mole of acid (or base) neutralized. Hneut for nitric acid is -52 kJ/mol HNO3. At 27.3C, 50.00 mL of 0.743M HNO3 is neutralized by 1.00 M Sr(OH)2 in a coffee-cup calorimeter. (a) How many mL of Sr(OH)2 were used in the neutralization? (b) What is the final temperature of the resulting solution? (Use the assumptions in Question 11.)
How much heat is produced by burning 4.00 moles of acetylene under standard state conditions?
Would the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the experimenter used a calorimeter that was a poorer insulator than a coffee cup calorimeter? Explain your answer.
How much heat is produced when 1.25 g of chromium meta’ reacts with oxygen gas under standard conditions?
The enthalpy changes of the following reactions can be measured: C2H4(g) + 3 O2(g) 2 CO2(g) + 2 H2O() rH = 1411.1 kJ/mol-rxn Q2H5OH() + 3 O2(g) 2 CO2(g) + 3 H2O() rH = 1367.5 kJ/mol-rxn (a) Use these values and Hesss law to determine the enthalpy change for the reaction C2H4(g) + H2O() C2H5OH() (b) Draw an energy level diagram that shows the relationship between the energy quantities involved in this problem.
How much heat is produced when loo mL of 0.250 M HCl (density, 1.00 g/mL) and 200 mL of 0.150 M NaOH (density, 1.00 g/mL) are mixed? HCl(aq)+NaO(aq)NaCl(aq)+H2O(l)H298=58kJ If both solutions are at the same temperature and the heat capacity of the products is 4.19 J/g C, how much will the temperature increase? What assumption did you make in your calculation?