11. eauxture. Important: remember to riase and wipe off the mixtures so as not to contaminate them. This would make Draw the structures of methyl stearate and propylene glycol. Which one is polar, and how can you tell? Which is nonpolar and how can you tell?

11. eauxture. Important: remember to riase and wipe off the mixtures so as not to contaminate them. This would make Draw the structures of methyl stearate and propylene glycol. Which one is polar, and how can you tell? Which is nonpolar and how can you tell?

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter20: Organic Chemistry

Section: Chapter Questions

Problem 9QAP

See similar textbooks

Related questions

Q: In making buffer 4, dissolve 5.04g disodium hydrogen phosphate (base) and 3.01g of potassium…

A: A buffer of disodium hydrogen phosphate (base) 3.01g of potassium dihydrogen phosphate (acid)V =…

Q: Which is (are) the product(s) of the following reaction? KMnO4/H+ (A) A OH OH (B) HO новзан OH OH…

A: The question is based on organic reactions.We need to identify the product and explain its…

Q: 5. Cyclohexane can isomerize into methylcyclopentane, with an equilibrium constant of 0.12 at 25 °C.…

A: The objective of the question is to calculate the amount of cyclohexane that remains once…

Q: How many atoms would there be in a pound-mole of hygrogen or any other element?

A: A pound-mole of hygrogen or any other element contains 2.733×1026 atoms. It is calculated as…

Q: Question 29 For the compound below please identify the position of equilibrium (which chair…

A: The basic principle is; the bulky group should always come at equatorial position.The higher the…

Q: What is the relationship between the following molecules? O Constitutional Isomers O Cis/trans…

A: Information about the question

Q: please help this is my 4th time posting this and i havent gotten a correct answer. Please actually…

A: Please find the attached image.Details of axesX-axis: 1/S (reciprocal of the substrate…

Q: Consider the following reaction. X=Y If Kc = 0.420 at 40. °C and K = 0.630 at 90. °C, what is AH for…

Q: please don't use hend raiting)

A: Crown ethers are cyclic poly ether compounds which are mainly used for the trapping of different…

Q: SOAPS MADE FROM COCONUT OIL ARE MORE SOLUBLE IN WATER. EXPLAIN WHY THIS IS TRUE COMPARED TO OTHER…

A: We need to determine reasons for higher solubility of soaps made from coconut oil compared to other…

Q: Predict the products of the following acid-base reactions, and predict whether the equilibrium lies…

A: Acids are proton donors and bases are proton acceptors. In an acid-base reaction, essentially a…

Q: What is the pH of a 0.0820 M solution of methylamine (CH₃NH₂, Kb = 4.4 × 10⁻⁴)?

A: The objective of this question is to calculate the pH of a 0.0820 M solution of methylamine.…

Q: Q2. 22 (a) Write down the Hamiltonian of a molecule having M nuclei and N electrons with a dear…

A: The Hamiltonian of a molecule having M nuclei and N electrons is given by the following equation: H…

Q: This sketch of a neutral molecule is shaded red or blue wherever the electrostatic potential at the…

A: Answer:The blue colour molecule has slightly positive charge and its size is smaller than red…

Q: Identify which of the following molecules can exhibit hydrogen bonding as a pure liquid. Check all…

A: To determine if a molecule can form hydrogen bond it must contain N-H , F-H and O-H bond. The…

Q: E) In anoxic conditions (e.g. Ен= -0.3 V and pH=8) trace metals form very insoluble sulfides. Would…

A: The objective of the question is to determine if it would be feasible to treat water to anoxic…

Q: 1. Starting with the structures below, complete the condensed structures of two soap molecules: О a)…

A: 1.a saturated soap molecule with a total of 12 carbons. CH3(CH2)10COO- b. CH3(CH2)5CH=CH(CH2)5COO-…

Q: Why do most metals make good electric conductors? A Metals have low specific heat. B Metals attract…

A: The correct option is (C) : The electrons in metals flow easily between atoms.Explanation:Option A…

Q: Question 4 Determine the position of equilibrium for the ACID-BASE reaction below: H ? A: cannot…

A: Whether equilibrium lies on the right side or left side depends upon the acidity of the reactant and…

Q: Predict the organic product of the reaction shown below (Part 1) and select the likely mechanism…

A: Organic product

Q: × Your answer is incorrect. The following reaction mechanism contains mistakes. Which of the…

A: This reaction is conversion carboxylic acid salt to its parent carboxylic acid.It involves following…

Q: 3 2 CH3-CH2-CH2-OH Proton Chemical Shift (5) in ppm Carbon Chemical Shift (5) in ppm H1 C1 C2 H2 C3…

A: The objective of this question is to identify the proton chemical shifts based on the given molecule…

Q: Incomplete combustion of hydrocarbons produces the toxic gas Carbon monoxide can be eliminated by…

A: CO + H2O ⇌ CO2 + H2ΔH° = −41.0 kJ/mol and ΔS° = −42.3 J cal/(mol·K) at 25°C and 1 atm.

Q: Give the IUPAC name for the following acid amide: CH3CH2CH(CH3)CH2CH(CH3)CH₂C NH2

A: Structure of acid amide:find out IUPAC name

Q: 6. HO 3S Synthesize the following compounds starting from benzene: H3C CH3 NH2 Br SO₂H H3C CH3 CI…

A: a)b)c)d)

Q: OH 1. NaH 2. I

Q: Draw the major product of this reaction. Ignore inorganic byproducts. PhCH2Br THF, reflux a

A: Enamines are nitrogen-containing compounds derived from the condensation reaction of secondary…

Q: (a) A 25.0 mL sample of 0.175 M methylamine CH3NH2 (Kb = 1.3 x 10-5) is titrated with 0.150 M HBr.…

A: The objective of this question is to calculate the pH at various points during the titration of a…

Q: How to calculate the ph? What would be the result if the acid was a di or tripotic? How do the…

A: All of your concerns are discussed; please go through each step.Explanation:Step 1: Let's learn…

Q: Which of the following stretches tends to be the most intense? A) O-H (alcohol) B) N-H C) =C-H…

A: The intensity of a bond stretching in an IR spectrum is influenced by the change in dipole moment…

Q: Draw the product of this reaction. Ignore inorganic byproducts. Br2 (2 equiv) Drawing Q

A: In the reaction given above, reaction between alkyne and bromine (Br2) is given. In this reaction,…

Q: Flame emission spectroscopy sometimes suffers from the difficulties of self-absorption and…

A: The objective of the question is to propose effective methods to overcome the challenges of…

Q: In the boxes provided below, draw a mechanism to show the formation of the cyanohydrin. Include all…

A: Final answer is given in explanation please see from there.Explanation:Approach to solving the…

Q: Gaseous butane (CH3(CH2)2CH3) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide…

A: The objective of this question is to calculate the theoretical yield of carbon dioxide (CO2) from…

Q: Draw condensed or line-angle formulas corresponding to each of the following names: 13. BOX#13:…

A: In the Bond line formula, a bond is represented by a single line.Only heteroatoms and hydrogen…

Q: Identify how many C (CARBON) atoms have sp³ hybridization for the compound below: :0: N: A B 5…

Q: Adjust the structures below to show the resulting intermediates.

A: The resultant intermediate during the reaction of ketone with water is gem diols as two OH group…

Q: Please do 27, draw and explain the reagents options if possible

A: Correct answer is (a)Explanation:Step 1: Step 2:Step 3: Step 4:

Q: Give correct detailed Solution with explanation needed of each options...don't give Handwritten…

A: a) Butan-2-oneb) 3,5-dichlorobenzaldehydec) 3,4-dimethylpentanal Explanation:Step 1:Assign…

Q: An equilibrium is established for the reaction 2 CO(g) + MoO2(s) = 2 CO2(g) + Mo(s). Use the…

A: Answer: The value of Kp = 1.89 x 10-2Explanation:Step 1:Step 2:

Q: What is the thermodynamic product of this reaction? Br Br Br. Br Br Br HBr

Q: Predict the major product for the following reaction including stereochemistry. OH

A: The given is type of pericyclic reaction.The Diels-Alder reaction is a type of cycloaddition…

Q: Question 3 Identify the most plausible mechanism for the ACID-BASE reaction below: A: B: C: D: Ο Α…

A: In any acid-base reaction equilibrium forms the reaction which moves the proton towards the…

Q: Select the correct final major product. HO CN NC OH 2 1) NaCN, pH > 10 2) H3O+/H₂O/A ? HO COOH НООС…

A: Carbonyl compounds reacts with NaCN to form cyanohydrin. Cyanide on complete hydrolysis give…

Q: Buffer 2 will be 150 mL of 0.15 M Tris-HCl buffer with a pH of 8.5 Write out the chemical equation…

A: The objective of the question is to write out the chemical equation for a Tris-HCl buffer and…

Q: Nitesh

A: The objective of the question is to calculate the change in Gibbs free energy (ΔG) for a reaction at…

Q: H₁₂C HO CH, H.C H.C CH₁₂ CH₂ CH, N о P S L F க

A: Given is one of the step of organic reaction mechanism.The given reaction is acetalisation…

Q: Question 32 For the compound below determine which of the circled protons (H atoms) is more acidic…

A: Acidity is defined as the ability of a molecule to release protons.If a compound easily donates…

Q: Draw the correct aromatic organic product for the following reaction. (If no reaction, draw the…

A: Isopropyl benzene contains one benzylic hydrogen. So it will undergo oxidation reaction when treated…

Q: Click on the most deshielded proton(s) in the following structure.

A: If the electron density around the nucleus of a hydrogen atom decreases due to the…

Question

Don't use hand raiting please

Imp
11.
Draw the structures of methyl stearate and propylene glycol. Which one is polar, and how
can you tell? Which is nonpolar and how can you tell?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Write the objective-

VIEW

Step 2: Analysing the given compounds

VIEW

Solution

VIEW

Step by step

Solved in 3 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

3. Consider the following table. List three substances as having the strongest intermolecular forces. Explain your reason. Formula CH4 HOH C₂H6 CH₂OH C3H8 CH₂CH₂OH C4H10 CH3CH₂CH₂OH Name methane water ethane methanol propane ethanol butane 1-propanol Molar Mass Boiling Point (°C) -164 100 -89 65 -42 78 16 18 30 32 44 46 58 60 97
Why does styrene have a higher boiling point, 145 °C, than isopropanol, 83 °C? Explain your answer by indicating the types and relative strengths of intermolecular forces present in each compound (see the line structures given below). HO styrene dipole moment = 0.13 D isopropanol dipole moment = 1.66 D
The molecular formula of N-methylacrylamide is C4H7ON. How many valence electrons are needed to draw the Lewis structure of this molecule? Also, Draw the Lewis structure of N-methylacrylamide based on the skeleton above. Which is/are the intermolecular force(s) present between molecules of N-methylacrylamide?
Look up the formulas and correct Lewis structures for Pentane and Tetrachloromethane. Then explain the relative positions of the boiling points. 1000, Boiling Point 76.5/ 100 36.1/ Pentane Tetrachloro-/iWater/ methane 800 760 600 Atmospheric Pressure 400 200 20 40 60 80 100 Temperature (°C) Vapor pressure (mm Hg)
4 What type of organic molecule is this? ОН ketone alcohol aldehyde organic acid
5. Build another hexane molecule and place it alongside the first one you built. (f) What types of intermolecular forces help hold hexane molecules to each other? (g) What aspect of the molecules' geometry makes these bonds effective?
11. Which statement is true of the carbon-carbon bonds in benzene? (a) They are identical to the carbon-carbon bonds in cyclohexane. (b) They are identical to the carbon-carbon bonds in cyclohexene. (c) They are half-way between a double and single bond. (d) They are easily broken in chemical reactions. (e) They are all double bonds. ct Copyright O 2002 McGraw-Hill Ryerson Limited Name: Class:
A. Identify the name of the functional group where the given organic compounds belong (alcohol, ether, aldehyde, ketone, carboxylic acid, ester, amine) 1. H H Br H H -C C-H H H H 2. H H Н—с H -5- H H N- H- 3. H H -нн I-
How does the structure of an alcohol differ from an ether? Describe how an aldehyde differs in structure from a ketone. Thiols are compounds which resemble alcohols, except that the oxygen atom is replaced by a sulfur atom. Draw the analogous thiol for the four carbon alcohol in Table 1. Describe the structural difference between carboxylic acids and esters. Are ethers polar molecules? Would you expect ethers to have higher or lower boiling points than alkanes (circle one)? Explain. Pentane (an alkane) has a boiling point of 36 °C. Does the data agree with your prediction? explain why this could be the case
How many electron pairs are shared when a triple bond exists between two carbon atoms? What must he the geometric arrangement around the carbon atoms in a triple bond? Draw the Lewis structure of a simple molecule that contains a triple bond.
On a microscopic level, how does the reaction of bromine with a saturated hydrocarbon differ from its reaction with an unsaturated hydrocarbon? How are they similar?
What is the difference between the hybridization of carbon atoms' valence orbitals in saturated and unsaturated hydrocarbons?