The industrial degreasing solvent methylene chloride, CH2Cl2, is prepared from methane by reaction with chlorine:
Use the following data to calculate ΔH° in kilojoules for the reaction:
Want to see the full answer?
Check out a sample textbook solutionChapter 8 Solutions
General Chemistry: Atoms First
- The formation of aluminum oxide from its elements is highly exothermic. If 2.70 g Al metal is burned in pure O2 to give A12O3, calculate how much thermal energy is evolved in the process (at constant pressure).arrow_forward9.42 Why is enthalpy generally more useful than internal energy in the thermodynamics of real world systems?arrow_forwardAt 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?arrow_forward
- Coal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.arrow_forwardHow is the sign of q, heat, defined? How does it relate to the total energy of the system?arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning