When Zn metal was dipped in a solution of acid, it released hydrogen gas. This reaction can be classified as 1. Gas forming reaction II. Single displacement reaction III. Oxidation-reduction reaction IV. Acid-Base reaction V. Combination reaction 1) I, IV and V 2) 1, II and III 3) II, III and IV 4) 1, III and V

When Zn metal was dipped in a solution of acid, it released hydrogen gas. This reaction can be classified as 1. Gas forming reaction II. Single displacement reaction III. Oxidation-reduction reaction IV. Acid-Base reaction V. Combination reaction 1) I, IV and V 2) 1, II and III 3) II, III and IV 4) 1, III and V

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter3: Chemical Reactions

Section3.5: Oxidatino-reduction And Electron Transfer

Problem 3.14CE

See similar textbooks

Similar questions

Classify the reactions represented by the following unbalanced equations by as many methods as possible. Balance the equations. msp;I4O9(s)I2O6(s)+I2(s)+O2(g) msp;Mg(s)+AgNO3(aq)Mg(NO3)2(aq)+Ag(s) msp;SiCl4(l)+Mg(s)MgCl2(s)+Si(s) msp;CuCl2(aq)+AgNO3(aq)Cu(NO3)2(aq)+AgCl(s) msp;Al(s)+Br2(l)AlBr3(s)
hat is meant by the driving force for a reaction? Give some examples of driving forces that make reactants tend to form products. Write a balanced chemical equation illustrating each type of driving force you have named.
In the reaction CaCl2+Na2CO3CaCO3+2NaCl, if 0.5mole of NaCl is to be formed, then: a. 1mole of Na2CO3 is needed. b. 0.5mole of CaCO3 is also formed. c. 0.5mole of Na2CO3 is needed. d. 0.25mole of CaCl2 is needed.
If an element is a reactant or product in a chemical reaction, the reaction must be an oxidation—reduction reaction. Why is this true?