What is the best reason why carboxylic acid 3 is the most acidic? адон | CI- || OH клон Яон OH ||| IV A) It is the least sterically hindered. B) The F groups are good leaving groups. C) F is very electronegative and can stabilize a negative charge as FO. D) F is very electronegative and will help to stabilize a negative charge on oxygen via induction. E) The conjugate base is stabilized by resonance.

What is the best reason why carboxylic acid 3 is the most acidic? адон | CI- || OH клон Яон OH ||| IV A) It is the least sterically hindered. B) The F groups are good leaving groups. C) F is very electronegative and can stabilize a negative charge as FO. D) F is very electronegative and will help to stabilize a negative charge on oxygen via induction. E) The conjugate base is stabilized by resonance.

Organic Chemistry: A Guided Inquiry

2nd Edition

ISBN:9780618974122

Author:Andrei Straumanis

Publisher:Andrei Straumanis

Chapter4: Polar Bonds, Polar Reactions

Section: Chapter Questions

Problem 13E: For each molecule below, draw the conjugate acid or conjugate base or both if the molecule hasboth a...

See similar textbooks

Similar questions

For each molecule below, draw the conjugate acid or conjugate base or both if the molecule hasboth a conjugate acid and a conjugate base (e.g., water).
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
In each equilibrium, label the stronger acid, the stronger base, the weaker acid, and the weaker base. Also estimate the position of each equilibrium. (a) CH3CH2O + CH3CCH CH3CH2OH + CH3CC (b) CH3CH2O + HCl CH3CH2OH + Cl (c) CH3COOH + CH3CH2O CH3COO + CH3CH2OH
left 4. Consider the following equilibrium: 29925610 + Aga weak and Sung base Bast CORS + 1ght base: Strong ad d AddOH ress stable OH Is the carboxylate anion (CH3CH₂COO) an appropriate base to deprotonate the alcohol? A) yes, because the equilibrium favors the left side B) yes, because the equilibrium favors the right side C) no, because the equilibrium favors the left side D) no, because the equilibrium favors the right side OH COO bas
EtONaas 2. In each pair, circle the stronger base. Strong booses a) EtOH EtONa EtONaCam cecct asoEid -Na, NHe(Anine>), b NANH2 c) tBuOK NaH the following
compared to HCO3-, H2co3 has a A Stronger conjugated base B Weaker conjugated base C Higher ka D Lower ka E Both b and c
Which is the strongest acid? OA. В. FO | CH;CHCH,ČOH CH;CH,CHCOH CH3CH,CHČOH CHCHC-COH F F
A ΝΗ most basic B > V с NH₂ V NH₂ H3CO E least basic NH₂
a) Arrange the following according to increasing basicity. 4p NH3, NHC22, NH(CH3)2 Least basic most basic b) Arrange the following according to increasing acidity. 4p H3CCH2CH=CH, H3CCH2C=CH H3C-C=C-CH3 Least acidic most acidic c) Arrange the following according to increasing basicity. 4p CH;O', CH;NH", CH;CH2', Least basic most basic d) Arrange the following according to their boiling points. 4p Octane, 2,2,3,3-tetramethylbutane, nonane Least BP highest BP
Which of these molecules would be the least acidic, and which would be the most acidic? CH3CH₂CH3 CH3CH₂NH₂ CH3CH₂OH A B C OC least A most OD-least, A- most OA-least, D- most OD= least, C = most B = least D = most B least, C most OC-least, B = most A = least, C = most CH3CH₂SH D
1. c) Indicate the most acidic hydrogen in each of the following molecules. 요 CH3COCH 3 X° (CH₂CH₂)₂NLi O || CH3CNHCH3 CH,CH,ONa 4 d) Arrange the following bases in order of increasing basicity, starting from the weakest base on the left to the strongest base on the right. O (CH3)3CCCH3 (CH3), COK CHỊCH Li (CH₂CH₂),N
Rank the benzoic acid derivatives 1-6 from weakest to strongest acid