The Haber process is used to industrially produce ammonia (NH3). Ammonia is the active ingredient in a variety of household cleaners. The data table below summarizes the experimental quantities of reactants and products collected from a specific batch. N2 (g) + 3 H2 (g) --> 2 NH3 (g) Substance Amount Used N2 10,000 g H2 15,000 g Amount Produced 11,150 g Substance NH3 If the company chemist calculated that 12,163 g of NH3 should be produced, what is the percent yield?

The Haber process is used to industrially produce ammonia (NH3). Ammonia is the active ingredient in a variety of household cleaners. The data table below summarizes the experimental quantities of reactants and products collected from a specific batch. N2 (g) + 3 H2 (g) --> 2 NH3 (g) Substance Amount Used N2 10,000 g H2 15,000 g Amount Produced 11,150 g Substance NH3 If the company chemist calculated that 12,163 g of NH3 should be produced, what is the percent yield?

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 113AE: Gold is produced electrochemically from an aqueous solution of Au(CN)2 containing an excess of CN....

See similar textbooks

Similar questions

Gold is produced electrochemically from an aqueous solution of Au(CN)2 containing an excess of CN. Gold metal and oxygen gas are produced at the electrodes. What amount (moles) of O2 will be produced during the production of 1.00 mole of gold?
What characterizes an electrolytic cell? What is an ampere? When the current applied to an electrolytic cell is multiplied by the time in seconds, what quantity is determined? How is this quantity converted to moles of electrons required? How are moles of electrons required converted to moles of metal plated out? What does plating mean? How do you predict the cathode and the anode half-reactions in an electrolytic cell? Why is the electrolysis of molten salts much easier to predict in terms of what occurs at the anode and cathode than the electrolysis of aqueous dissolved salts? What is overvoltage?
Cobalt metal can be prepared by reducing cobalt (II) oxide with carbon monoxide. CoO(s)+CO(g)Co(s)+CO2(g)Kc=4.90102 at 550 C
The hydrocarbon naphthalene was frequently used in mothballs until recently, when it was discovered that human inhalation of naphthalene vapors can lead to hemolytic anemia. Naphthalene is 93.71% carbon by mass, and a 0.256-mole sample of naphthalene has a mass of 32.8 g. What is the molecular formula of naphthalene? This compound works as a pesticide in mothballs by. sublimation of the .solid so that it fumigates enclosed spaces with its vapors according to the equation Naphthalene(s)naphthalene(g)K=4.29106(at298K) If 3.00 g solid naphthalene is placed into an enclosed space with a volume of 5.00 L at 25C, what percentage of the naphthalene will have sublimed once equilibrium bas been established?
The nitrogen content of organic compounds can be determined by the Dumas method. The compound in question is first reacted by passage over hot CuO(s): CompoundCuO(s)HotN2(g)+CO2(g)+H2O(g) The product gas is then passed through a concentrated solution of KOH to remove the CO2. After passage through the KOH solution, the gas contains N2 and is saturated with water vapor. In a given experiment a 0.253-g sample of a compound produced 31.8 mL N2 saturated with water vapor at 25C and 726 torr. What is the mass percent of nitrogen in the compound? (The vapor pressure of water at 25C is 23.8 torr.)
In the text, the equation G=G+RTIn(Q) was derived for gaseous reactions where the quantities in Q were expressed in units of pressure. We also can use units of mol/L for the quantities in Q, specifical.ly for aqueous reactions. With this in mind, consider the reaction HF(aq)H+(aq)+F-(aq) for which Ka = 7.2 104 at 25C. Calculate G for the reaction under the following conditions at 25C. a. [HF] = [H+] = [F] = 1.0 M b. [HF] = 0.98 M, [H+] = [F] = 2.7 102M c. [HF] = [H+] = [F] = 1.0 105 M d. [HF] = [F] = 0.27 M, [H+] = 7.2 104M e. [HF] = 0.52 M, [F] = 0.67 M, [H+] = 1.0 103M Based on the calculated G values, in what direction will the reaction shift to reach equilibrium for each of the five sets of conditions?
9.52 Write the formation reaction for each of the following substances. (a) CH4(g) , (b) C3H(l) , (c) HCI(g), (d) C6H12O6(s) , (e) NaF(s)
What possible uses exist for the natural gas liquids that are removed from natural gas during its processing?