Suppose the reduction of nitric oxide proceeds by the following mechanism: step elementary reaction rate constant 1 H,(g) + 2 NO(g) N,0(g) + H2O(g) 2 H,(9) + N,0(9) N,(9) + H,O(9) k2 → Suppose also k,«k,. That is, the first step is much slower than the second. Write the balanced chemical equation for the overall chemical reaction: Write the experimentally- observable rate law for the overall chemical reaction. rate = k U Note: your answer should not contain the concentrations of any intermediates. Express the rate constant k for the overall chemical reaction in terms of k1, k2, and (if necessary) the rate constants k-1 and k.2 for k = the reverse of the two elementary reactions in the mechanism.

Suppose the reduction of nitric oxide proceeds by the following mechanism: step elementary reaction rate constant 1 H,(g) + 2 NO(g) N,0(g) + H2O(g) 2 H,(9) + N,0(9) N,(9) + H,O(9) k2 → Suppose also k,«k,. That is, the first step is much slower than the second. Write the balanced chemical equation for the overall chemical reaction: Write the experimentally- observable rate law for the overall chemical reaction. rate = k U Note: your answer should not contain the concentrations of any intermediates. Express the rate constant k for the overall chemical reaction in terms of k1, k2, and (if necessary) the rate constants k-1 and k.2 for k = the reverse of the two elementary reactions in the mechanism.

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section: Chapter Questions

Problem 105QRT

See similar textbooks

Similar questions

Monochloroethane (C2H5Cl) can be produced by the direct reaction of ethane gas (C2H6) with chlorine gas or by the reaction of ethylene gas (C2H4) with hydrogen chloride gas. The second reaction gives almost a 100% yield of pure C2H5Cl at a rapid rate without catalysis. The first method requires light as an energy source or the reaction would not occur. Yet G for the first reaction is considerably more negative than G for the second reaction. Explain how this can be so.
Cobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.
For the decomposition of Ag2O: 2Ag2O(s)4Ag(s)+O2(g)(a) Obtain an expression for G as a function of temperature. Prepare a table of G values at 100 K intervals between 100 K and 500 K. b) Calculate the temperature at which G =0.
Amoxicillin is an antibiotic packaged as a powder. When it is used to treat babies and small animals, the pharmacist or veterinarian must suspend it in water, so that it can be administered orally with a medicine dropper. The label says to dispose of unused suspension after 14 days. It also points out that refrigeration is required. In the context of this chapter, what is implied in the latter two statements?
Consider the reaction 2SO2(g)+O2(g)2SO3(g) (a) Calculate G at 25C. (b) If the partial pressures of SO2 and SO3 are kept at 0.400 atm, what partial pressure should O2 have so that the reaction just becomes nonspontaneous (i.e., G=+1.0 k J)?
Adenosine triphosphate, ATP, is used as a free-energy source by biological cells. (See the essay on page 624.) ATP hydrolyzes in the presence of enzymes to give ADP: ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq);G=30.5kJ/molat25C Consider a hypothetical biochemical reaction of molecule A to give molecule B: A(aq)B(aq);G=+15.0kJ/molat25C Calculate the ratio [B]/[A] at 25C at equilibrium. Now consider this reaction coupled to the reaction for the hydrolysis of ATP: A(aq)+ATP(aq)+H2O(l)B(aq)+ADP(aq)+H2PO4(aq) If a cell maintains a high ratio of ATP to ADP and H2PO4 by continuously making ATP, the conversion of A to B can be made highly spontaneous. A characteristic value of this ratio is [ATP][ADP][H2PO4]=500 Calculate the ratio [B][A] in this case and compare it with the uncoupled reaction. Compared with the uncoupled reaction, how much larger is this ratio when coupled to the hydrolysis of ATP?
A process that is reactant-favored at equilibrium can never be spontaneous. This statement is (a) true (b) false
If wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)
For the reaction 2 A(aq) <---> B(aq) + C(aq), the standard free enthalpy variation is 1.43 kJ at 25oC. The initial concentration of A is 0.541 M, the initial concentration of B is 0.343 M, and the initial concentration of C is 0.267 M. At equilibrium (we are still at 25oC), what will be the concentration of A( aq) (in mol/L)?
Chemical Equilibrium. a) Briefly describe why (or how) it is possible to have an absolute value for the entropy of a system. b) Write appropriate inequalities for Gibbs free energy, Entropy and the Reaction Quotient that determine the direction of spontaneous change for forward, reverse or equilibrium processes. c) Briefly describe what you expect to occur as a function of time at a “single molecule" level for the chemical reaction AB=A +B9) at equilibrium. d) For the case of c how would you determine that the system is not at equilibrium?
Ammonia and oxygen react to form nitrogen and water, like this: 4NH, (g)+30,(g) 2N, (g)+6H,0(g) Suppose a mixture of NH2, 0,, N, and H,0 has come to equilibrium in a closed reaction vessel. Predict what change, if any, the perturbations in the table 3' below will cause in the composition of the mixture in the vessel. Also decide whether the equilibrium shifts to the right or left. perturbation change in composition shift in equilibrium to the right The pressure of NH3 will v ? to the left Some H,0 is added. go up. The pressure of O2 will O (none) go down. not change. to the right The pressure of O2 will ? Some NH, is removed. to the left The pressure of N2 will ? O (none) O O O
At 25 ∘C25 ∘C, the equilibrium partial pressures for the reaction A(g)+2B(g)↽−−⇀C(g)+D(g) were found to be ?A=4.34PA=4.34 atm, ?B=4.47PB=4.47 atm, ?C=6.00PC=6.00 atm, and ?D=5.45PD=5.45 atm. What is the standard change in Gibbs free energy of this reaction at 25 ∘C25 ∘C?