Liquid octane (CH,(CH,) CH,) will react with gaseous oxygen (0,) to produce gaseous carbon dioxide (Co,) and gaseous water (H,O). Suppose 1.14 g of octane is mixed with 1.8 g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 2 significant digits. OP

Liquid octane (CH,(CH,) CH,) will react with gaseous oxygen (0,) to produce gaseous carbon dioxide (Co,) and gaseous water (H,O). Suppose 1.14 g of octane is mixed with 1.8 g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to 2 significant digits. OP

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 20A

See similar textbooks

Similar questions

Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
A 0.755-g sample of hydrated copper(II) sulfate CuSo4xH2O was heated carefully until it had changed completely to anhydrous copper(II) sulfate (CuSO4 ) with a mass of 0.4183 g. Determine the value of x. [This number is called the number of waters of hydration of copper(II) sulfate. It specifies the number of water molecules per formula unit ofCuSO4 in the hydrated crystal.]
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
A dark brown binary compound contains oxygen and ametal. It is 13.38% oxygen by mass. Heating it moderatelydrives off some of the oxygen and gives a red binary compoundthat is 9.334% oxygen by mass. Strong heatingdrives off more oxygen and gives still another binary compound,which is only 7.168% oxygen by mass. (a) Compute the mass of oxygen that is combined with1.000 g of the metal in each of these three oxides. (b) Assume that the empirical formula of the first compoundis MO2 (where M representsthe metal). Givethe empirical formulas of the second and thirdcompounds. (c) Name the metal.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Can the subscripts in a chemical formula be fractions? Explain.