A voltaic cell is constructed in which the following cell reaction occurs. Thehalf-cell compartments are connected by a salt bridge.Pb²+ (aq) + Mg(s)Pb(s) + Mg2+ (aq)The anode reaction is:+The cathode reaction is:+1-0In the external circuit, electrons migratethe Pb|Pb²+ electrode.In the salt bridge, anions migrate [the Pb/Pb2+ compartment.++the Mg|Mg2+ electrodethe Mg|Mg2+ compartment

At anode oxidation takes place while at cathode reduction takes place.

A voltaic cell is constructed in which the following cell reaction occurs. The compartments are connected by a salt bridge. half-cell Pb²+ (aq) + Mg(s) →→→ Pb(s) + Mg²+ (aq) The anode reaction is: The cathode reaction is: →[ -0 In the external circuit, electrons migrate the Pb|Pb2+ electrode. In the salt bridge, anions migrate the Pb|Pb2+ compartment. + + the Mg Mg2+ electrode the Mg Mg2+ compartment

A voltaic cell is constructed in which the following cell reaction occurs. The compartments are connected by a salt bridge. half-cell Pb²+ (aq) + Mg(s) →→→ Pb(s) + Mg²+ (aq) The anode reaction is: The cathode reaction is: →[ -0 In the external circuit, electrons migrate the Pb|Pb2+ electrode. In the salt bridge, anions migrate the Pb|Pb2+ compartment. + + the Mg Mg2+ electrode the Mg Mg2+ compartment

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 135CWP: Consider a galvanic cell based on the following half-reactions: a. What is the expected cell...

See similar textbooks

Similar questions

The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
The half-cells Fe2+(aq) | Fe(s) and O2(g) | H2O (in and solution) are linked to create a voltaic cell. (a) Write equations for the oxidation and reduction half-reactions and for the overall (cell) reaction. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the _______ electrode to the _____ electrode. Negative ions move in the salt bridge from the _____ half-cell to the ______ half-cell.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
A voltaic cell is constructed using the reaction Mg(s) + 2H+(aq) Mg2+(aq) + H2(g) (a) Write equations for the oxidation and reduction half-reactions. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the ________ electrode to the ______ electrode. Negative ions move in the salt bridge from the ______ half-cell to the ______ half-cell. The half-reaction at the anode is ____, and that at the cathode is _____.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The following oxidationreduction reactions are used in electrochemical cells. Write them using cell notation. (a) 2Ag+(aq)(0.50M)+Ni(s)2Ag(s)+Ni2+(aq)(0.20M) (b) Cu(s)+PtCl62-(aq)(0.10M)Cu2+(aq)(0.20M)+PtCl42-(aq)(0.10M)+2Cl(aq)(0.40M) (c) Pb(s)+SO42-(aq)(0.30M)+2AgCl(s)PbSO4(s)+2Ag(s)+2Cl(aq)(0.20M) (d) In a galvanic cell, one half-cell contains 0.010 M HCI and a platinum electrode, over which H2 is bubbled at a pressure of 1.0 atm. The other half-cell is composed of a zinc electrode in a 0.125 M solution of Zn(NO3)2.
The half cells Sn2+(aq) |Sn(s) and Cl2(g) |Cl(aq) are linked to create a voltaic cell. (a) Write equations for the oxidation and reduction half-reactions and for the overall (cell) reaction. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the ______ electrode to the ____ electrode. Negative ions move in the salt bridge from the _____ half-cell to the _____ half-cell.