3.49b2 SH + Your answer is incorrect. OH Predict which side of the reaction is favored under equilibrium conditions, and explain your choice. ○ The reactants are favored, because the negative charge on the large sulfur atom is more stable (making it the stronger base). ○ The reactants are favored, because the negative charge on the electronegative oxygen atom is more stable (making it the stronger base). The products are favored, because the negative charge on the large sulfur atom is more stable (making it the weaker base). ○ The products are favored, because the negative charge on the electronegative oxygen atom is more stable (making it the weaker base).

3.49b2 SH + Your answer is incorrect. OH Predict which side of the reaction is favored under equilibrium conditions, and explain your choice. ○ The reactants are favored, because the negative charge on the large sulfur atom is more stable (making it the stronger base). ○ The reactants are favored, because the negative charge on the electronegative oxygen atom is more stable (making it the stronger base). The products are favored, because the negative charge on the large sulfur atom is more stable (making it the weaker base). ○ The products are favored, because the negative charge on the electronegative oxygen atom is more stable (making it the weaker base).

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter4: Acids And Bases

Section: Chapter Questions

Problem 4.33P: Complete the equation for the reaction between each Lewis acid-base pair. In each equation, label...

See similar textbooks

Similar questions

Complete the equation for the reaction between each Lewis acid-base pair. In each equation, label which starting material is the Lewis acid and which is the Lewis base; use curved arrows to show the flow of electrons in each reaction. In doing this problem, it is essential that you show valence electrons for all atoms participating in each reaction. (a) (b) (c) (d)
For each molecule below, draw the conjugate acid or conjugate base or both if the molecule hasboth a conjugate acid and a conjugate base (e.g., water).
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Which of the attached anions is the stronger base? Explain your choice.
Consider cyclohexane and benzene (draw the structures below). Draw the conjugate base of each molecule and then explain why cyclohexane is the weaker acid.
OH- + CH3COOH ==== CH3COO- + H2O . Which of the products is a conjugate base?
Which is a stronger base?
Which is the stronger acid and which is the stronger base?
Choose the stronger (less stable, more basic, more reactive) base in the following pair of molecules. Consider the basicity of only the indicated atom. A B ОА B
Would you expect the reaction to work if you used sodium bicarbonate as a base instead of sodium hydroxide? Explain why or why not.
H2SO4 + NH3 ==== HSO4- + NH4+ . Which of the products is a conjugate base?
Which is a stronger base, S2 - or Se2 -? Explain.