Q: Indicate for each pair whether they represent constitutional (structural) isomers or resonance…
A:
Q: A mixture of gaseous reactants is put into a cylinder, where a chemical reaction turns them into…
A: To answer: Is the reaction exothermic or endothermic? Does the temperature of the water bath go up…
Q: According to the following reaction, how many grams of sulfur trioxide will be formed upon the…
A:
Q: 7 7 4 НО 6 CH3CH2 OH COOH доволни 8 CH3CCH₂C=CCH₂CH3 CH3 Н 5 Н нн нн Н Н Н н
A: A group of atoms responsible for the characteristic reactions of a particular compound is called…
Q: A reaction is shifting right toward equilibrium, this means that O Q K O Q=K O Q < 1
A: The given question is based on the concepts of chemical equilibrium.
Q: Question 6 The name of the following alkyl group is: CH3-CH- CH3 Propyl Propyl. You selected this…
A:
Q: Liquid hexane (CH, (CH₂) CH,) will react with gaseous oxygen (0₂) to produce gaseous carbon dioxide…
A:
Q: Draw the following compound using perspective view:…
A: Name of given compound is,…
Q: The Reaction A → P is second order reaction has a rate constant of 0.0363 sec^-1. If I start with an…
A:
Q: The data below are for water (H₂O) Boiling Point Melting point 0.0°C SH Capacity (liquid) SH…
A: Cooling curves are basically the plot of temperature versus time. It represents the change in phase…
Q: How did it became a amino and show solutions
A: Amines also called "amino" functional groups are organic compounds having either a primary amine…
Q: What will happen to the pH or pure water if 5.0 grams NaNO3 is added? (Hint: Split the compound…
A:
Q: Which of the following simple model gas assumptions is/are not true? A. The molecules are…
A: There are three States of matter: solid liquid and gas. Simple model gas is a theoretical model that…
Q: ми 2
A: Given molecular formula is C4H8O
Q: The salt K2HPO4 (potassium hydrogen phosphate) is a strong electrolyte but not a strong acid or…
A: Solution of potassium hydrogen phosphate.
Q: Balance the following equations: (e) Sc2O3(s)+SO3(l)⟶Sc2(SO4)3(s)Sc2O3(s)+SO3(l)⟶Sc2(SO4)3(s)…
A:
Q: Calculate the number of neutrons of neutrons 209 Bi. X
A: Atoms are made up of three main particle -positively charged proton,negatively charged electron and…
Q: Identify the type of organic compound (alkane, alkene, alkyne, alicyclic, aromatic, alcohol, ether,…
A: Organic compounds are a class of chemical compounds in which one or more atoms of carbon are…
Q: What is the chemical formula for the structure that is formed after citric acid donates its protons?…
A: Citric acid is tricarboxylic acid that means it has three carboxyl functional groups. Acid has…
Q: 1) A sulfuric acid solution containing 54.4g of H₂SO4 per liter of solution has a P = 1.329 g/cm³.…
A:
Q: 3. A compound has the following MS & IR spectra. Propose a structure. Mass Spectrum Relative…
A: Mass spectra provides the information about molecular mass, molecular formula and the possible…
Q: The Keq for the reaction: A + B ↔ AB is 2.163 What is the Keq for 2 + AB ↔ 2 A + 2 B
A: Some of the important characteristics of the equilibrium constant are If the equation (having…
Q: The "normal" lead content in human blood is about 0.40 part per million (that is, 0.40 g of lead per…
A:
Q: rounded yold Calloway 5th The data below are for water (1₂0) Boiling Point Melting point Heat of…
A: Cooling curve is the plot of temperature versus time The independent variable which is the variable…
Q: Give handwritten answer
A:
Q: QUESTION 8 If 0.153 L of 0.104 M Na2SO4(aq) is combined with 0.175 L of 0.209 M NaCl, what is the…
A:
Q: CH3—CH2−CH,—NH—CH3 structure CH₂ CH3 CH3 CH₂ CH₂-N-CH₂-CH₂-CH3 - - CH3–CH2– NH name 0 C
A: 1. Organic compound derive from ammonia is known as amine . 2.Amine contains N and H or N and alkyl…
Q: Write the balanced equation: White phosphorus, P4, burns in air to form a compound with a mass…
A: Given that White phosphorus, P4, burns in air to form a compound with a mass percentage composition…
Q: Redox reaction: lodine Topical Solution, USP (Sodium iodide content) 1. State all the chemical…
A: This redox reaction involves S2O32- ions and I2 The half reactions are S4O62-+2e- ⇌2S2O32- Eo =0.08…
Q: Rank the following groups in order of decreasing priority (1 = highest, 4 = lowest)
A: We have been given four groups and we have to rank the given groups in order of decreasing priority…
Q: How can an ethanol be denatured?
A: Solution is made up of two components: solute and solvent. The component which is present in major…
Q: When elemental copper is strongly heated with sulfur, CuS is produced: Cu(s) + S(s) → CuS(s) What…
A:
Q: 5) What volume in mL of a concentrated solution of NaOH (6.0M) must be diluted to 200 mL to make a…
A: Given, For Concentrated solution of NaOH Concentration of NaOH solution (M1) = 6.0 M Volume of NaOH…
Q: 1. P, S, Cl and Ar. How does Z* correlate with their covalent radii. Calculate the effective nuclear…
A:
Q: Write a balanced equation to show the reaction of aqueous aluminum acetate with aqueous ammonium…
A:
Q: How many grams of H₂0 must be used to dissolve loog of sucrose (C₁2H₂20₁1) to prepare a 0.020 mole…
A: Given, the mass and mole fraction of sucrose in solution. We are asked to calculate the mass of…
Q: Question 10 of 16 > Macmillan Learning The end point of a titration was reached after 22.1 mL of…
A: 22.1 mL of 0.050 M disodium EDTA titrant was used to reach the end point of a titration .We have…
Q: BALANCE REDOX REACTION (USE THE LONG METHOD WITH CHECKINGS) Fe2+ + Cr Fe + Cr³+ CONTENT SHOULD BE…
A: Concept based on the balancing redox reactions.
Q: Identify the species represented by each curve in the fractional composition diagram of a weak base…
A:
Q: 6. 0.75 moles of aluminum sulfate dissolve in 525.0 mL of water per the reaction: Al2(SO4)3 (s)→…
A: Given, Al2(SO4)3(s) ----> 2Al3+(aq) + 3SO42-(aq) moles of Al2(SO4)3 = 0.75 moles Note: asuming no…
Q: Use Charles's law to complete the table. (Assume pressure and number of moles of gas to be…
A: Complete the first row of the table. Express the volume in litres to three significant figures.
Q: Suggest an explanation for the observation that the heat of fusion of a substance is always smaller…
A: The heat of fusion is the amount of heat required to convert solid into a liquid while that of heat…
Q: Oxytocin is a nonapeptide hormone in mammals. It is a facilitator for childbirth and breast-feeding.…
A:
Q: Examine the potential energy diagram below and answer the following questions. a.Which letter(s)…
A:
Q: BALANCE REDOX REACTION (USE THE LONG METHOD WITH CHECKINGS) MnO₂ + CrO3 → Mn + CrO4 CONTENT SHOULD…
A: this is a redox reaction.
Q: For the chemical reaction, 2NaOH+H2SO4⟶Na2SO4+2H2O2NaOH+H2SO4⟶Na2SO4+2H2O what mass of…
A: The reaction is : 2 NaOH + H2SO4 ==> Na2SO4 + 2 H2O Moles of water given = 4.87 mol Molar mass…
Q: why does Acetic acid increases the concentration of the reactant?
A: The given reversible reaction is CH3COOH(aq) <====> CH3COO- (aq) + H+(aq) LeChatelier's…
Q: Cl(aq) + CrO4²- (aq) → CIO¯ (aq) + CrO₂ (aq)
A:
Q: Draw the conformation around relevant energy diagram and newman for the below isomer with rotation…
A:
Q: BALANCE REDOX REACTION (USE THE LONG METHOD WITH CHECKINGS) SO2 + O2 → SO3 CONTENT SHOULD BE THESE…
A: this is a redox reaction
Step by step
Solved in 2 steps
- What is Reagent Grade classification of chemicals and give some examples.Identify and provide an explanation of what “Separation Science” entails and its importance with the respect to the chemical analysis of food. Provide an example.Is it acceptable to recycle the containers of hazardous chemicals? Why or why not? Explain your answer within the context of chemical safety.
- What is calibration and why is it essential in relation to food analysis? Provide examples.Chemical Manufacturers Association (CMA) and four companies that manufacture chemicals challenged a test rule promulgated by the Environmental Protection Agency (EPA) under the Toxic Substances Control Act (TSCA). The plaintiffs asserted that the EPA must find that the existence of an unreasonable risk of injury to health is more probable than not before it may issue a test rule under the Act. In response, the EPA claimed that it may issue a test rule under the TSCA if the agency determines that there is a substantial probability of an unreasonable risk of injury to health. The test rule required toxicological testing to determine the health effects of the chemical, 2-ethylhexanoic acid, and imposed on exporters of this chemical a duty to file certain notices with the EPA. What standard should be applied? Why?During a combustion test, the following observations (Table 2) were recorded. By using suitable examples, explain the findings
- Jollibee Burger Item Sodium(mg) Fat(g) Calories Item cost($) Beef Patty 50 17 220 $0.25 Bun 330 9 260 $0.15 Cheese 310 6 70 $0.10 Onions 1 2 10 $0.09 Pickles 260 0 ,. 5 $0.03 Lettuce 3 0 4 $0.04 Ketchup 160 0 20…Many common materials that we ingest, though quite safe in reasonable quantities, become toxic when taken in very large doses. A measure of toxicity is the LD 50 value (Lethal Dose, 50%). It is the quantity of material, expressed in mg of material per kg of subject-body-weight that, if administered to a population of subjects, would cause 50% of the population to die. The LD 50 value for FD&C Red Dye No. 40 is >10,000 mg/kg in rats. Assume that the LD 50 value for humans is the same as for rats. Calculate the number of number of glasses of Allura Red sports drink, each containing 8.8 mg of Allura Red, required to reach the LD 50 of 10,000 mg of Allura Red/kg body weight. Assume the person has a body weight of 165 lbs. 2.205 lbs 1 kg !! You may assume two significant figures but do not use sčientific notation. Do not include units with your answer. Your Answer: AnswerList five (5) information that you should read on a chemical container and briefly describe their significance in relation to safety.