An Ag/AgCl electrode dipping into 1.00 M HCI has a standard reduction potential of +0.2223 V. The half-reaction is AgCl(s)+e Ag(s) +Cl(aq) A second Ag/AgCl electrode is dipped into a solution containing Cl at an unknown concentration. The cell generates a potential of 0.0412 V, with the electrode in the solution of unknown concentration having a negative charge. What is the molar concentration of Cl in the unknown solution?

An Ag/AgCl electrode dipping into 1.00 M HCI has a standard reduction potential of +0.2223 V. The half-reaction is AgCl(s)+e Ag(s) +Cl(aq) A second Ag/AgCl electrode is dipped into a solution containing Cl at an unknown concentration. The cell generates a potential of 0.0412 V, with the electrode in the solution of unknown concentration having a negative charge. What is the molar concentration of Cl in the unknown solution?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter17: Electrochemistry And Its Applications

Section: Chapter Questions

Problem 107QRT

See similar textbooks

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
A galvanic cell is based on the following half-reactions: In this cell, the copper compartment contains a copper electrode and [Cu2+] = 1.00 M, and the vanadium compartment contains a vanadium electrode and V2+ at an unknown concentration. The compartment containing the vanadium (1.00 L of solution) was titrated with 0.0800 M H2EDTA2, resulting in the reaction H2EDTA2(aq)+V2+(aq)VEDTA2(aq)+2H+(aq)K=? The potential of the cell was monitored to determine the stoichiometric point for the process, which occurred at a volume of 500.0 mL H2EDTA2 solution added. At the stoichiometric point, was observed to be 1 .98 V. The solution was buffered at a pH of 10.00. a. Calculate before the titration was carried out. b. Calculate the value of the equilibrium constant, K, for the titration reaction. c. Calculate at the halfway point in the titration.
Calculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)